Grossman PPAP Database
Polycyclic polyprenylated acylphloroglucinols (bicyclo[3.3.1]nonane derivatives).
Compiled by Prof. Robert B. Grossman, University of Kentucky.
Showing 1492 compounds in 442 structures. | Alphabetical index | Footnotes | All references
| Structure and Index | R and X group(s) | Common Name | Source [a] | [α]D (°) [b] | Reference(s) | ||
|---|---|---|---|---|---|---|---|
|
|||||||
| 1.1 | R1 = i-Pr R2 = H R3 = H R4 = prenyl R5 = geranyl |
prolifenone B | H. prolificum[a] | −0.58 (1.30, m)[b] | G. E. Henry 2006 | ||
| 1.2 | R1 = i-Pr R2 = H R3 = prenyl R4 = prenyl R5 = prenyl |
hyperevolutin A | H. revolutum[a] Vahl | +84.4 (0.5, m)[b] | L. A. Decosterd 1989 | ||
| 1.3 | R1 = i-Pr R2 = prenyl R3 = H R4 = prenyl R5 = prenyl |
olympiforin B[c] | H. olympicum[a] L. | +9.8 (0.116, m)[b] | Y. Ilieva 2023 | ||
| 1.4 | R1 = i-Pr R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
hyperibine J, a.k.a. adhyperfirin, a.k.a. hyperpolyphyllirin | H. maculatum[a] Crantz, H. perforatum, H. polyphyllum, H. triquetrifolium[a] | +7.2 (1, m)[b], OMe: +7 (0.10, m)[b] | E. C. Tatsis 2007, A. Porzel 2014, K. P. Mitsopoulou 2015, P. T. Nedialkov 2015 | ||
| 1.5 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
secohyperforin | H. perforatum[a] | NR | A. Charchoglyan 2007, B. A. Sparling 2015 | ||
| 1.6 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
hyperforin[c] | H. perforatum, H. attenuatum[a] | +41 (5, e)[b] | A. I. Gurevich 1971 (includes translation), N. S. Bystrov 1975, N. S. Bystrov 1978, N. S. Bystrov 1978 (translation), D. Li 2015a | ||
| 1.7 | R1 = i-Pr R2 = prenyl R3 = CH2CH2CMe2OH R4 = prenyl R5 = H |
garcinielliptone A | G. subelliptica[a] | −33 (0.6)[b] | J.-R. Weng 2003a | ||
| 1.8 | R1 = i-Bu R2 = H R3 = geranyl R4 = prenyl R5 = H |
garcicosin | G. verrucosa[a] | −10 (0.3)[b] | M. Rajaonarivelo 2016 | ||
| 1.9 | R1 = s-Bu R2 = H R3 = H R4 = prenyl R5 = geranyl |
prolifenone A[e] | H. prolificum[a] | +13.3 (0.145, m)[b] | G. E. Henry 2006 | ||
| 1.10 | R1 = s-Bu R2 = H R3 = prenyl R4 = prenyl R5 = prenyl |
hyperevolutin B[e] | H. revolutum[a] Vahl | NR | L. A. Decosterd 1989 | ||
| 1.11 | R1 = (S)-s-Bu R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
olympiforin A[c] | H. olympicum[a] L. | +20.97 (0.102, m)[b] | Y. Ilieva 2023 | ||
| 1.12 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
adsecohyperforin[e] | H. perforatum[a] | NR | A. Charchoglyan 2007 | ||
| 1.13 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
adhyperforin[e] | H. perforatum[a] | NR | P. Maisenbacher 1992 | ||
| 1.14 | R1 = s-Bu R2 = CH2CH2CMe2OH R3 = prenyl R4 = prenyl R5 = H |
garcinielliptone D[e] | G. subelliptica[a] | −22 (0.1)[b] | J.-R. Weng 2003a | ||
| 1.15 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
nemorosone[d] | Cuban propolis, C. rosea, C. grandiflora, C. insignis, C. nemorosa[a] | +113 (0.1)[b]; OMe: +150 (0.8, m)[b] and +49 (1.4)[b] | C. M. A. de Oliveira 1996, C. M. A. de Oliveira 1999, J. Lokvam 2000, O. Cuesta Rubio 2001a, B. A. Sparling 2015 | ||
| 1.16 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
bzhyperforin[c] | H. forestii[a] | −66 (0.2, m)[b] | W.-J. Lu 2020 | ||
| 1.17 | R1 = Ph R2 = prenyl R3 = lavandulyl R4 = prenyl R5 = H |
chamone I[e] | C. grandiflora[a] | NR | J. Lokvam 2000 | ||
| 1.18 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
hydroxynemorosone | C. nemorosa[a] | OMe: +143 (0.7, m)[b] | C. M. A. de Oliveira 1996, R. Ciochina 2006 | ||
| 1.19 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (S)-isolavandulyl[g] R5 = H |
garcinialiptone D | G. subelliptica[a] | −79.1 (7.83, m)[b] | L.-J. Zhang 2010 | ||
|
|||||||
| 2.1 | R1 = i-Pr R2 = prenyl R3 = prenyl |
7-epi-secohyperforin[d] | H. sampsonii[a] | NR | L. Ernst 2024 | ||
| 2.2 | R1 = i-Pr R2 = geranyl R3 = prenyl |
no common name | H. sampsonii[a] | NR | L. Ernst 2024 | ||
| 2.3 | R1 = Ph R2 = prenyl R3 = prenyl |
plukenetione D, a.k.a. 7-epi-nemorosone, and tautomer plukenetione E[d] | C. nemorosa, C. plukenetii, H. sampsonii[a] | OAc: +34.5 (0.03)[b], −37.6 (0.1)[b]; OMe: +10.7 (3.1)[b] | G. E. Henry 1999, C. M. A. de Oliveira 1999, R. B. Grossman 2000, X.-W. Yang 2017a, L. Ernst 2024 | ||
| 2.4 | R1 = Ph R2 = prenyl R3 = (E)-4-acetoxyprenyl |
insignone | C. insignis[a] | OMe: +92.7 (1.6)[b] | A. L. M. Porto 2000 | ||
| 2.5 | R1 = Ph R2 = geranyl R3 = prenyl |
nemosampsone[d] | H. sampsonii[a] | NR | L. Ernst 2024 | ||
|
|||||||
| 3.1 | hyperfirin | H. perforatum[a] | NR | E. C. Tatsis 2007 | |||
|
|||||||
| 4.1 | R1 = i-Pr R2 = CH2CH2COMe R3 = prenyl |
hyphenone A | H. henryi[a] | +13 (0.22, m)[b] | N.-N. Jiang 2019 | ||
| 4.2 | R1 = i-Pr R2 = (E)-CH2CH=CMeCHO R3 = prenyl |
hypseudone C[c] | H. pseudohenryi[a] | +25.5 (0.157, m)[b] | N.-N. Jiang 2025 | ||
| 4.3 | R1 = i-Pr R2 = (E)-CH2CH=CMeCH(OMe)2 R3 = prenyl |
hypseudone D[c] | H. pseudohenryi[a] | +31.2 (0.078, m)[b] | N.-N. Jiang 2025 | ||
| 4.4 | R1 = i-Pr R2 = prenyl R3 = (E)-CH2CH=CMeCHO |
hyperkouytone B[c] | H. kouytchense[a] | +41.2 (0.23, m)[b] | H.-Y. Lou 2024 | ||
| 4.5 | R1 = s-Bu R2 = (E)-CH2CH=CMeCHO R3 = prenyl |
hypseudone B[c][e] | H. pseudohenryi[a] | +34.9 (0.094, m)[b] | N.-N. Jiang 2025 | ||
|
|||||||
| 5.1 | dorstenpictanone | Dorstenia picta | NR | H. Hussain 2011 | |||
|
|||||||
| 6.1 | hyperkouytone C[c] | H. kouytchense[a] | −96.0 (0.5, m)[b] | H.-Y. Lou 2024 | |||
|
|||||||
| 7.1 | R1 = i-Pr R2 = prenyl X1 = H X2 = H |
deoxyfurohyperforin A | H. perforatum[a] | +42 (0.018, mc)[b] | V. Vajs 2003 | ||
| 7.2 | R1 = i-Pr R2 = prenyl X1 = OH/H X2 = H/OH |
furohyperforin A, mixture of epimers | H. perforatum[a] | NR | S. Trifunović 1998, V. Vajs 2003 | ||
| 7.3 | R1 = i-Pr R2 = prenyl X1 = OMe X2 = H |
hyperwilsone B[c] | H. wilsonii[a] | +114.1 (0.2, acn)[b] | Y. Duan 2021c | ||
| 7.4 | R1 = i-Pr R2 = prenyl X1 = H X2 = OMe |
hyperwilsone A[c] | H. wilsonii[a] | +25.7 (0.2, acn)[b] | Y. Duan 2021c | ||
| 7.5 | R1 = (S)-s-Bu R2 = prenyl X1 = H X2 = OMe |
lancasteroid F[c] | H. lancasteri[a] | +5.8 (0.3, m)[b] | J.-Q. You 2025 | ||
| 7.6 | R1 = (S)-s-Bu R2 = prenyl X1 = OMe X2 = H |
lancasteroid E[c] | H. lancasteri[a] | +115.7 (0.3, m)[b] | J.-Q. You 2025 | ||
| 7.7 | R1 = Ph R2 = H X1 = H X2 = H |
hyperscabrone B[c] | H. scabrum[a] | −39 (0.1, m)[b] | W. Gao 2016a | ||
| 7.8 | R1 = Ph R2 = H X1 = H X2 = OMe |
lancasteroid G[c] | H. lancasteri[a] | −62.1 (0.3, m)[b] | J.-Q. You 2025 | ||
| 7.9 | R1 = Ph R2 = H X1 = OMe X2 = H |
lancasteroid H[c] | H. lancasteri[a] | +1.7 (0.3, m)[b] | J.-Q. You 2025 | ||
| 7.10 | R1 = Ph R2 = prenyl X1 = H X2 = H |
hyphenrone X[c] | H. henryi[a] H. Lév & Vaniot | −23 (0.18, m)[b] | Y. Liao 2016 | ||
| 7.11 | R1 = Ph R2 = prenyl X1 = OH X2 = H |
hypulatone F[c] | H. patulum[a] | –23 (0.1, m)[b] | Y.-F. Qiu 2026 | ||
| 7.12 | R1 = Ph R2 = prenyl X1 = OMe X2 = H |
hypseudohenrin F[c] | H. pseudohenryi[a] | +22.2 (0.86, m)[b] | H. Sun 2021b | ||
| 7.13 | R1 = Ph R2 = prenyl X1 = H X2 = OMe |
hypseudohenrin G[c] | H. pseudohenryi[a] | −14.0 (0.57, m)[b] | H. Sun 2021b | ||
|
|||||||
| 8.1 | R1 = Me R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
hyperforatin F[c] | H. perforatum[a] | +52 (0.4, m)[b] | Y. Guo 2017 | ||
| 8.2 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = H X = OH |
garsubellin A | G. subelliptica[a] | −21 (e, 1.1)[b] | Y. Fukuyama 1997, Y. Fukuyama 1998 | ||
| 8.3 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CH(OH)CMe2OH R4 = H X = OH |
hyperhimatin G[c] | H. himalaicum[a] | +48.4 (0.5, m)[b] | H. Cheng 2022b | ||
| 8.4 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X = H |
hypercohin G | H. cohaerens[a] | +42.4 (0.20, m)[b] | X. Liu 2013a | ||
| 8.5 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
furohyperforin | H. perforatum, H. attenuatum[a] | +62.4 (0.9)[b], +81.9 (0.9, m)[b], +68 (0.2)[b] | S. Trifunović 1998, L. Verotta 1999, D. Li 2015a | ||
| 8.6 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X = OOH |
33-deoxy-33-hydroperoxyfurohyperforin | H. perforatum[a] | +75 (1.2)[b] | L. Verotta 2000 | ||
| 8.7 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X = acetonyl |
hyperpatuone J[c] | H. patulum[a] | −15.00 (0.3, m)[b] | F. Zhang 2026 | ||
| 8.8 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH X = OH |
scabrumione F, a.k.a. hyperioxide F[c] | H. scabrum, H. perforatum[a] | +38.7 (0.04, m)[b], +7.2 (0.1, m)[b] | Z.-B. Zhou 2022a, X.-G. Pan 2025 | ||
| 8.9 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OOH X = OH |
hyperkouytone H, a.k.a. hyperioxide E[c] | H. kouytchense, H. perforatum[a] | +62.7 (0.3, m)[b], +8.1 (0.1, m)[b] | H.-Y. Lou 2024, X.-G. Pan 2025 | ||
| 8.10 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (R)-2,3-epoxy-3-methylbutyl X = OH |
hyperkouytone J | H. kouytchense[a] | +33.92 (0.25, m)[b] | H.-Y. Lou 2024 | ||
| 8.11 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (R)-CH2CHOHCMe=CH2 X = OH |
hyperforatin E[c] | H. perforatum[a] | +66 (0.3, m)[b] | Y. Guo 2017 | ||
| 8.12 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe=CH2 X = OH |
32-epi-hyperforatin E[c] | H. perforatum[a] | +81 (0.3, m)[b] | Y. Guo 2017 | ||
| 8.13 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = CH2C(=O)CHMe2 X = OH |
hyperforatin G[c] | H. perforatum[a] | +48 (0.6, m)[b] | Y. Guo 2017 | ||
| 8.14 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = CH2C(=O)CMe=CH2 X = OH |
hyperioxide D[c] | H. perforatum[a] | +15.3 (0.1, m)[b] | X.-G. Pan 2025 | ||
| 8.15 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (R)-CH2CHOHCMe2OH X = OH |
17R,18-dihydroxyfurohyperforin | H. perforatum, H. scabrum[a] | +26.6 (0.25, m)[b] | R.-D. Liu 2014, H. Bridi 2018, Y. C. Xiao 2018 | ||
| 8.16 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OH X = OH |
attenuatumione G[c] | H. attenuatum[a] | +40.5 (0.19)[b] | Z.-B. Zhou 2016a | ||
| 8.17 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (R)-CH2CHOHCMe2OMe X = OH |
hyperfol G, a.k.a. curvisepalumione A[c] | H. curvisepalum, H. perforatum[a] | +117.0 (0.3, m)[b] | H. Lou 2020b, Z.-B. Zhou 2022b | ||
| 8.18 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OMe X = OH |
curvisepalumione B[c] | H. curvisepalum[a] | +78.8 (0.17, m)[b] | Z.-B. Zhou 2022b | ||
| 8.19 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OEt X = OH |
hyperioxide C[c] | H. perforatum[a] | +6.6 (0.1, m)[b] | X.-G. Pan 2025 | ||
| 8.20 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe=CH2 R4 = prenyl X = OH |
hyperforatin Q[c] | H. perforatum[a] | +87.7 (0.6, m)[b] | Y. Guo 2019b | ||
| 8.21 | R1 = i-Pr R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl X = OH |
hyperformitin I[c] | H. perforatum[a] | +59 (0.2, m)[b] | Y. Guo 2021a | ||
| 8.22 | R1 = i-Pr R2 = prenyl R3 = (E)-CH=CHCMe2OOH R4 = prenyl X = OH |
hyperkouytone G | H. kouytchense[a] | +47.38 (0.3, m)[b] | H.-Y. Lou 2024 | ||
| 8.23 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe2OH R4 = prenyl X = OH |
hyperioxide B[c] | H. perforatum[a] | +60.0 (0.02, m)[b] | X.-G. Pan 2025 | ||
| 8.24 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = prenyl X = OH |
no common name | H. himalaicum[a] | +88.4 (0.2, m)[b] | G.-H. Liu 2025 | ||
| 8.25 | R1 = i-Pr R2 = (E)-CH2CH=C(Me)CHO R3 = prenyl R4 = prenyl X = OH |
hyperhookerione E[c] | H. hookerianum[a] | +140.2 (0.5, m)[b] | Z. Guo 2025b | ||
| 8.26 | R1 = i-Pr R2 = (R)-CH2CHOHCMe=CH2 R3 = prenyl R4 = prenyl X = OH |
hyperforatin S[c] | H. perforatum[a] | +62.2 (0.6, m)[b] | Y. Guo 2019b | ||
| 8.27 | R1 = i-Pr R2 = (S)-CH2CHOHCMe=CH2 R3 = prenyl R4 = prenyl X = OH |
hypericumoxide J | H. scabrum[a] | +3.4 (0.06, m)[b] | R. Liu 2017, Y. Guo 2019b | ||
| 8.28 | R1 = i-Pr R2 = (E)-CH=CHCMe2OH R3 = prenyl R4 = prenyl X = OH |
hyperfol F[c] | H. perforatum[a] | +31.35 (0.17, m)[b] | H. Lou 2020b | ||
| 8.29 | R1 = i-Pr R2 = (E)-CH=CHCMe2OOH R3 = prenyl R4 = prenyl X = OH |
hyperkouytone I | H. kouytchense[a] | +28.38 (0.17, m)[b] | H.-Y. Lou 2024 | ||
| 8.30 | R1 = i-Pr (18R,39R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hyperforatone B[c] | H. perforatum[a] | +53.0 (0.5, m)[b] | Y. Guo 2018 | ||
| 8.31 | R1 = i-Pr (18R,39S)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hypercohin D | H. cohaerens[a] | +81.5 (0.10, m)[b] | X. Liu 2013a | ||
| 8.32 | R1 = i-Pr (18S,39R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hypercohin B[c] | H. cohaerens[a] | +30.8 (0.15, m)[b] | X. Liu 2013a | ||
| 8.33 | R1 = i-Pr (18S,39S)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hyperforatone A[c] (one of two by that name) | H. perforatum[a] | +31.8 (0.3, m)[b] | Y. Guo 2018, W.-Y. Liu 2025a | ||
| 8.34 | R1 = i-Pr (18S,39R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OOH |
hyperforatone D[c] | H. perforatum[a] | +26.1 (0.4, m)[b] | Y. Guo 2018 | ||
| 8.35 | R1 = i-Pr (27R,37R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hypericumoxide K | H. scabrum[a] | +65.2 (0.07, m)[b] | R. Liu 2017 | ||
| 8.36 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = H X = OH |
garsubellin B[d][e] | G. subelliptica[a] | −36 (0.6, e)[b] | Y. Fukuyama 1998, Y. Ma 2022b | ||
| 8.37 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = H X = OH |
hyperacmosin S[c][e] (enantiomer) | G. acmosepalum[a] | +32.3 (0.52, e)[b]; +92.3 (0.05, m)[b] | Y. Ma 2022b | ||
| 8.38 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X = H |
hyperforcinol J, a.k.a. hyperiforin A[c][e] | H. forrestii[a] | +70 (0.4, m)[b], +77.3 (0.1, m)[b] | W.-J. Lu 2021, J.-F. Zong 2021 | ||
| 8.39 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
furoadhyperforin[e] | H. perforatum[a] | NR | S. Vugdelija 2000 | ||
| 8.40 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X = OOH |
hyperichoisin A[e] | H. choisianum[a] | +45.78 (0.075, m)[b] | H.-B. Zhang 2021 | ||
| 8.41 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X = acetonyl |
hyperpatuone K[c][e] | H. patulum[a] | −35 (0.3, m)[b] | F. Zhang 2026 | ||
| 8.42 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (R)-CH2CHOHCMe=CH2 X = OH |
hyperforatin T[c][e] | H. perforatum[a] | +45.5 (0.2, m)[b] | Y. Guo 2019b | ||
| 8.43 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe=CH2 X = OH |
hyperforatin U[c][e] | H. perforatum[a] | +57.3 (0.3, m)[b] | Y. Guo 2019b | ||
| 8.44 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OH X = OH |
uralione P[c][e] | H. uralum[a] | +27.2 (0.1, m)[b] | X. Li 2017 | ||
| 8.45 | R1 = s-Bu R2 = prenyl R3 = (R)-CH2CHOHCMe=CH2 R4 = prenyl X = OH |
hyperforatin R[c][e] | H. perforatum[a] | +36.0 (0.3, m)[b] | Y. Guo 2019b | ||
| 8.46 | R1 = s-Bu R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = H X = OH |
hyperhimatin H[c][e] | H. himalaicum[a] | +44.0 (0.5, m)[b] | H. Cheng 2022b | ||
| 8.47 | R1 = s-Bu R2 = CH(Pr)CH2CO2H R3 = prenyl R4 = H X = OH |
sundaicumone B[e] | Calophyllum sundaicum | +48 (0.1, e)[b] | S. Cao 2006 | ||
| 8.48 | R1 = s-Bu R2 = CH(Pr)CH2CO2H R3 = CH2CHOHCMe2OH R4 = H X = OH |
sundaicumone A[e] | Calophyllum sundaicum | +52 (0.2, e)[b] | S. Cao 2006 | ||
| 8.49 | R1 = s-Bu (18R,39S)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hypericumoxide L[e] | H. scabrum[a] | +28.6 (0.02, m)[b] | R. Liu 2017 | ||
| 8.50 | R1 = s-Bu (18S,39R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hyperforatone C[c][e] | H. perforatum[a] | +21.5 (0.5, m)[b] | Y. Guo 2018 | ||
| 8.51 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X = H |
hypermacone C[d] | H. maclarenii[a] | –78.08 (0.094, m)[b] | W.-L. Meng 2026 | ||
| 8.52 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X = OH |
hyperibone G | H. scabrum[a] | −29.3 (0.9)[b] | M. Matsuhisa 2002 | ||
| 8.53 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X = OH |
propolone D (enantiomer) | Cuban propolis | +48.5 (0.7)[b] | I. M. Hernandez 2005 | ||
| 8.54 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = H |
hypercohin H | H. cohaerens[a] | −19.0 (0.11, m)[b] | X. Liu 2013a | ||
| 8.55 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
uraloidin A, a.k.a. uralodin A | H. henryi [a]subsp. uraloides | −55.0 (0.10, m)[b] | N. Guo 2008, X.-Q. Chen 2010 | ||
| 8.56 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = OOH |
hyperforcinol H, a.k.a. hyperiforin B[c] | H. forrestii[a] | −20 (0.1, m)[b], −7.3 (0.1, m)[b] | W.-J. Lu 2021, J.-F. Zong 2021 | ||
| 8.57 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (R)-CH2CH(OH)CMe=CH2 X = OH |
hyperpatulone B[c] | H. patulum[a] | +41.7 (1.0, m)[b] | Z.-N. Wu 2019 | ||
| 8.58 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S)-CH2CH(OH)CMe=CH2 X = OH |
hyperpatulone A[c] | H. patulum[a] | +39.6 (1.0, m)[b] | Z.-N. Wu 2019 | ||
| 8.59 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (R)-CH2CH(OH)CMe2OH X = OH |
hyperpatulone D[c] (one of two by that name) | H. patulum[a] | +51.8 (1.0, m)[b] | Z.-N. Wu 2019 | ||
| 8.60 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S)-CH2CH(OH)CMe2OH X = OH |
hyperpatulone C[c] (one of two by that name) | H. patulum[a] | +56.6 (1.0)[b] | Z.-N. Wu 2019 | ||
| 8.61 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (E)-CH2CH=CMeCHO X = OH |
hyperpatuone L[c] | H. patulum[a] | +11.67 (0.3, m)[b] | F. Zhang 2026 | ||
| 8.62 | R1 = Ph R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = (E)-CH=CHCMe2OH X = OH |
kiiacylphnol F[c] | H. przewalskii[a] Maxim | −12 (0.3, m)[b] | Y. Duan 2022a | ||
| 8.63 | R1 = Ph R2 = prenyl R3 = prenyl R4 = geranyl X = OH |
kiiacylphnol E[c] | H. przewalskii[a] Maxim | +2 (0.2, m)[b] | Y. Duan 2022a | ||
| 8.64 | R1 = Ph R2 = prenyl R3 = geranyl R4 = H X = OOH |
trijapin E | Triadenum japonicum | −150 (0.2, m)[b] | A. Oya 2015 | ||
| 8.65 | R1 = Ph R2 = CH2CHOHCMe=CH2 R3 = prenyl R4 = H X = OH |
hyperibone D[e] | H. scabrum[a] | −61.9 (0.7)[b] | M. Matsuhisa 2002 | ||
| 8.66 | R1 = Ph (18S,39R)-R2 = ![]() R3 = prenyl R4 = prenyl X = OH |
hypercohin C | H. cohaerens[a] | −43.6 (0.10, m)[b] | X. Liu 2013a | ||
| 8.67 | R1 = Ph R2 = CH2COCHMe2 R3 = prenyl R4 = prenyl X = OH |
kiiacylphnol D[c] | H. przewalskii[a] Maxim | −9 (0.2, m)[b] | Y. Duan 2022a | ||
|
|||||||
| 9.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
hypercohin E | H. cohaerens[a] | +17.9 (0.10, m)[b] | X. Liu 2013a | ||
| 9.2 | R1 = i-Pr R2 = CH2CH2CMe2OH R3 = prenyl R4 = H X = OH |
garcinielliptone C | G. subelliptica[a] | −40 (0.2)[b] | J.-R. Weng 2003a | ||
| 9.3 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = H X = OH |
hyperhimatin F[c] | H. himalaicum[a] | −14.0 (0.5, m)[b]; | H. Cheng 2022b | ||
| 9.4 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
hypercohin F[e] | H. cohaerens[a] | +18.6 (0.15, m)[b] | X. Liu 2013a | ||
| 9.5 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X = OH |
hyperscabrone M[c] | H. scabrum[a] | −29.0 (0.1, m)[b] | W. Gao 2016a | ||
| 9.6 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X = OOH |
hyperscabrone A[c] | H. scabrum[a] | −37 (0.1, m)[b] | W. Gao 2016a | ||
| 9.7 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = OH |
uralione E | H. uralum[a] | −30 (0.2)[b] | Z.-B. Zhou 2016b | ||
| 9.8 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (R)-CH2CHOHCMe2OH X = OH |
uralione Q[c] | H. uralum[a] | −23.4 (0.1, m)[b] | X. Li 2017 | ||
| 9.9 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OH X = OH |
uralione R[c] | H. uralum[a] | −32.0 (0.1, m)[b] | X. Li 2017 | ||
|
|||||||
| 10.1 | hypseudohenrin L[c] | H. pseudohenryi[a] | +22.4 (0.71, m)[b] | Y.-h. Ma 2022 | |||
|
|||||||
| 11.1 | R1 = i-Pr R2 = prenyl R3 = CMe2OH R4 = prenyl R5 = H |
hyperacmosin J[n] | H. acmosepalum[a] | −122 (0.18, m)[b] | X. Wang 2020b | ||
| 11.2 | R1 = i-Pr R2 = prenyl R3 = CMe2OH R4 = (R)-CH2CHOHCMe2OH R5 = H |
hyperhimatin J[c] | H. himalaicum[a] | +116.7 (0.5, m)[b] | H. Cheng 2022b | ||
| 11.3 | R1 = i-Pr R2 = prenyl R3 = CMe2OH R4 = (R)-CH2CHOHCMe2OH R5 = prenyl |
hyperioxide A[c] | H. perforatum[a] | +70.0 (0.02, m)[b] | X.-G. Pan 2025 | ||
| 11.4 | R1 = i-Pr R2 = prenyl R3 = (2R)-5-oxo-2-methyltetrahydrofuran-2-yl R4 = prenyl R5 = H |
hyperhookerione F[d] | H. hookerianum[a] | −128.8 (0.5, m)[b] | Z. Guo 2025b | ||
| 11.5 | R1 = i-Pr R2 = prenyl R3 = (2S)-5-oxo-2-methyltetrahydrofuran-2-yl R4 = prenyl R5 = H |
hyperhookerione G[d] | H. hookerianum[a] | −146.2 (0.5, m)[b] | Z. Guo 2025b | ||
| 11.6 | R1 = i-Pr R2 = prenyl R3 = (R)-2-hydroxy-6-methyl-5-hepten-2-yl R4 = (R)-CH2CH(OH)CMe2OH R5 = H |
no common name | H. himalaicum[a] | −32.0 (0.1, m)[b] | G.-H. Liu 2025 | ||
| 11.7 | R1 = i-Pr R2 = geranyl R3 = CMe2OH R4 = prenyl R5 = H |
hyperacmosin B[c] | H. acmosepalum[a] | −53.0 (0.502, m)[b] | J. Wang 2019, J. Wang 2022 | ||
| 11.8 | R1 = s-Bu R2 = prenyl R3 = CMe2OH R4 = (R)-CH2CHOHCMe2OH R5 = H |
hyperhimatin L[c] | H. himalaicum[a] | +71.3 (0.5, m)[b] | H. Cheng 2022b | ||
| 11.9 | R1 = Ph R2 = prenyl R3 = H R4 = prenyl R5 = H |
hypersampsone R, a.k.a. hyperattenin B[d] (one of two by the first name) | H. attenuatum[a] Choisy, H. sampsonii[a] | +22.0 (0.3)[b], +43.9 (0.19)[b] | W.-J. Tian 2014c, D. Li 2015a | ||
| 11.10 | R1 = Ph R2 = prenyl R3 = OH R4 = prenyl R5 = H |
hyperattenin A[d] | H. attenuatum[a] Choisy | +38.3 (0.92)[b] | D. Li 2015a | ||
| 11.11 | R1 = Ph R2 = prenyl R3 = C(=O)Me R4 = prenyl R5 = H |
hypersampsonone I[d] | H. sampsonii[a] | +17.5 (1.0, m)[b] | Y. Li 2023 | ||
| 11.12 | R1 = Ph R2 = prenyl R3 = i-Pr R4 = prenyl R5 = prenyl |
hypermacone B[c] | H. maclarenii[a] | +8.65 (0.074, m)[b] | W.-L. Meng 2026 | ||
| 11.13 | R1 = Ph R2 = prenyl R3 = CMe2OH R4 = prenyl R5 = H |
sampsonione L | H. sampsonii[a] | +55 (0.06)[b] | L.-H. Hu 2000 | ||
| 11.14 | R1 = Ph R2 = prenyl R3 = CMe2OH R4 = (E)-CH=CHCMe2OH R5 = H |
hyperibone F | H. scabrum[a] | −31.0 (0.2)[b] | M. Matsuhisa 2002, R. Ciochina 2006 | ||
| 11.15 | R1 = Ph R2 = prenyl R3 = (S)-2-hydroxy-6-methyl-5-hepten-2-yl R4 = prenyl R5 = H |
sampsonione K | H. sampsonii[a] | −5.6 (1.1)[b] | L.-H. Hu 2000, Z.-B. Zhou 2014 | ||
| 11.16 | R1 = Ph R2 = prenyl R3 = (R)-2-hydroxy-6-methyl-5-hepten-2-yl R4 = prenyl R5 = H |
attenuatumione C | H. attenuatum[a] | +20.9 (0.15)[b] | Z.-B. Zhou 2014 | ||
| 11.17 | R1 = Ph R2 = prenyl R3 = (R)-2-hydroxy-6-methyl-5-hepten-2-yl R4 = (S)-CH2CH(OH)CMe2OH R5 = H |
no common name | H. himalaicum[a] | +37.3 (0.1, m)[b] | G.-H. Liu 2025 | ||
| 11.18 | R1 = Ph R2 = prenyl R3 = (R)-5-oxo-2-methyltetrahydrofuran-2-yl R4 = prenyl R5 = H |
hyperisampsin I[d] | H. sampsonii[a] | +42 (0.2)[b] | H. Zhu 2015b | ||
| 11.19 | R1 = Ph R2 = prenyl R3 = (S)-5-oxo-2-methyltetrahydrofuran-2-yl R4 = prenyl R5 = H |
hyperisampsin H[d] | H. sampsonii[a] | +4 (0.2)[b] | H. Zhu 2015b | ||
| 11.20 | R1 = Ph R2 = prenyl (3R,6S)-R3 = R4 = prenyl R5 = H X = OH |
hyperisampsin J[d] | H. sampsonii[a] | +21 (0.3, m)[b] | H. Zhu 2015b | ||
| 11.21 | R1 = Ph R2 = prenyl (3R,6S)-R3 = R4 = prenyl R5 = H X = OOH |
hyperisampsin K[d] | H. sampsonii[a] | +12 (0.4)[b] | H. Zhu 2015b | ||
| 11.22 | R1 = Ph R2 = prenyl (3S,6R)-R3 = R4 = prenyl R5 = H X = OH |
hyperisampsin M[d] | H. sampsonii[a] | +47 (0.1)[b] | H. Zhu 2015b | ||
| 11.23 | R1 = Ph R2 = prenyl (3S,6R)-R3 = R4 = prenyl R5 = H X = OOH |
hyperisampsin L[d] | H. sampsonii[a] | +9 (0.1, m)[b] | H. Zhu 2015b | ||
| 11.24 | R1 = Ph R2 = CH2CHOHCMe=CH2 R3 = CMe2OH R4 = (E)-CH=CHCMe2OH R5 = H |
hyperibone E[e] | H. scabrum[a] | −56.0 (0.2)[b] | M. Matsuhisa 2002, R. Ciochina 2006 | ||
|
|||||||
| 12.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl |
hyperscabin H[d] | H. scabrum[a] | +21.5 (0.11, mc)[b] | J. Ma 2021b | ||
| 12.2 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe2OH R4 = H |
hyperhimatin I[c] | H. himalaicum[a] | +40.2 (0.5, m)[b] | H. Cheng 2022b | ||
| 12.3 | R1 = i-Pr R2 = CH2CO2H R3 = prenyl R4 = H |
hyperhimatin D[c] | H. himalaicum[a] | +6.2 (0.5, m)[b] | H. Cheng 2022b | ||
| 12.4 | R1 = i-Pr R2 = geranyl R3 = prenyl R4 = H |
hyperacmosin A[c] | H. acmosepalum[a] | +87.8 (0.337, m)[b] | J. Wang 2019, J. Wang 2022 | ||
| 12.5 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl |
hyperscabin I[d][e] | H. scabrum[a] | +23.1 (0.10, mc)[b] | J. Ma 2021b | ||
| 12.6 | R1 = s-Bu R2 = prenyl R3 = (R)-CH2CHOHCMe2OH R4 = H |
hyperhimatin K[c][e] | H. himalaicum[a] | +37.7 (0.5, m)[b] | H. Cheng 2022b | ||
| 12.7 | R1 = s-Bu R2 = CH2CO2H R3 = prenyl R4 = H |
hyperhimatin E[c][e] | H. himalaicum[a] | +20.0 (0.5, m)[b] | H. Cheng 2022b | ||
|
|||||||
| 13.1 | otogirinin E[e] | H. erectum[a] Thunb. | NR | Y. Ishida 2010 | |||
|
|||||||
| 14.1 | R = i-Pr | hyperwilsone J[c] | H. wilsonii[a] | −44.8 (0.4, m)[b] | Y. Duan 2021c | ||
| 14.2 | R = s-Bu | hyperwilsone K[c][e] | H. wilsonii[a] | −6.96 (0.4, m)[b] | Y. Duan 2021c | ||
|
|||||||
| 15.1 | R = i-Pr | kiiacylphnol A[c] | H. przewalskii[a] Maxim | +13 (0.1, m)[b] | Y. Duan 2022a | ||
| 15.2 | R = s-Bu | kiiacylphnol B[c][e] | H. przewalskii[a] Maxim | +22 (0.6, m)[b] | Y. Duan 2022a | ||
|
|||||||
| 16.1 | R1 = i-Pr R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone D[c] | H. monogynum[a] | +69 (0.3, m)[b] | W.-J. Xu 2015 | ||
| 16.2 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garcinielliptone L[d] | G. subelliptica[a] | −41 (0.3)[b] | J.-R. Weng 2004, X.-W. Yang 2017a, Y. Guo 2021a | ||
| 16.3 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperformitin L[c] (enantiomer) | H. perforatum[a] | +60 (0.2, m)[b] | Y. Guo 2021a | ||
| 16.4 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furohyperforin isomer 2, a.k.a. attenuatumione E[c] | H. attenuatum, H. perforatum[a] | +39.7 (0.13)[b] | J.-y. Lee 2006, C. Hashida 2008, Z.-B. Zhou 2014, X.-W. Yang 2018, Y.-F. Qiu 2023 | ||
| 16.5 | R1 = i-Pr R2 = CMe=CH2 R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypertum H[c] | H. perforatum[a] | +85.7 (0.05, m)[b] | W.-Y. Liu 2025b | ||
| 16.6 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hyperforatin B[c] | H. perforatum[a] | +106 (0.3, m)[b] | Y. Guo 2017 | ||
| 16.7 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
hyperformitin E, a.k.a. scabrumione D[c] | H. perforatum, H. scabrum[a] | +63 (0.6, m)[b], +61.5 (0.1, m)[b] | Y. Guo 2021a, Z.-B. Zhou 2022a, Y.-F. Qiu 2023 | ||
| 16.8 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OMe X1 = H X2 = H |
15-epi-hyperforatin D[c] | H. perforatum[a] | +54 (0.6, m)[b] | Y. Guo 2017 | ||
| 16.9 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe=CH2 X1 = H X2 = H |
32-epi-hyperforatin A[c] | H. perforatum[a] | +78 (0.6, m)[b] | Y. Guo 2017 | ||
| 16.10 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CH(OH)CMe=CH2 X1 = H X2 = H |
hyperforatin A[c] | H. perforatum[a] | +84 (0.5, m)[b] | Y. Guo 2017 | ||
| 16.11 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe2OH X1 = H X2 = H |
curvisepalumione C[c] | H. himalaicum, H. curvisepalum[a] N. Robson | +37.1 (0.1, m)[b], +32.1 (0.5, m)[b] | G.-H. Liu 2025, M.-M. Cao 2025 | ||
| 16.12 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CH(OH)CMe2OH X1 = H X2 = H |
no common name | H. himalaicum[a] | +36.7 (0.1, m)[b] | G.-H. Liu 2025 | ||
| 16.13 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe2OH X1 = H X2 = OH |
hyperuraline B[c] | H. uralum[a] | +14.1 (0.10)[b] | J. Hu 2025 | ||
| 16.14 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (3R)-2,3-epoxy-3-methylbutyl X1 = H X2 = OH |
hypersampine A[c] | H. sampsonii[a] | +20.9 (NR, m)[b] | X.-P. Wang 2024 | ||
| 16.15 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl X1 = H X2 = H |
hyperformitin A, a.k.a. scabrumione A[c] | H. perforatum, H. scabrum[a] | +162 (0.3, m)[b], +147.6 (0.1, m)[b] | Y. Guo 2021a, Z.-B. Zhou 2022a, Y.-F. Qiu 2023 | ||
| 16.16 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (R)-CH2CHOHCMe=CH2 R5 = prenyl X1 = H X2 = H |
hyperforatin O[c] | H. perforatum[a] | +57.5 (0.3, m)[b] | Y. Guo 2019b | ||
| 16.17 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (S)-CH2CHOHCMe=CH2 R5 = prenyl X1 = H X2 = H |
hyperforatin P[c] | H. perforatum[a] | +14.2 (0.1, m)[b] | Y. Guo 2019b | ||
| 16.18 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (R)-CH2CHOHCMe2OH R5 = prenyl X1 = H X2 = H |
uralione O[c] | H. uralum[a] | +28.6 (0.1, m)[b] | X. Li 2017, Y.-F. Qiu 2023 | ||
| 16.19 | R1 = i-Pr R2 = CMe2OH R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperformitin C, a.k.a. scabrumione C[c] | H. perforatum, H. scabrum[a] | +94 (0.5, m)[b], +103.0 (0.1, m)[b] | Y. Guo 2021a, Z.-B. Zhou 2022a, Y.-F. Qiu 2023 | ||
| 16.20 | R1 = i-Pr R2 = CMe2OH R3 = CH2CH(OH)CMe2OH R4 = prenyl R5 = (R)-2,3-epoxy-3-methylbutyl X1 = H X2 = H |
hyperuraline A[e] | H. uralum[a] | +19.8 (0.10)[b] | J. Hu 2025 | ||
| 16.21 | R1 = i-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
ascynol L[c] | H. ascyron[a] | +20 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 16.22 | R1 = (S)-s-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone B[c] | H. ascyron, H. monogynum[a] | +80 (0.2, m)[b] | W.-J. Xu 2015, L.-M. Kong 2017 | ||
| 16.23 | R1 = s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furoadhyperforin isomer 2a[e] | H. perforatum[a] | +66 (0.08, m)[b] | J.-B. Yang 2016 | ||
| 16.24 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperascyrin E[c] | H. ascyron[a] | +16 (0.1, m)[b] | J.-W. Hu 2018 | ||
| 16.25 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hyperascyrin H[c] | H. ascyron[a] | +28 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 16.26 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = OH |
hyperascyrin G[c] | H. ascyron[a] | +12 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 16.27 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperibrin F[c] | H. scabrum[a] | −50.8 (0.07, m)[b] | J. Hu 2017 | ||
| 16.28 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
propolone C, a.k.a. garcinielliptone K[d] (enantiomer) | Cuban propolis, G. subelliptica[a] | +35.7 (0.2)[b], +27 (0.3)[b] | J.-R. Weng 2004, I. M. Hernandez 2005, X.-W. Yang 2017a | ||
| 16.29 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe2OH X1 = H X2 = H |
ascyronine A[c] | H. ascyron[a] | −15.5 (0.1, m)[b] | E.-H. Zhang 2023 | ||
| 16.30 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
ascyronone F, a.k.a. uralione G[c] | H. ascyron, H. uralum[a] | +36.5 (0.1, m)[b], +17 (0.1)[b] | Z. P. Li 2019, Z.-B. Zhou 2016b, Y.-F. Qiu 2023 | ||
|
|||||||
| 17.1 | R1 = i-Pr R2 = i-Pr R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermacone E[c] | H. maclarenii[a] | −9.21 (0.089, m)[b] | W.-L. Meng 2026 | ||
| 17.2 | R1 = i-Pr R2 = CMe=CH2 R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermacone D[c] | H. maclarenii[a] | +7.84 (0.102, m)[b] | W.-L. Meng 2026 | ||
| 17.3 | R1 = i-Pr R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone C[c] | H. monogynum[a] | −8 (0.2, m)[b] | W.-J. Xu 2015 | ||
| 17.4 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garcinielliptone M[d] | G. subelliptica[a] | +73 (0.2)[b] | J.-R. Weng 2004, X.-W. Yang 2017a, Y. Guo 2021a | ||
| 17.5 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperformitin M[c] (enantiomer) | H. perforatum[a] | −48 (0.1, m)[b] | Y. Guo 2021a | ||
| 17.6 | R1 = i-Pr R2 = CMe2OH R3 = (R)-CH2CH(OH)CMe2OH R4 = prenyl R5 = H X1 = H X2 = H |
hyperhimatin P[c] | H. himalaicum[a] | −44.7 (0.5, m)[b] | H. Cheng 2022b | ||
| 17.7 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
attenuatumione F, a.k.a. hyperscabin G[c] | H. attenuatum, H. scabrum[a] | +19.6 (0.18)[b], +28.4 (0.1, mc)[b] | Z.-B. Zhou 2014, J. Ma 2021b, Y.-F. Qiu 2023 | ||
| 17.8 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hyperforatin C[c] | H. perforatum[a] | +12 (0.5, m)[b] | Y. Guo 2017 | ||
| 17.9 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = 2,3-epoxy-3-methylbutyl X1 = H X2 = H |
hypericumoxide A[e] | H. scabrum[a] | +12.5 (0.06, m)[b] | R. Liu 2017, Y.-F. Qiu 2023 | ||
| 17.10 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
hyperformitin F[c] | H. perforatum[a] | +10 (0.1, m)[b] | Y. Guo 2021a | ||
| 17.11 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OMe X1 = H X2 = H |
hyperforatin D[c] | H. perforatum[a] | +12 (0.5, m)[b] | Y. Guo 2017 | ||
| 17.12 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe=CH2 X1 = H X2 = H |
hyperforatin L[c] | H. perforatum[a] | −7.5 (0.6, m)[b] | Y. Guo 2019b | ||
| 17.13 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CH(OH)CMe=CH2 X1 = H X2 = H |
hyperforatin M[c] | H. perforatum[a] | +5.2 (0.3, m)[b] | Y. Guo 2019b | ||
| 17.14 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe2OH X1 = H X2 = H |
hypericumoxide B[c] | H. scabrum[a] | −12.5 (0.08, m)[b] | R. Liu 2017, Y.-F. Qiu 2023 | ||
| 17.15 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (S)-CH2CH(OH)CMe=CH2 R5 = prenyl X1 = H X2 = H |
hyperforatin N[c] | H. perforatum[a] | +35.0 (0.2, m)[b] | Y. Guo 2019b | ||
| 17.16 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = H X1 = H X2 = H |
hyperhimatin O[c] | H. himalaicum[a] | −6.2 (0.5, m)[b] | H. Cheng 2022b | ||
| 17.17 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl X1 = H X2 = H |
hyperformitin B[c] | H. perforatum[a] | +70 (0.3, mc)[b] | Y. Guo 2021a | ||
| 17.18 | R1 = i-Pr R2 = CMe2OH R3 = (R)-CH2CH(OH)CMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypericumoxide C[c] | H. scabrum[a] | +14.7 (0.03, m)[b] | R. Liu 2017, Y.-F. Qiu 2023 | ||
| 17.19 | R1 = i-Pr R2 = CMe2OH R3 = (S)-CH2CH(OH)CMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = H |
uralione K[c] | H. uralum[a] | +6 (0.1)[b] | Z.-B. Zhou 2016b, Y.-F. Qiu 2023 | ||
| 17.20 | R1 = i-Pr R2 = CMe2OH R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperformitin D, a.k.a. scabrumione B[c] | H. perforatum, H. scabrum[a] | +31 (0.3, m)[b], +61.5 (0.1, m)[b] | Z.-B. Zhou 2016b, Y. Guo 2021a, Y.-F. Qiu 2023 | ||
| 17.21 | R1 = i-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
ascynol M[c] | H. ascyron[a] | −15 (0.21, m)[b] | Y.-L. Hu 2025 | ||
| 17.22 | R1 = (S)-s-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone A[c] | H. monogynum[a] | +9 (0.2, m)[b] | W.-J. Xu 2015 | ||
| 17.23 | R1 = s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furoadhyperforin isomer 2b[c] | H. scabrum, H. cohaerens[a] | +24 (0.06, m)[b] | J.-B. Yang 2016 | ||
| 17.24 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperascyrin F[c] | H. ascyron[a] | −48 (0.4, m)[b] | J.-W. Hu 2018 | ||
| 17.25 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = OH |
hyperascyrin I[c] | H. ascyron[a] | −35 (0.1, m)[b] | J.-W. Hu 2018 | ||
| 17.26 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperibrin C[c] | H. scabrum[a] | +92.5 (0.10, m)[b] | W. Gao 2016c | ||
| 17.27 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
uralione F[c] | H. uralum[a] | −32 (0.3)[b] | Z.-B. Zhou 2016b, Y.-F. Qiu 2023 | ||
| 17.28 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = prenyl R4 = (S)-isolavandulyl[g] R5 = H X1 = H X2 = H |
garcinialiptone C | G. subelliptica[a] | −94.0 (0.86, m)[b] | L.-J. Zhang 2010 | ||
|
|||||||
| 18.1 | R = prenyl | sampsonione N | H. sampsonii[a] | +22.0 (0.090)[b] | Z. Y. Xiao 2007, Y.-F. Qiu 2023 | ||
| 18.2 | R = geranyl | hyperacmosin O, a.k.a. hypersampsonone H[d] | H. acmosepalum, H. sampsonii[a] | −1.5 (0.1, m)[b], + 7.5 (1.0, m)[b] | M.-x. Sun 2021b, Y. Li 2023 | ||
|
|||||||
| 19.1 | R = geranyl X = H |
sampsonione M | H. sampsonii[a] | +55 (0.04)[b] | L.-H. Hu 2000 | ||
| 19.2 | R = (R)-lavandulyl[f] X = OMe |
garcimultiflorone M[c][t][u][x] | G. multiflora[a] | −32.8 (0.060, m)[b] | Z.-Q. Wang 2018 | ||
|
|||||||
| 20.1 | lathrophytoic acid B | Kielmeyera lathrophyton | NR | M. F. de Almeida 2011 | |||
|
|||||||
| 21.1 | R1 = i-Pr R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone H[c] | H. monogynum[a] | +61 (0.2, m)[b] | W.-J. Xu 2015 | ||
| 21.2 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garsubellin C[d] | G. subelliptica[a] | +39 (0.4, e)[b] | Y. Fukuyama 1997, Y. Fukuyama 1998, Y. Guo 2021a | ||
| 21.3 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperformitin K[c] (enantiomer) | H. perforatum[a] | −56 (0.4, e)[b] | Y. Guo 2021a | ||
| 21.4 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
18-epi-furohyperforin isomer 1[r] | H. perforatum[a] | +15 (0.3, m)[b] | C. Hashida 2008, X.-W. Yang 2018 | ||
| 21.5 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hyperforatin K[c] | H. perforatum[a] | −13 (0.5, m)[b] | Y. Guo 2017 | ||
| 21.6 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OEt X2 = H |
hyperacmosin P[c] | H. acmosepalum[a] | −19.2 (0.1, m)[b] | M.-x. Sun 2021b | ||
| 21.7 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe2OH X1 = H X2 = H |
uralione L[c] | H. uralum[a] | −29.0 (0.1, m)[b] | X. Li 2017 | ||
| 21.8 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CH(OH)CMe=CH2 X1 = H X2 = H |
15-epi-hyperforatin I[c] | H. perforatum[a] | −28 (0.3, m)[b] | Y. Guo 2017 | ||
| 21.9 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CH(OH)CMe2OH X1 = H X2 = H |
hyperidione F[c] | H. perforatum[a] | −30.0 (0.010, m)[b] | X.-G. Pan 2024 | ||
| 21.10 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CH(OH)CMe2OMe X1 = H X2 = H |
curvisepalumione D[c] | H. curvisepalum[a] N. Robson | −23.3 (0.5, m)[b] | M.-M. Cao 2025 | ||
| 21.11 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
hyperidione E[c] | H. perforatum[a] | +1.5 (0.033, m)[b] | X.-G. Pan 2024 | ||
| 21.12 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (R)-CH2CH(OH)CMe2OH R5 = prenyl X1 = H X2 = H |
hyperidione C[c] | H. perforatum[a] | +20.0 (0.020, m)[b] | X.-G. Pan 2024 | ||
| 21.13 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (S)-CH2CH(OH)CMe2OH R5 = prenyl X2 = H X2 = H |
no common name | H. himalaicum[a] | +29.7 (0.1, m)[b] | G.-H. Liu 2025 | ||
| 21.14 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl X1 = H X2 = H |
hyperformitin H[c] | H. perforatum[a] | +88 (0.3, m)[b] | Y. Guo 2021a | ||
| 21.15 | R1 = i-Pr R2 = CMe2OH R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypericumoxide D | H. scabrum[a] | +9.8 (0.07, m)[b] | R. Liu 2017 | ||
| 21.16 | R1 = i-Pr R2 = CMe2OH R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl X1 = H X2 = OH |
ascyronine B[c] | H. ascyron[a] | +13.9 (0.1, m)[b] | E.-H. Zhang 2023 | ||
| 21.17 | R1 = i-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
ascynol N[c] | H. ascyron[a] | +44 (0.2, m)[b] | Y.-L. Hu 2025 | ||
| 21.18 | R1 = i-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperwilsone E[c] | H. wilsonii[a] | −16.8 (0.6, m)[b] | Y. Duan 2021c | ||
| 21.19 | R1 = (S)-s-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone F[c] | H. monogynum[a] | −44 (0.1, m)[b] | W.-J. Xu 2015 | ||
| 21.20 | R1 = s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furoadhyperforin isomer B[e][s] | H. perforatum[a] | +14 (1.5)[b] | C. Hashida 2008, X.-W. Yang 2018 | ||
| 21.21 | R1 = Ph R2 = CMe=CH2 R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermacone A[c] | H. maclarenii[a] | –65.71 (0.07, m)[b] | W.-L. Meng 2026 | ||
| 21.22 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperascyrin A[c] | H. ascyron[a] | −80 (0.1, m)[b] | J.-W. Hu 2018 | ||
| 21.23 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = OH |
hyperascyrin C[c] | H. ascyron[a] | −67 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 21.24 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperibone A | H. scabrum[a] | +57 (0.2)[b], +63.7 (0.4)[b] | M. Matsuhisa 2002, I. M. Hernandez 2005 | ||
| 21.25 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garcinielliptone I (enantiomer) | G. subelliptica[a] | −37.7 (1.1)[b] | J.-R. Weng 2003b, R. Ciochina 2006 | ||
| 21.26 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
uralodin B | H. henryi [a]subsp. uraloides | −24.6 (0.075, m)[b] | X.-Q. Chen 2010 | ||
| 21.27 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hypercohin J | H. cohaerens[a] | −4.8 (0.09, m)[b] | X. Liu 2013a, X.-W. Yang 2018 | ||
| 21.28 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = OH |
hyperbeanin D[c] | H. beanii[a] | +0.9 (0.11, m)[b] | Y. Ma 2022a | ||
| 21.29 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
dihroxuralodin | H. petiolulatum[a] | −27.9 (0.10, m)[b] | T. Rui 2017 | ||
|
|||||||
| 22.1 | hyperwilsone C[c] | H. wilsonii[a] | −36.3 (0.3, m)[b] | Y. Duan 2021c | |||
|
|||||||
| 23.1 | R1 = i-Pr R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone G[c] | H. monogynum[a] | +34 (0.3, m)[b] | W.-J. Xu 2015 | ||
| 23.2 | R1 = i-Pr R2 = CMe2OH R3 = Me R4 = prenyl R5 = (S)-CH2CHOHCMe2OH X1 = H X2 = H |
hypermongone I[c] | H. monogynum[a] | +6 (0.1, m)[b] | W.-J. Xu 2015 | ||
| 23.3 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garsubellin D[d] | G. subelliptica[a] | −12 (0.4, e)[b] | Y. Fukuyama 1998, Y. Guo 2021a | ||
| 23.4 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperformitin J[c] (enantiomer) | H. perforatum[a] | +18 (0.4, e)[b] | Y. Guo 2021a | ||
| 23.5 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = OH |
garcinielliptone P | G. subelliptica[a] | −2 (1.6)[b] | K.-W. Lin 2011 | ||
| 23.6 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furohyperforin isomer 1[r] | H. perforatum[a] | +50 (0.7)[b] | J.-y. Lee 2006, C. Hashida 2008, X.-W. Yang 2018 | ||
| 23.7 | R1 = i-Pr R2 = CMe=CH2 R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypertum I[c] | H. perforatum[a] | +60.3 (0.04, m)[b] | W.-Y. Liu 2025b | ||
| 23.8 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = OH X2 = H |
hyperforatin J[c] | H. perforatum[a] | +44 (0.5, m)[b] | Y. Guo 2017 | ||
| 23.9 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
hypericumoxide F | H. scabrum[a] | +10.7 (0.09, m)[b] | R. Liu 2017 | ||
| 23.10 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CHOHCMe2OH X1 = H X2 = H |
uralione M[c] | H. uralum[a] | +28.6 (0.1, m)[b] | X. Li 2017 | ||
| 23.11 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (S)-CH2CHOHCMe2OH X1 = H X2 = H |
uralione N[c] | H. uralum[a] | +38.8 (0.1, m)[b] | X. Li 2017 | ||
| 23.12 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = CH2C(=O)CHMe2 X1 = H X2 = H |
hyperforatin H[c] | H. perforatum[a] | +34 (0.5, m)[b] | Y. Guo 2017 | ||
| 23.13 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CHOHCMe=CH2 X1 = H X2 = H |
hyperforatin I[c] | H. perforatum[a] | +23 (0.4, m)[b] | Y. Guo 2017 | ||
| 23.14 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = H X1 = H X2 = H |
hyperhimatin M[c] | H. himalaicum[a] | +37.8 (0.5, m)[b] | H. Cheng 2022b | ||
| 23.15 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl X1 = H X2 = H |
hyperformitin G[c] | H. perforatum[a] | +17 (0.3, m)[b] | Y. Guo 2021a | ||
| 23.16 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (S)-CH2CHOHCMe2OH R5 = H X1 = H X2 = H |
hyperhimatin N[c] | H. himalaicum[a] | +27.1 (0.5, m)[b] | H. Cheng 2022b | ||
| 23.17 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (R)-CH2CHOHCMe2OH R5 = prenyl X1 = H X2 = H |
hypericumoxide E[c] | H. scabrum[a] | +9.8 (0.07, m)[b] | R. Liu 2017 | ||
| 23.18 | R1 = i-Pr R2 = CMe2OH R3 = prenyl R4 = (E)-CH=CHCMe2OOH R5 = (S)-CH2CHOHCMe2OH X1 = H X2 = H |
hyperidione A[c] | H. perforatum[a] | +20.0 (0.025, m)[b] | X.-G. Pan 2024 | ||
| 23.19 | R1 = i-Pr R2 = CMe2OH R3 = CH2CH(OH)CMe2OH R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
ascyronine C[c][e] | H. ascyron[a] | +11.9 (0.1, m)[b] | E.-H. Zhang 2023 | ||
| 23.20 | R1 = i-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
ascynol O[c] | H. ascyron[a] | −55 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 23.21 | R1 = i-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperwilsone D[c] | H. wilsonii[a] | +37.6 (0.4, m)[b] | Y. Duan 2021c | ||
| 23.22 | R1 = (S)-s-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hypermongone E[c] | H. monogynum[a] | +9 (0.2, m)[b] | W.-J. Xu 2015 | ||
| 23.23 | R1 = (S)-s-Bu R2 = CMe2OH R3 = Me R4 = prenyl R5 = (R)-CH2CHOHCMe2OH X1 = H X2 = H |
hypermongone J[c] | H. monogynum[a] | +6 (0.1, m)[b] | W.-J. Xu 2015 | ||
| 23.24 | R1 = s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
garsubellin E[e] | G. subelliptica[a] | −7 (e, 0.4)[b] | Y. Fukuyama 1998 | ||
| 23.25 | R1 = s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
furoadhyperforin isomer A[e][s] | H. perforatum[a] | +34 (0.9)[b] | C. Hashida 2008, X.-W. Yang 2018 | ||
| 23.26 | R1 = (R)-s-Bu R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (R)-CH2CHOHCMe2OH X1 = H X2 = H |
hyperidione B[c] | H. perforatum[a] | +120.0 (0.010, m)[b] | X.-G. Pan 2024 | ||
| 23.27 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = H |
hyperascyrin B[c] | H. ascyron[a] | −5 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 23.28 | R1 = Ph R2 = CMe2OH R3 = Me R4 = prenyl R5 = prenyl X1 = H X2 = OH |
hyperascyrin D[c] | H. ascyron[a] | +3 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 23.29 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
hyperibone B | H. scabrum[a], Cuban propolis | −20.8 (0.5)[b], −42.2 (0.1)[b] | M. Matsuhisa 2002, I. M. Hernandez 2005 | ||
| 23.30 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = H X1 = H X2 = H |
ochrocarpinone C[o][p] (perhaps enantiomer) | Ochrocarpos punctatus | +0.21 (0.38)[b] | V. S. P. Chaturvedula 2002 | ||
| 23.31 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = prenyl X1 = H X2 = H |
uralodin C | H. henryi [a]subsp. uraloides | −55.0 (0.010, m)[b] | X.-Q. Chen 2010 | ||
| 23.32 | R1 = Ph R2 = CMe2OH R3 = prenyl R4 = prenyl R5 = (E)-CH=CHCMe2OH X1 = H X2 = H |
hypersampine B[c] | H. sampsonii[a] | +13.9 (0.10, m)[b] | X.-P. Wang 2024 | ||
| 23.33 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = prenyl R4 = (R)-lavandulyl[f] R5 = H X1 = H X2 = H |
garcinielliptone FB | G. subelliptica[a] | −66 (0.2)[b] | C.-C. Wu 2005 | ||
|
|||||||
| 24.1 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe2OH R4 = prenyl X = H |
hyperidione D[c] | H. perforatum[a] | +26.0 (0.050, m)[b] | X.-G. Pan 2024 | ||
| 24.2 | R1 = i-Pr R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl X = H |
scabrumione E | H. scabrum[a] | +4.5 (0.04, m)[b] | Z.-B. Zhou 2022a | ||
| 24.3 | R1 = i-Pr R2 = geranyl R3 = prenyl R4 = prenyl X = H |
hyperwilone D[d] | H. wilsonii[a] | +50.0 (0.74)[b] | J. Hao 2021 | ||
| 24.4 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = H |
hypersampsone U[d] | H. sampsonii[a] | +28.2 (0.50)[b] | W.-J. Tian 2016 | ||
| 24.5 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X = OMe |
garcimultinone G[d] | G. multiflora[a] | +159.26 (0.02, m)[b] | H. Teng 2021 | ||
| 24.6 | R1 = Ph R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl X = H |
hyperibone C | H. scabrum[a] | −27.3 (0.3)[b] | M. Matsuhisa 2002, R. Ciochina 2006 | ||
| 24.7 | R1 = Ph R2 = geranyl R3 = prenyl R4 = prenyl X = H |
hyperattenin C[d] | H. attenuatum[a] Choisy | −8.4 (0.13, m)[b] | D. Li 2015a | ||
| 24.8 | R1 = Ph R2 = geranyl R3 = prenyl R4 = prenyl X = OEt |
hyperattenin D[d] | H. attenuatum[a] Choisy | +100.4 (0.42, m)[b] | D. Li 2015a | ||
| 24.9 | R1 = Ph R2 = (S)-lavandulyl[f] R3 = prenyl R4 = prenyl X = H |
garcimultinone F[d] | G. multiflora[a] | +186.27 (0.02, m)[b] | H. Teng 2021 | ||
| 24.10 | R1 = 3,4-dihydroxyphenyl R2 = lavandulyl R3 = prenyl R4 = prenyl X = H |
garcinielliptone GC[e] | G. multiflora[a] | +159.4 (0.27, m)[b] | H. Yang 2020 | ||
|
|||||||
| 25.1 | R = prenyl | sampsonione O | H. sampsonii[a] | +87.9 (0.073)[b] | Z. Y. Xiao 2007 | ||
| 25.2 | R = geranyl | otogirinin D | H. erectum[a] Thunb., H. attenuatum[a] | +160.0 (0.03, m)[b] | Y. Ishida 2010, D. Li 2015a | ||
|
|||||||
| 26.1 | R1 = i-Pr R2 = Me |
papuaforin B | H. papuanum[a] | NR | K. Winkelmann 2001a | ||
| 26.2 | R1 = Ph R2 = prenyl |
scrobiculatone B[c] | C. scrobiculata[a] | +44.7 (0.2)[b] | A. L. M. Porto 2000 | ||
| 26.3 | R1 = Ph R2 = prenyl |
hyperscabrone K[d] (enantiomer) | H. scabrum[a] | −57.2 (0.1, m)[b] | W. Gao 2016b, X.-W. Yang 2018 | ||
| 26.4 | R1 = Ph R2 = lavandulyl |
chamone II[e] | C. grandiflora[a] | NR | J. Lokvam 2000 | ||
|
|||||||
| 27.1 | R1 = prenyl R2 = H |
plukenetione F | C. plukenetii[a] | −53.6 (0.03)[b] | G. E. Henry 1999 | ||
| 27.2 | R1 = prenyl R2 = prenyl |
hypersampsone F | H. sampsonii[a] | +30 (0.2)[b] | Y.-L. Lin 2003, R. Ciochina 2006 | ||
| 27.3 | R1 = lavandulyl R2 = H |
garcimultine A[e] (equilibrates rapidly with regioisomer garcimultine B) |
G. multiflora[a] | mixture with garcimultine B: +79.4 (0.336, m)[b] | H. Liu 2017 | ||
| 27.4 | R1 = (S)-CH2CH(CMe2OH)CH2CH=CMe2 R2 = H |
garcimultinone H[d] | G. multiflora[a] | +35.0 (0.02, m)[b] | H. Teng 2021 | ||
| 27.5 | R1 = (2R,3E)-CH2CH(CMe=CH2)CH=CHCMe2OH R2 = H |
garcimultiflorone K[c][t][u][x] (one of two by that name) | G. multiflora[a] | −1.1 (0.090, m)[b] | Z.-Q. Wang 2018 | ||
|
|||||||
| 28.1 | R1 = i-Pr R2 = Me R3 = prenyl R4 = CH2–prenyl X1 = H X2 = H |
bellumone B[c] | H. bellum[a] | +6 (0.05, m)[b] | X. Zhou 2021 | ||
| 28.2 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = CH2–prenyl X1 = H X2 = H |
hyperscabin F, a.k.a. hyperpatin E[c] | H. patulum, H. scabrum[a] | +66.4 (0.12, mc)[b], +76.0 (0.10, m)[b] | J. Ma 2021b, J.-C. Huang 2025 | ||
| 28.3 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = CH2–prenyl X1 = OH X2 = H |
uralione A[c] | H. uralum[a] | +49 (0.2)[b] | Z.-B. Zhou 2016b | ||
| 28.4 | R1 = i-Pr R2 = (R)-CH2CHOHCMe2OH R3 = prenyl R4 = Me X1 = OH X2 = H |
hyperhimatin C[c] | H. himalaicum[a] | −11.8 (0.5, m)[b] | H. Cheng 2022b | ||
| 28.5 | R1 = i-Pr R2 = (R)-CH2CHOHCMe2OH R3 = prenyl R4 = CH2–prenyl X1 = OH X2 = H |
hypericumoxide M[c] | H. scabrum[a] | +19.8 (0.07, m)[b] | R. Liu 2017 | ||
| 28.6 | R1 = i-Pr R2 = (S)-CH2CHOHCMe2OH R3 = prenyl R4 = CH2–prenyl X1 = OH X2 = H |
attenuatumione H[c] | H. attenuatum[a] | +34.6 (0.1)[b] | Z.-B. Zhou 2016a | ||
| 28.7 | R1 = s-Bu R2 = Me R3 = prenyl R4 = CH2–prenyl X1 = H X2 = H |
bellumone A[c][e] | H. bellum[a] | +10 (0.1, m)[b] | X. Zhou 2021 | ||
| 28.8 | R1 = s-Bu R2 = (R)-CH2CHOHCMe2OH R3 = prenyl R4 = Me X1 = H X2 = OH |
hyperhimatin B[c][e] | H. himalaicum[a] | −4.0 (0.5, m)[b] | H. Cheng 2022b | ||
| 28.9 | R1 = s-Bu R2 = (R)-CH2CHOHCMe2OH R3 = prenyl R4 = Me X1 = OH X2 = H |
hyperhimatin A[c][e] | H. himalaicum[a] | −6.7 (0.5, m)[b] | H. Cheng 2022b | ||
| 28.10 | R1 = Ph R2 = Me R3 = prenyl R4 = CH2–prenyl X1 = H X2 = OH |
hyperacmosin I[c][ee] | H. acmosepalum[a] | −122 (0.25, m)[b] | X. Wang 2020b | ||
| 28.11 | R1 = Ph R2 = prenyl R3 = prenyl R4 = CH2–prenyl X1 = H X2 = H |
hyperkouytone D, a.k.a. hyperpatin A[c] | H. kouytchense, H. patulum[a] | −57.0 (0.38, m)[b], −35.0 (0.10, m)[b] | H.-Y. Lou 2024, J.-C. Huang 2025 | ||
| 28.12 | R1 = Ph R2 = prenyl R3 = prenyl R4 = CH2–prenyl X1 = H X2 = OH |
uralione B | H. uralum[a] | −28 (0.1)[b] | Z.-B. Zhou 2016b | ||
| 28.13 | R1 = Ph R2 = prenyl R3 = prenyl R4 = CH2–prenyl X1 = OH X2 = H |
uralione C | H. uralum[a] | −41 (0.1)[b] | Z.-B. Zhou 2016b | ||
| 28.14 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S)-CH2CH2CH(OH)CMe2OH X1 = H X2 = H |
hyperpatin B[c] | H. patulum[a] | −58.5 (0.10, m)[b] | J.-C. Huang 2025 | ||
| 28.15 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (E)-CH2=CHCH=O X1 = H X2 = H |
hyperpatin C[c] | H. patulum[a] | −16.0 (0.10, m)[b] | J.-C. Huang 2025 | ||
| 28.16 | R1 = Ph R2 = (R)-CH2CH(OH)CMe2OH R3 = prenyl R4 = Me X1 = OH X2 = H |
propolone B | Cuban propolis | +38.2 (0.6)[b] | I. M. Hernandez 2005, W. Gao 2016b | ||
| 28.17 | R1 = Ph R2 = (S)-CH2CH(OH)CMe2OH R3 = prenyl R4 = Me X1 = OH X2 = H |
hyperscabrone J[c] | H. scabrum[a] | −58.5 (0.1, m)[b] | W. Gao 2016b | ||
| 28.18 | R1 = Ph R2 = (S)-CH2CH(OH)CMe2OH R3 = prenyl R4 = CH2–prenyl X1 = OH X2 = H |
hyperkouytone E[c] | H. kouytchense[a] | −49.3 (0.25, m)[b] | H.-Y. Lou 2024 | ||
| 28.19 | R1 = Ph R2 = (S)-CH2CH(OH)CMe2OH R3 = prenyl R4 = CH2–prenyl X1 = H X2 = OH |
uralione D[c] | H. uralum[a] | −28 (0.1, m)[b] | Z.-B. Zhou 2016b | ||
| 28.20 | R1 = Ph R2 = (S)-CH2CH(OH)CMe2OH R3 = prenyl R4 = (R)-CH2CH2CH(OH)CMe2OH X1 = H X2 = OH |
hypertonii C[c] | H. addingtonii[a] N. Robson | +25.4 (0.1, acn)[b] | Q. Feng 2025 | ||
| 28.21 | R1 = Ph R2 = (S)-CH2CH(OH)CMe2OH R3 = prenyl R4 = (S)-CH2CH2CH(OH)CMe2OH X1 = H X2 = OH |
hypertonii D[c] | H. addingtonii[a] N. Robson | +18.6 (0.1, acn)[b] | Q. Feng 2025 | ||
| 28.22 | R1 = Ph R2 = (R)-(2,4,4-trimethyl-2-cyclohexenyl)methyl R3 = prenyl R4 = Me X1 = H X2 = H |
garcinuntin B[c] | G. nuntasaenii[a] | −62.8 (1.0)[b] | S. Chaturonrutsamee 2018 | ||
| 28.23 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = Me X1 = H X2 = H |
hyperscabrone N[c] | G. multiflora[a] | −62.0 (0.1, m)[b] | J. Cao 2024 | ||
| 28.24 | R1 = 3,4-dihydroxyphenyl R2 = (S)-lavandulyl[f] R3 = prenyl R4 = Me X1 = H X2 = H |
garcimultinone J[d] | G. multiflora[a] | −5.07 (0.05, m)[b] | H. Teng 2021 | ||
| 28.25 | R1 = 3,4-dihydroxyphenyl R2 = 2,2,6,6-tetramethyl-3-oxanylmethyl R3 = prenyl R4 = Me X1 = H X2 = H |
hyperscabrone O[c][e] | G. multiflora[a] | −40.0 (0.1, m)[b] | J. Cao 2024 | ||
| 28.26 | R1 = 3,4-dihydroxyphenyl R2 = (S)-2,2,6,6-tetramethyl-3-oxanylmethyl R3 = CH2CH2CMe2OH R4 = Me X1 = H X2 = H |
garpedvinin M[d] | G. pedunculata[a] Roxb. | +30.8 (0.10, m)[b] | D.-L. Zou 2025 | ||
|
|||||||
| 29.1 | hyperpatin D[c] | H. patulum[a] | −42.0 (0.10, m)[b] | J.-C. Huang 2025 | |||
|
|||||||
| 30.1 | R = prenyl X = H |
hypersampsone T[d] | H. sampsonii[a] | +62.8 (0.50)[b] | W.-J. Tian 2016 | ||
| 30.2 | R = prenyl X = OOH |
15,16-dihydro-16-hydroperoxyplukenetione F[e] | C. havetiodes[a] var. stenocarpa | +24.7 (0.3)[b] | O. E. Christian 2001 | ||
| 30.3 | R = geranyl X = H |
hypersampsone H | H. sampsonii[a] | +44.37 (0.222)[b] | Y. H. Zeng 2009, W.-J. Tian 2016, X.-W. Yang 2018 | ||
| 30.4 | R = (S)-lavandulyl[f] X = H |
garcimultinone I[d] | G. multiflora[a] | +73.90 (0.09, m)[b] | H. Teng 2021 | ||
|
|||||||
| 31.1 | R1 = i-Pr R2 = Me R3 = H |
papuaforin A | H. papuanum[a] | +13 (0.1, m)[b] | K. Winkelmann 2001a | ||
| 31.2 | R1 = i-Pr R2 = Me R3 = prenyl |
papuaforin E | H. papuanum[a] | +41 (0.1, m)[b] | K. Winkelmann 2001a | ||
| 31.3 | R1 = i-Pr R2 = prenyl R3 = H |
garcinielliptone F, a.k.a. garsubelone B[d] | G. subelliptica[a] | −23 (0.09)[b], −90.8 (0.08, m)[b] | J.-R. Weng 2003b, Y.-L. Wang 2019, Y.-G. Fu 2025 | ||
| 31.4 | R1 = i-Pr R2 = prenyl R3 = prenyl |
pyrano[7,28-b]hyperforin | H. perforatum[a] | +83.5 (0.3)[b] | M. D. Shan 2001 | ||
| 31.5 | R1 = s-Bu R2 = Me R3 = H |
papuaforin C[e] | H. papuanum[a] | +23 (0.1, m)[b] | K. Winkelmann 2001a | ||
| 31.6 | R1 = s-Bu R2 = Me R3 = prenyl |
papuaforin D[e] | H. papuanum[a] | +64 (0.1, m)[b] | K. Winkelmann 2001a | ||
| 31.7 | R1 = s-Bu R2 = prenyl R3 = H |
garsubelone C[d][e] | G. subelliptica[a] | +6 (0.06, m)[b] | Y.-G. Fu 2025 | ||
| 31.8 | R1 = s-Bu R2 = prenyl R3 = prenyl |
hypercohin I[e] | H. cohaerens[a] | +60.0 (0.22, m)[b] | X. Liu 2013a | ||
| 31.9 | R1 = Ph R2 = prenyl R3 = H |
scrobiculatone A | C. scrobiculata[a] | +44.7 (0.2)[b] | A. L. M. Porto 2000, K. Winkelmann 2001a | ||
| 31.10 | R1 = Ph R2 = (R)-(2,4,4-trimethyl-2-cyclohexenyl)methyl R3 = H |
garcinuntin C[c] | G. nuntasaenii[a] | −112.3 (0.33)[b] | S. Chaturonrutsamee 2018 | ||
|
|||||||
| 32.1 | R1 = i-Pr R2 = prenyl R3 = prenyl |
hyperselancin B[c] | H. lanceolatum[a] | −9 (0.2)[b] | S. A. T. Fobofou 2016, Y.-G. Fu 2025 | ||
| 32.2 | R1 = s-Bu R2 = prenyl R3 = prenyl |
hyperselancin A[c][e] | H. lanceolatum[a] | −1 (0.3)[b] | S. A. T. Fobofou 2016, Y.-G. Fu 2025 | ||
| 32.3 | R1 = s-Bu R2 = prenyl R3 = geranyl |
androforin A[e] | H. androsaemum[a] | −59.3 (0.23, MeOH)[b] | K. Wang 2012 | ||
| 32.4 | R1 = Ph R2 = prenyl R3 = prenyl |
plukenetione G | C. plukenetii[a] | NR | G. E. Henry 1999 | ||
| 32.5 | R1 = Ph R2 = lavandulyl R3 = prenyl |
garcimultine B[e] (equilibrates rapidly with regioisomer garcimultine A) |
G. multiflora[a] | mixture with garcimultine A: +79.4 (0.336, m)[b] | H. Liu 2017 | ||
|
|||||||
| 33.1 | R1 = i-Pr R2 = Me R3 = prenyl R4 = prenyl X1 = H X2 = H |
bellumone C[c] | H. bellum[a] | +13 (0.1, m)[b] | X. Zhou 2021 | ||
| 33.2 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = H X1 = H X2 = H |
garcinielliptone B | G. subelliptica[a] | −23 (0.1)[b] | J.-R. Weng 2003a | ||
| 33.3 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl X1 = H X2 = H |
hyperpatin F, a.k.a. hypertum J[c] | H. patulum, H. perforatum, H. scabrum[a] | +13.0 (0.10, m)[b], +7.8 (0.1, m)[b] | J.-C. Huang 2025, W.-Y. Liu 2025b | ||
| 33.4 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl X1 = OH X2 = H |
hyperwilsone I[c][e] | H. wilsonii[a] | +13.6 (0.4, m)[b] | Y. Duan 2021c | ||
| 33.5 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl X1 = OH X2 = H |
hyperascyrin J[c] | H. ascyron[a] | −68 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 33.6 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl X1 = H X2 = OH |
hyperacmosin H[c] | H. acmosepalum[a] | −478 (0.25, m)[b] | X. Wang 2020b | ||
| 33.7 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H X1 = H X2 = H |
propolone A | Cuban propolis, H. attenuatum[a] | +40 (0.1)[b] | O. Cuesta Rubio 1999, D. Li 2015a | ||
| 33.8 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X1 = H X2 = H |
hyperforcinol I, a.k.a. hyperpatin G[c] | H. forrestii, H. patulum[a] | −37 (0.1, m)[b], −48.0 (0.10, m)[b] | W.-J. Lu 2021, J.-C. Huang 2025 | ||
| 33.9 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl X1 = OH X2 = H |
hyperbeanin E[c] | H. beanii[a] | −30.0 (0.10, m)[b] | Y. Ma 2022a | ||
| 33.10 | R1 = Ph R2 = (R)-(2,4,4-trimethyl-2-cyclohexenyl)methyl R3 = prenyl R4 = H X1 = H X2 = H |
garcinuntin A[c] | G. nuntasaenii[a] | −96.3 (0.30)[b] | S. Chaturonrutsamee 2018 | ||
| 33.11 | R1 = 3,4-dihydroxyphenyl R2 = (S)-2,2,6,6-tetramethyl-3-oxanylmethyl R3 = CH2CH2CMe2OH R4 = H X1 = H X2 = H |
garpedvinin N[d] | G. pedunculata[a] Roxb. | +40.9 (0.10, m)[b] | D.-L. Zou 2025 | ||
|
|||||||
| 34.1 | ochrocarpinone A[e][o] | Ochrocarpos punctatus | +8.7 (0.15)[b] | V. S. P. Chaturvedula 2002 | |||
|
|||||||
| 35.1 | R = geranyl | hypersampsone K | H. sampsonii, H. attenuatum[a] | +31.7 (0.376)[b] | Y. H. Zeng 2012, D. Li 2015a | ||
| 35.2 | R = (R)-lavandulyl[f] | garcimultiflorone L[c] | G. multiflora[a] | +65.4 (0.040, m)[b] | Z.-Q. Wang 2018 | ||
|
|||||||
| 36.1 | hyperpatin H[c] | H. patulum[a] | −105.0 (0.10, m)[b] | J.-C. Huang 2025 | |||
|
|||||||
| 37.1 | R = Ph | garcimultinone D[d] | G. multiflora[a] | +186.27 (0.02, m)[b] | H. Teng 2021 | ||
| 37.2 | R = 3,4-dihydroxyphenyl | garcimultinone E[d] | G. multiflora[a] | +11.22 (0.15, m)[b] | H. Teng 2021 | ||
|
|||||||
| 38.1 | garcimultiflorone A | G. multiflora[a] | −173 (0.12)[b] | J.-J. Chen 2009 | |||
|
|||||||
| 39.1 | no common name | C. obdeltifolia[a] | +30.9 (0.3)[b] | J. S. A. R. Teixeira 2005 | |||
|
|||||||
| 40.1 | hypersampsonone A[d] | H. sampsonii[a] | +46.1 (0.59)[b] | J.-S. Zhang 2016 | |||
|
|||||||
| 41.1 | hypersampsone S[d] (one of two by that name) | H. sampsonii[a] | +62.0 (0.50)[b] | W.-J. Tian 2016 | |||
|
|||||||
| 42.1 | R1 = i-Pr R2 = prenyl |
hypercohone D | H. cohaerens[a] | −97.0 (0.07, m)[b] | J.-J. Zhang 2014a | ||
| 42.2 | R1 = i-Bu R2 = Me |
ascynol P[c] | H. ascyron[a] | −130 (0.1, m)[b] | Y.-L. Hu 2025 | ||
|
|||||||
| 43.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl |
oxepahyperforin | H. perforatum[a] | −73.7 (0.8)[b] | L. Verotta 2000 | ||
| 43.2 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-CH2CHOHCMe2OH |
uralione J[c] | H. uralum[a] | −48 (0.1, m)[b] | Z.-B. Zhou 2016b | ||
| 43.3 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH |
hyperforatone F | H. perforatum[a] | −70.0 (0.3, m)[b] | Y. Guo 2018 | ||
| 43.4 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe2OH R4 = prenyl |
hypericumoxide I[c] | H. scabrum[a] | −67.3 (0.06, m)[b] | R. Liu 2017 | ||
| 43.5 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = prenyl |
hyperforatone G[c] | H. perforatum[a] | −77.5 (0.3, m)[b] | Y. Guo 2018 | ||
| 43.6 | R1 = i-Pr R2 = (R)-CH2CHOHCMe2OH R3 = prenyl R4 = prenyl |
hypericumoxide G[c] | H. scabrum[a] | −60.3 (0.07, m)[b] | R. Liu 2017 | ||
| 43.7 | R1 = i-Pr R2 = (S)-CH2CHOHCMe2OH R3 = prenyl R4 = prenyl |
hypericumoxide H[c] | H. scabrum[a] | −43.5 (0.06, m)[b] | R. Liu 2017 | ||
| 43.8 | R1 = i-Pr (18S,39R)-R2 = ![]() R3 = prenyl R4 = prenyl |
hyperforatone E | H. perforatum[a] | −93.6 (0.9, m)[b] | Y. Guo 2018 | ||
| 43.9 | R1 = (S)-s-Bu R2 = prenyl R3 = prenyl R4 = prenyl |
hyphenrone E[c] | H. henryi[a] | −117.6 (0.20, m)[b] | X.-W. Yang 2014, X.-W. Yang 2015 | ||
| 43.10 | R1 = s-Bu R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = prenyl |
hyperforatone H[c][e] | H. perforatum[a] | −90.3 (0.9, m)[b] | Y. Guo 2018 | ||
| 43.11 | R1 = s-Bu R2 = (E)-CH=CHCH2OOH R3 = prenyl R4 = prenyl |
uralin C[c][e] | H. uralum[a] | −82 (0.2, m)[b] | Q.-Q. Fang 2021 | ||
| 43.12 | R1 = Ph R2 = prenyl R3 = Me R4 = prenyl |
hyperascyrin K[c] | H. ascyron[a] | −201 (0.2, m)[b] | J.-W. Hu 2018 | ||
| 43.13 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl |
hypercohone F, a.k.a. uralione H | H. cohaerens, H. uralum[a] | −240.8 (0.17, m)[b], −210 (0.2)[b] | J.-J. Zhang 2014a, Z.-B. Zhou 2016b | ||
| 43.14 | R1 = Ph R2 = prenyl R3 = (S)-CH2CHOHCMe2OH R4 = prenyl |
uralione I[c] | H. uralum[a] | −139 (0.1, m)[b] | Z.-B. Zhou 2016b | ||
| 43.15 | R1 = Ph R2 = prenyl R3 = (E)-CH=CHCH2OH R4 = prenyl |
kiiacylphnol H[c] | H. przewalskii[a] Maxim | −115 (0.4, m)[b] | Y. Duan 2022a | ||
|
|||||||
| 44.1 | R1 = i-Pr R2 = Me |
hyperscabrone C[c] | H. scabrum[a] | −124 (0.1, m)[b] | W. Gao 2016a | ||
| 44.2 | R1 = i-Pr R2 = prenyl |
hypercohone E | H. cohaerens[a] | −42.8 (0.12, m)[b] | J.-J. Zhang 2014a | ||
| 44.3 | R1 = i-Bu R2 = Me |
ascynol Q[c] | H. ascyron[a] | −112 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 44.4 | R1 = (R)-s-Bu R2 = Me |
hyperscabrone D[c] | H. scabrum[a] | −75 (0.1, m)[b] | W. Gao 2016a | ||
| 44.5 | R1 = s-Bu R2 = prenyl |
hyperibrin H[c][e] | H. scabrum[a] | NR | W. Xu 2021 | ||
| 44.6 | R1 = Ph R2 = prenyl |
kiiacylphnol G[c] | H. przewalskii[a] Maxim | −125 (0.4, m)[b] | Y. Duan 2022a | ||
|
|||||||
| 45.1 | hyperkouytone A[d] | H. kouytchense[a] | −24.8 (0.21, m)[b] | H.-Y. Lou 2024 | |||
|
|||||||
| 46.1 | hyperhookerione A[c] | H. hookerianum[a] | +127.8 (0.5, m)[b] | Z. Guo 2025b | |||
|
|||||||
| 47.1 | R1 = i-Pr R2 = prenyl R3 = Me R4 = prenyl R5 = H |
bellumone D[c] | H. bellum[a] | −11 (0.1, m)[b] | X. Zhou 2021 | ||
| 47.2 | R1 = i-Pr R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
hyperibone J, a.k.a. hyperfoliatin | H. scabrum, H. ascyron, H. perfoliatum[a] L. | +16.9 (0.3)[b], +17 (1, m)[b] | N. Tanaka 2004, N. Benkiki 2014, L.-M. Kong 2017 | ||
| 47.3 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
subellinone, a.k.a. garcinielliptin oxide | G. subelliptica[a] | −2.8 (1.0, e)[b]; +1 (0.3)[b] | Y. Fukuyama 1993, C.-N. Lin 1996, R. B. Grossman 2020 | ||
| 47.4 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
8-hydroxyhyperforin-8,1-hemiacetal | H. perforatum[a] | +34 (1.0)[b] | L. Verotta 2000 | ||
| 47.5 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = (R)-CH2CHOHCMe2OH |
hyperfol C[c] | H. perforatum[a] | −9.18 (0.05, m)[b] | H. Lou 2020b | ||
| 47.6 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = (S)-CH2CHOHCMe2OH |
hyperfol D[c] | H. perforatum[a] | −43.12 (0.12, m)[b] | H. Lou 2020b | ||
| 47.7 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = (S)-CH2CHOHCMe2OMe |
hyperfol E[c] | H. perforatum[a] | −27.09 (0.09, m)[b] | H. Lou 2020b | ||
| 47.8 | R1 = i-Pr R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl |
hyphenrone W | H. henryi[a] H. Lév & Vaniot | +6 (0.08, m)[b] | Y. Liao 2016 | ||
| 47.9 | R1 = i-Pr R2 = CH2CH2CMe2OH R3 = prenyl R4 = prenyl R5 = H |
garcinielliptone E | G. subelliptica[a] | −51 (0.2)[b] | J.-R. Weng 2003a, R. B. Grossman 2020 | ||
| 47.10 | R1 = i-Pr R2 = geranyl R3 = Me R4 = prenyl R5 = H |
bellumone E[c] | H. bellum[a] | −9 (0.1, m)[b] | X. Zhou 2021 | ||
| 47.11 | R1 = i-Bu R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
ascyronone D | H. ascyron[a] | −3 (0.18, m)[b] | L.-M. Kong 2017 | ||
| 47.12 | R1 = i-Bu R2 = prenyl R3 = prenyl R4 = (E)-4-oxoprenyl R5 = H |
spiranthenone A | Spiranthera odoratissima | +11 (0.19)[b] | L. C. Albernaz 2012, X.-W. Yang 2018 | ||
| 47.13 | R1 = (S)-s-Bu R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
hyperscabrone G[c] | H. ascyron, H. scabrum[a] | +7 (0.1, m)[b] | W. Gao 2016a, L.-M. Kong 2017 | ||
| 47.14 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
garcinielliptone T[e] | G. subelliptica[a] | +32 (0.09, m)[b] | R. B. Grossman 2020 | ||
| 47.15 | R1 = (S)-s-Bu R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
hyphenrone G[c] | H. henryi[a] | +26 (0.4, m)[b] | X.-W. Yang 2015 | ||
| 47.16 | R1 = s-Bu R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl |
hyperforcinol G[c][e] | H. forrestii[a] | +54 (0.3, m)[b] | W.-J. Lu 2021 | ||
|
|||||||
| 48.1 | R = i-Pr | hyperhookerione B[c] | H. hookerianum[a] | +221.6 (0.5, m)[b] | Z. Guo 2025b | ||
| 48.2 | R = s-Bu | hyperhookerione C[c][e] | H. hookerianum[a] | +33.3 (0.5, m)[b] | Z. Guo 2025b | ||
|
|||||||
| 49.1 | R = i-Pr X = OH |
kiiacylphnol C[c] | H. przewalskii[a] Maxim | +61 (0.5, m)[b] | Y. Duan 2022a | ||
| 49.2 | R = i-Pr X = OMe |
hyperhookerione D[c] | H. hookerianum[a] | +77.8 (0.5, m)[b] | Z. Guo 2025b | ||
| 49.3 | R = i-Pr X = OEt |
hypseudohenrin I[c] | H. pseudohenryi[a] | +21.5 (20.6, m)[b] | H.-R. Sun 2021a | ||
| 49.4 | R = s-Bu X = OH |
hyperforcinol F[c][e] | H. forrestii[a] | +113 (0.2, m)[b] | W.-J. Lu 2021 | ||
| 49.5 | R = s-Bu X = OEt |
hypseudohenrin J[c][e] | H. pseudohenryi[a] | +40.6 (0.71, m)[b] | H.-R. Sun 2021a | ||
|
|||||||
| 50.1 | R1 = i-Pr R2 = prenyl R3 = H X1 = H X2 = OH |
przewalcyrone E[c] | H. przewalskii[a] | −88.18 (0.44, m)[b] | Y. Duan 2019 | ||
| 50.2 | R1 = i-Pr R2 = prenyl R3 = H X1 = OH X2 = H |
przewalcyrone F[c] | H. przewalskii[a] | −47.25 (0.13, m)[b] | Y. Duan 2019 | ||
| 50.3 | R1 = i-Pr R2 = prenyl R3 = prenyl X1 = H X2 = OH |
hyphenrone T[c] | H. henryi[a] H. Lév & Vaniot | −118 (0.09, m)[b] | Y. Liao 2016 | ||
| 50.4 | R1 = i-Pr R2 = prenyl R3 = prenyl X1 = OH X2 = H |
hyphenrone U | H. henryi[a] H. Lév & Vaniot | −46 (0.16, m)[b] | Y. Liao 2016 | ||
| 50.5 | R1 = i-Pr R2 = prenyl R3 = prenyl X1 = O X2 = O |
hypseudohenrin K[c] | H. pseudohenryi[a] | −18.6 (1.13, m)[b] | H.-R. Sun 2021a | ||
| 50.6 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe=CH2 X1 = H X2 = OH |
hyperforatone J[c] | H. perforatum[a] | −59.5 (0.2, m)[b] | Y. Guo 2018 | ||
| 50.7 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CHOHCMe=CH2 X1 = H X2 = OH |
hyperforatone I[c] | H. perforatum[a] | −40.0 (0.4, m)[b] | Y. Guo 2018 | ||
| 50.8 | R1 = i-Pr R2 = prenyl R3 = (R)-CH2CHOHCMe2OMe X1 = H X2 = OH |
hyperforatone O[c] | H. perforatum[a] | −22.0 (0.3, m)[b] | Y. Guo 2018 | ||
| 50.9 | R1 = i-Pr R2 = prenyl R3 = (S)-CH2CHOHCMe2OMe X1 = H X2 = OH |
hyperforatone N[c] | H. perforatum[a] | −52.7 (0.4, m)[b] | Y. Guo 2018 | ||
| 50.10 | R1 = i-Pr R2 = (R)-CH2CHOHCMe=CH2 R3 = prenyl X1 = H X2 = OH |
hyperforatone K[c] | H. perforatum[a] | −35.4 (0.5, m)[b] | Y. Guo 2018 | ||
| 50.11 | R1 = i-Pr R2 = (R)-CH2CHOHCMe2OH R3 = prenyl X1 = H X2 = OH |
hyperforatone L[c] | H. perforatum[a] | −66.3 (0.3, m)[b] | Y. Guo 2018 | ||
| 50.12 | R1 = i-Pr R2 = (S)-CH2CHOHCMe2OH R3 = prenyl X1 = H X2 = OH |
hyperforatone M[c] | H. perforatum[a] | −10.4 (0.3, m)[b] | Y. Guo 2018 | ||
| 50.13 | R1 = i-Bu R2 = prenyl R3 = H X1 = H X2 = OH |
przewalcyrone C[c] | H. przewalskii[a] | −80.33 (0.3, m)[b] | Y. Duan 2019 | ||
| 50.14 | R1 = i-Bu R2 = prenyl R3 = H X1 = OH X2 = H |
przewalcyrone D[c] | H. przewalskii[a] | −67.70 (0.18, m)[b] | Y. Duan 2019 | ||
| 50.15 | R1 = (S)-s-Bu R2 = prenyl R3 = H X1 = H X2 = OH |
przewalcyrone A[c] | H. przewalskii[a] | −109.29 (0.43, m)[b] | Y. Duan 2019 | ||
| 50.16 | R1 = (S)-s-Bu R2 = prenyl R3 = H X1 = OH X2 = H |
przewalcyrone B[c] | H. przewalskii[a] | −132.38 (0.3, m)[b] | Y. Duan 2019 | ||
| 50.17 | R1 = (S)-s-Bu R2 = prenyl R3 = prenyl X1 = OH X2 = H |
hyperwilsone F[c] | H. wilsonii[a] | −36.8 (0.4, m)[b] | Y. Duan 2021c | ||
| 50.18 | R1 = s-Bu R2 = prenyl R3 = prenyl X1 = H X2 = OH |
hyphenrone V | H. henryi[a] H. Lév & Vaniot | −38 (0.16, m)[b] | Y. Liao 2016 | ||
| 50.19 | R1 = Ph R2 = prenyl R3 = prenyl X1 = OH X2 = H |
hyperwilsone G[c] | H. wilsonii[a] | −44.0 (0.3, m)[b] | Y. Duan 2021c | ||
| 50.20 | R1 = Ph R2 = prenyl R3 = prenyl X1 = H X2 = OH |
hyperwilsone H[c] | H. wilsonii[a] | −60.6 (0.5, m)[b] | Y. Duan 2021c | ||
|
|||||||
| 51.1 | hyperhookerione H[c] | H. hookerianum[a] | −110 (0.5, m)[b] | Z. Guo 2025b | |||
|
|||||||
| 52.1 | hyperhookerione I[c] | H. hookerianum[a] | −163 (0.5, m)[b] | Z. Guo 2025b | |||
|
|||||||
| 53.1 | garcinielliptone H | G. subelliptica[a] | −14.3 (0.1)[b] | J.-R. Weng 2003b | |||
|
|||||||
| 54.1 | ascynol G[c] | H. ascyron[a] | +78 (0.1, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 55.1 | garcinielliptone G | G. subelliptica[a] | −53 (0.1)[b] | J.-R. Weng 2003b, Y.-G. Fu 2025 | |||
|
|||||||
| 56.1 | hyperscabin D[c] | H. scabrum[a] | +71.4 (0.08, mc)[b] | J. Ma 2021b | |||
|
|||||||
| 57.1 | hyperforone A[c] (one of two by that name) | H. perforatum[a] | −10.1 (0.1, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 58.1 | hyperforone B[c] (one of two by that name) | H. perforatum[a] | −144.4 (0.5, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 59.1 | hyperforone C[c] (one of two by that name) | H. perforatum[a] | −29.2 (0.3, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 60.1 | hyperforone D[c] | H. perforatum[a] | +68.9 (0.9, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 61.1 | hyperforone E[c] | H. perforatum[a] | −66.4 (0.3, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 62.1 | hyperforone F[c] | H. perforatum[a] | −30.0 (0.8, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 63.1 | hyperforone G[c] | H. perforatum[a] | −15.2 (0.4, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 64.1 | hyperforone H[c] | H. perforatum[a] | −22.3 (0.9, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 65.1 | hyperatin A[c] | H. perforatum[a] | +64.3 (0.1, m)[b] | Y. Guo 2024 | |||
|
|||||||
| 66.1 | R = i-Pr X = OH |
hyperatin D[c] | H. perforatum[a] | −24.5 (0.1, m)[b] | Y. Guo 2024 | ||
| 66.2 | R = i-PrO X = OH |
hyperatin C[c] | H. perforatum[a] | −1.8 (0.2, m)[b] | Y. Guo 2024 | ||
| 66.3 | R = i-PrO X = OMe |
hyperatin B[c] | H. perforatum[a] | −5.3 (0.2, m)[b] | Y. Guo 2024 | ||
|
|||||||
| 67.1 | R = i-Pr | hyperacmose A[c] | H. acmosepalum[a] | +11.11 (2.8, m)[b] | Z. Hu 2026 | ||
| 67.2 | R = s-Bu | hyperacmose B[c][e] | H. acmosepalum[a] | +8.63 (1.9, m)[b] | Z. Hu 2026 | ||
|
|||||||
| 68.1 | hyperacmose C[c] | H. acmosepalum[a] | +21.43 (0.56, m)[b] | Z. Hu 2026 | |||
|
|||||||
| 69.1 | hypericumoxide N[d] | H. scabrum[a] | −24.2 (0.09, m)[b] | R. Liu 2017 | |||
|
|||||||
| 70.1 | hyperpatone A[c] | H. patulum[a] | −54.18 (0.3, m)[b] | F. Zhang 2023 | |||
|
|||||||
| 71.1 | R1 = i-Pr R2 = H |
garcinielliptone J | G. subelliptica[a] | −166 (0.2)[b] | J.-R. Weng 2003b | ||
| 71.2 | R1 = i-Pr R2 = (E)-CH=CHCMe2OH |
norhyperpalum G[c] | H. patulum[a] | +107.6 (0.5, m)[b] | Y. Duan 2021b | ||
| 71.3 | R1 = (S)-s-Bu R2 = H |
soulattrone A | Calophyllum soulattri | +157.3 (0.19, e)[b] | S. K. Nigam 1988 | ||
| 71.4 | R1 = s-Bu R2 = (E)-CH=CHCMe2OH |
norhyperpalum F[c][e] | H. patulum[a] | +92.0 (0.6, m)[b] | Y. Duan 2021b | ||
|
|||||||
| 72.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl |
hyphenrone A[c] | H. henryi[a] | −23.8 (0.25, m)[b] | X.-W. Yang 2014 | ||
| 72.2 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl |
perforatumone[d] (prob. enantiomer) | H. perforatum[a] | +153 (2.9, a)[b] | J. Wu 2004, X.-W. Yang 2015 | ||
| 72.3 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH |
hyperuralone C | H. uralum[a] | +3 (0.25, m)[b] | J.-J. Zhang 2015 | ||
| 72.4 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OOH |
hyperuralone E | H. uralum[a] | +2 (0.11, m)[b] | J.-J. Zhang 2015 | ||
| 72.5 | R1 = i-Pr R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl |
attenuatumione B | H. attenuatum[a] | +4.8 (0.19)[b] | Z.-B. Zhou 2014, J.-J. Zhang 2015 | ||
| 72.6 | R1 = i-Pr R2 = (E)-CH=CHCMe2OH R3 = prenyl R4 = prenyl |
hyphenrone Y (one of two by that name) | H. henryi[a] | +10 (0.2, m)[b] | F. Hu 2023 | ||
| 72.7 | R1 = (S)-s-Bu R2 = prenyl R3 = prenyl R4 = prenyl |
hyphenrone H[c] | H. henryi[a] | −4 (0.1, m)[b] | X.-W. Yang 2015 | ||
| 72.8 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH |
hyperuralone D[e] | H. uralum[a] | +4 (0.09, m)[b] | J.-J. Zhang 2015 | ||
| 72.9 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OOH |
hyperuralone F[e] | H. uralum[a] | +2 (0.11, m)[b] | J.-J. Zhang 2015 | ||
| 72.10 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl |
hyphenrone B[c] | H. henryi[a] | −39.8 (0.09, m)[b] | X.-W. Yang 2014 | ||
|
|||||||
| 73.1 | hyperfol H[c][dd] | H. perforatum[a] | −203 (0.3, m)[b] | H. Lou 2020b | |||
|
|||||||
| 74.1 | hyperfol B[c] | H. perforatum[a] | −33.24 (0.09, m)[b] | H.-Y. Lou 2020a | |||
|
|||||||
| 75.1 | hyperkouytone N[c] | H. kouytchense[a] | −14.2 (0.24, m)[b] | H.-Y. Lou 2024 | |||
|
|||||||
| 76.1 | R = i-Pr | hyperuralone G | H. uralum[a] | −37 (0.11, m)[b] | J.-J. Zhang 2015 | ||
| 76.2 | R = s-Bu | hyperuralone H[e] | H. uralum[a] | −38 (0.3, m)[b] | J.-J. Zhang 2015 | ||
|
|||||||
| 77.1 | R = i-Pr | hyphenrone C[c] | H. henryi[a] | −32.9 (0.10, m)[b] | X.-W. Yang 2014, X.-W. Yang 2015 | ||
| 77.2 | R = (S)-s-Bu | hyphenrone I[c] | H. henryi[a] | +22 (0.1, m)[b] | X.-W. Yang 2015 | ||
|
|||||||
| 78.1 | ascynol H[c] | H. ascyron[a] | −22 (0.3, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 79.1 | hyphenrone D[c] | H. henryi[a] | −62.5 (0.10, m)[b] | X.-W. Yang 2014 | |||
|
|||||||
| 80.1 | hyperlanin A, a.k.a. hyperforatone A[c] (one of two by the second name) | H. lancasteri[a] | −18.0 (0.3, m)[b] | J.-Q. You 2024, W.-Y. Liu 2025a | |||
|
|||||||
| 81.1 | hyperfol A[c] | H. perforatum[a] | −202.49 (0.3, m)[b] | H.-Y. Lou 2020a | |||
|
|||||||
| 82.1 | R1 = i-Pr R2 = H R3 = Me R4 = (E)-CH=CHCMe2OH |
ascynol J[c] | H. ascyron[a] | −30 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 82.2 | R1 = i-Pr R2 = H R3 = prenyl R4 = prenyl |
hyphenrone F[c] | H. henryi[a] | −140 (0.10, m)[b] | X.-W. Yang 2014 | ||
| 82.3 | R1 = i-Pr R2 = CO2Me R3 = prenyl R4 = prenyl |
hyperpatuone M[c] | H. patulum[a] | −52 (0.3, m)[b] | F. Zhang 2026 | ||
| 82.4 | R1 = s-Bu R2 = H R3 = Me R4 = (E)-CH=CHCMe2OH |
ascynol K[c][e] | H. ascyron[a] | −24 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 82.5 | R1 = Ph R2 = H R3 = Me R4 = prenyl |
ascyronone C | H. ascyron[a] | −151 (0.30, m)[b] | L.-M. Kong 2017 | ||
| 82.6 | R1 = Ph R2 = H R3 = Me R4 = (E)-CH=CHCMe2OH |
ascynol I[c] | H. ascyron[a] | −149 (0.1, m)[b] | Y.-L. Hu 2025 | ||
|
|||||||
| 83.1 | hyperforen A[c] | H. perforatum[a] | +9.53 (0.05, m)[b] | H. Lou 2022 | |||
|
|||||||
| 84.1 | R1 = i-Pr R2 = Me |
ascyronone A | H. ascyron[a] | +87 (0.04, m)[b] | L.-M. Kong 2017 | ||
| 84.2 | R1 = i-Pr R2 = prenyl |
hyperforcinol K[c] | H. forrestii[a] | +57 (0.9, m)[b] | W.-J. Lu 2021 | ||
| 84.3 | R1 = s-Bu R2 = Me |
ascyronone B[e] | H. ascyron[a] | +108 (0.11, m)[b] | L.-M. Kong 2017 | ||
| 84.4 | R1 = s-Bu R2 = prenyl |
hyperforcinol E[c][e] | H. forrestii[a] | +70 (0.3, m)[b] | W.-J. Lu 2021 | ||
|
|||||||
| 85.1 | uralin B[c] | H. uralum[a] | +63 (0.3, m)[b] | Q.-Q. Fang 2021 | |||
|
|||||||
| 86.1 | hypsampsone A[d] | H. sampsonii[a] | +71.49 (0.7, m)[b] | Z.-Z. Zhang 2021 | |||
|
|||||||
| 87.1 | hypersampone A[d] | H. sampsonii[a] | −70.01 (1.7, m)[b] | L. Huang 2022 | |||
|
|||||||
| 88.1 | R = OBz | hypersampone B[d] | H. sampsonii[a] | −67.93 (1.8, m)[b] | L. Huang 2022 | ||
| 88.2 | R = Bz | hypersampone C[d] | H. sampsonii[a] | −21.54 (1.9, m)[b] | L. Huang 2022 | ||
|
|||||||
| 89.1 | R = i-Pr | hyperscabin A[c] | H. scabrum[a] | +37.9 (0.05, mc)[b] | J. Ma 2021a | ||
| 89.2 | R = s-Bu | norhyperpalum E[c][e] | H. patulum[a] | +55.1 (0.3, m)[b] | Y. Duan 2021b | ||
|
|||||||
| 90.1 | R = i-Pr | hyperscabin B[c] | H. scabrum[a] | +75.6 (0.18, mc)[b] | J. Ma 2021a | ||
| 90.2 | R = s-Bu | hyperscabin C[c][e] | H. scabrum[a] | +66.2 (0.08, mc)[b] | J. Ma 2021a | ||
| 90.3 | R = Ph | norhyperpalum D[c] | H. patulum[a] | −47.1 (0.2, m)[b] | Y. Duan 2021b | ||
|
|||||||
| 91.1 | R = i-Pr | hyperacmosin K[c] | H. acmosepalum[a] | +109.4 (0.1115, m)[b] | M. Sun 2021a | ||
| 91.2 | R = Ph | norhyperpalum B[c] | H. patulum[a] | −14.7 (0.6, m)[b] | Y. Duan 2021b | ||
|
|||||||
| 92.1 | R = i-Pr | hyperacmosin L[c] | H. acmosepalum[a] | +133.8 (0.068, m)[b] | M. Sun 2021a | ||
| 92.2 | R = Ph | norhyperpalum C[c] | H. patulum[a] | +3.3 (0.3, m)[b] | Y. Duan 2021b | ||
|
|||||||
| 93.1 | norhyperpalum A[d] | H. patulum[a] | −53.7 (0.3, m)[b] | Y. Duan 2021b | |||
|
|||||||
| 94.1 | hyperscabin E[c] | H. scabrum[a] | +103.2 (0.14, mc)[b] | J. Ma 2021b | |||
|
|||||||
| 95.1 | hypertum A[c] | H. perforatum[a] | −8.5 (0.05, m)[b] | W.-Y. Liu 2025b | |||
|
|||||||
| 96.1 | R1 = prenyl R2 = Me |
hyperhexanone F[c] | H. sampsonii[a] | −40 (0.3, m)[b] | Z.-Z. Zhang 2021 | ||
| 96.2 | R1 = geranyl R2 = Me |
hyperhexanone A[c] | H. sampsonii[a] | −13.3 (0.30)[b] | H. Zhu 2016 | ||
| 96.3 | R1 = geranyl R2 = Et |
hyperacmosin M[c] | H. acmosepalum[a] | −54.5 (0.044, m)[b] | M. Sun 2021a | ||
|
|||||||
| 97.1 | hyperforcinol D[c] | H. forrestii[a] | +4 (0.7, m)[b] | W.-J. Lu 2021 | |||
|
|||||||
| 98.1 | R = i-Pr | hyperacmosin D[c] | H. acmosepalum[a] | −25.45 (0.22, m)[b] | X.-y. Suo 2021a | ||
| 98.2 | R = (S)-s-Bu | hyperacmosin C[c] | H. acmosepalum[a] | −12.30 (0.26, m)[b] | X.-y. Suo 2021a | ||
|
|||||||
| 99.1 | hyperbenzone A[c] | H. beanii[a] | −4 (0.2, m)[b] | W. Lu 2021 | |||
|
|||||||
| 100.1 | hyperbenzone B[c] | H. beanii[a] | +12 (0.1, m)[b] | W. Lu 2021 | |||
|
|||||||
| 101.1 | spirohypolactone A[c] | H. perforatum[a] | +65.6 (0.6, m)[b] | Y. Guo 2019a | |||
|
|||||||
| 102.1 | R1 = i-Pr R2 = CH2CH2CH=CMe2 |
spirohypolactone B[c] | H. perforatum[a] | +43.5 (0.6, m)[b] | Y. Guo 2019a | ||
| 102.2 | R1 = s-Bu R2 = CH2CH2CH=CMe2 |
norhyperpalum H[c][e] | H. patulum[a] | +44.3 (0.5, m)[b] | Y. Duan 2021b | ||
| 102.3 | R1 = Ph R2 = (E)-CH=CHCH=CMe2 |
hyperisenin B[c] | H. seniawinii[a] | +48.8 (0.3, m)[b] | Y. Duan 2025 | ||
|
|||||||
| 103.1 | R = i-Pr X = H |
norhyperpalum I[c] | H. patulum[a] | −9.6 (0.6, m)[b] | Y. Duan 2021b | ||
| 103.2 | R = i-Pr X = OH |
hyperhexanone C[c] | H. perforatum[a] | −17.8 (0.6, m)[b] | Y. Guo 2019a | ||
| 103.3 | R = s-Bu X = OH |
hyperhexanone D[c][e] | H. perforatum[a] | −30.3 (0.4, m)[b] | Y. Guo 2019a | ||
|
|||||||
| 104.1 | hyperhexanone E[c] | H. perforatum[a] | −139.0 (0.3, m)[b] | Y. Guo 2019a | |||
|
|||||||
| 105.1 | R = prenyl | norsampsone A[c] | H. sampsonii[a] | +23.4 (0.50)[b] | W.-J. Tian 2014a | ||
| 105.2 | R = geranyl | norsampsone C[c] | H. sampsonii[a] | +26.0 (0.50)[b] | W.-J. Tian 2014a | ||
| 105.3 | R = lavandulyl | norgarmultinone A[c][e] | G. multiflora[a] | +77.78 (0.02, m)[b] | H. Teng 2020 | ||
|
|||||||
| 106.1 | R = prenyl | norsampsone B[c] | H. sampsonii[a] | −28.6 (0.50)[b] | W.-J. Tian 2014a | ||
| 106.2 | R = geranyl | norsampsone D[c] | H. sampsonii[a] | −28.2 (0.50)[b] | W.-J. Tian 2014a | ||
|
|||||||
| 107.1 | norwilsonnol B[d] | H. wilsonii[a] | +111.0 (0.5, m)[b] | S. Xie 2021 | |||
|
|||||||
| 108.1 | hyperisenin A[d] | H. seniawinii[a] | +42.0 (0.1, m)[b] | Y. Duan 2025 | |||
|
|||||||
| 109.1 | hypertum B[c] | H. perforatum[a] | −9.5 (0.15, m)[b] | W.-Y. Liu 2025b | |||
|
|||||||
| 110.1 | norwilsonnol A[c] | H. wilsonii[a] | −174.0 (0.7, m)[b] | S. Xie 2021 | |||
|
|||||||
| 111.1 | hyperwilsol A[c] | H. wilsonii[a] | −5.55 (0.08, m)[b] | Z.-X. Wang 2025 | |||
|
|||||||
| 112.1 | hypseudohenrin H[c] | H. wilsonii[a] | −8.56 (1.29, m)[b] | M.-X. Sun 2024 | |||
|
|||||||
| 113.1 | hypertum C[c] | H. perforatum[a] | −26.8 (0.05, m)[b] | W.-Y. Liu 2025b | |||
|
|||||||
| 114.1 | X1 = OMe X2 = H |
hypertum D[c] | H. perforatum[a] | mixture with hypertum E: −40.1 (0.1, m)[b] | W.-Y. Liu 2025b | ||
| 114.2 | X1 = H X2 = OMe |
hypertum E[c] | H. perforatum[a] | mixture with hypertum D: −40.1 (0.1, m)[b] | W.-Y. Liu 2025b | ||
|
|||||||
| 115.1 | norgarmultinone B[c] | G. multiflora[a] | +43.37 (0.07, m)[b] | H. Teng 2020 | |||
|
|||||||
| 116.1 | hypseudohenrin C[c] | H. pseudohenryi[a] | +10.5 (1.14, m)[b] | H. Sun 2021b | |||
|
|||||||
| 117.1 | hyperwilsol D[c] | H. wilsonii[a] | −81.55 (0.04, m)[b] | Z.-X. Wang 2025 | |||
|
|||||||
| 118.1 | hypseudohenrin D[c] | H. pseudohenryi[a] | +10.9 (1.29, m)[b] | H. Sun 2021b | |||
|
|||||||
| 119.1 | R1 = i-Pr R2 = H |
garcinielliptone O | G. subelliptica[a] | −277 (0.16)[b] | J.-R. Weng 2004 | ||
| 119.2 | R1 = i-Pr R2 = prenyl |
no common name | H. perforatum[a] | +95.5 (1.1)[b] | M. D. Shan 2001 | ||
| 119.3 | R1 = (R)-s-Bu R2 = prenyl |
hyperwilsol C[c] | H. wilsonii[a] | +93.99 (0.05, m)[b] | Z.-X. Wang 2025 | ||
| 119.4 | R1 = Ph R2 = H |
hyperibrin G[d] | H. scabrum[a] | +80.2 (0.06, m)[b] | J. Hu 2017 | ||
|
|||||||
| 120.1 | R = i-Pr | hypertum F[c] | H. perforatum[a] | +40.2 (0.02, m)[b] | W.-Y. Liu 2025b | ||
| 120.2 | R = (S)-s-Bu | hypertum G[c] | H. perforatum[a] | +49.5 (0.02, m)[b] | W.-Y. Liu 2025b | ||
|
|||||||
| 121.1 | spirohypertone B[c] | H. patulum[a] | −15.2 (0.1, m)[b] | Y. Duan 2024b | |||
|
|||||||
| 122.1 | R = CO2Me | hypseudohenrin A[c] | H. pseudohenryi[a] | +9.8 (1.43, m)[b] | H. Sun 2021b | ||
| 122.2 | R = H | hypseudohenrin B[c] | H. pseudohenryi[a] | +12.9 (1.86, m)[b] | H. Sun 2021b | ||
|
|||||||
| 123.1 | R1 = i-Pr R2 = Me R3 = prenyl X = H |
hyperibrin A[c] | H. scabrum[a] | +37.0 (0.05, m)[b] | W. Gao 2016c | ||
| 123.2 | R1 = i-Pr R2 = Me R3 = prenyl X = OH |
hyperibrin B, a.k.a. hypermonone I[c] | H. monogynum, H. scabrum[a] | +53.2 (0.08, m)[b], +46.03 (0.08, m)[b] | W. Gao 2016c, X. Wang 2021b, Y.-R. Zeng 2021c | ||
| 123.3 | R1 = i-Pr R2 = Me R3 = prenyl X = OOH |
hyperscabrone H[c] | H. scabrum[a] | +8.3 (0.1, m)[b] | W. Gao 2016a, X. Wang 2021b | ||
| 123.4 | R1 = i-Pr R2 = prenyl R3 = H X = H |
garcinielliptone N | G. subelliptica[a] | −42 (0.38)[b] | J.-R. Weng 2004 | ||
| 123.5 | R1 = i-Pr R2 = prenyl R3 = prenyl X = H |
no common name | H. perforatum[a] | +18.3 (1.8)[b] | M. D. Shan 2001 | ||
| 123.6 | R1 = i-Bu R2 = Me R3 = (E)-CH=CHCMe2OH X = H |
ascynol F[c] | H. ascyron[a] | +22 (0.1, m)[b] | Y.-L. Hu 2025 | ||
| 123.7 | R1 = s-Bu R2 = Me R3 = prenyl X = H |
hypermonone H[c] | H. monogynum[a] | +7.88 0.24, m) | Y.-R. Zeng 2021c | ||
| 123.8 | R1 = s-Bu R2 = Me R3 = prenyl X = OOH |
hyperscabrone I[c][e] | H. scabrum[a] | +24 (0.1, m)[b] | W. Gao 2016a, X. Wang 2021b | ||
| 123.9 | R1 = Ph R2 = Me R3 = prenyl X = H |
norascyronone C | H. ascyron[a] | +15 (0.1, m)[b] | Y.-L. Hu 2019 | ||
| 123.10 | R1 = Ph R2 = prenyl R3 = prenyl X = H |
hypseudohenrin E[c] | H. pseudohenryi[a] | +4.96 (3.43, m)[b] | H. Sun 2021b | ||
| 123.11 | R1 = Ph R2 = geranyl R3 = H X = H |
hyperhexanone B[c] | H. sampsonii[a] | −14.6 (0.15)[b] | H. Zhu 2016 | ||
|
|||||||
| 124.1 | R1 = i-Pr R2 = H |
hyperscabrin A[c] | H. scabrum[a] | −85.1 (0.06, mc)[b] | J. Ma 2012 | ||
| 124.2 | R1 = i-Pr R2 = prenyl |
hyperscabin K[d] | H. scabrum[a] | −198.3 (0.17, mc)[b] | J. Ma 2021b | ||
| 124.3 | R1 = s-Bu R2 = prenyl |
hyperscabin L[d][e] | H. scabrum[a] | −178.4 (0.19, mc)[b] | J. Ma 2021b | ||
|
|||||||
| 125.1 | hyperscabin J[c] | H. scabrum[a] | +36.6 (0.07, mc)[b] | J. Ma 2021b | |||
|
|||||||
| 126.1 | R = i-Pr | hyperscabrin B[c] | H. scabrum[a] | +27.6 (0.08, mc)[b] | J. Ma 2012 | ||
| 126.2 | R = s-Bu | hyperscabrin C[c][e] | H. scabrum[a] | +22.4 (0.10, mc)[b] | J. Ma 2012 | ||
|
|||||||
| 127.1 | norhypersampsone A | H. sampsonii[a] | −40.0 (0.5)[b] | J.-S. Zhang 2017 | |||
|
|||||||
| 128.1 | R1 = i-Pr R2 = Me |
yezo'otogirin C[c] | H. yezoense[a] | −57.2 (0.05)[b] | N. Tanaka 2009b | ||
| 128.2 | R1 = i-Pr R2 = prenyl |
yezo'otogirin A[c] | H. yezoense[a] | −168.2 (0.25)[b] | N. Tanaka 2009b | ||
| 128.3 | R1 = i-Bu R2 = Me |
ascynol E[c] | H. ascyron[a] | −39 (0.2, m)[b] | Y.-L. Hu 2025 | ||
| 128.4 | R1 = (S)-s-Bu R2 = Me |
hypermogin A[c] | H. monogynum[a] | −164.7 (0.2, m)[b] | Y.-R. Zeng 2021a | ||
| 128.5 | R1 = (S)-s-Bu R2 = prenyl |
yezo'otogirin B[c] | H. yezoense[a] | −165.7 (0.15)[b] | N. Tanaka 2009b | ||
|
|||||||
| 129.1 | R = i-Pr | hypermogin C[c] | H. monogynum[a] | −48.9 (0.12, m)[b] | Y.-R. Zeng 2021a | ||
| 129.2 | R = (S)-s-Bu | hypermogin B[c] | H. monogynum[a] | −38.0 (0.2, m)[b] | Y.-R. Zeng 2021a | ||
|
|||||||
| 130.1 | hypermogin D[c] | H. monogynum[a] | −32.0 (0.2, m)[b] | Y.-R. Zeng 2021a | |||
|
|||||||
| 131.1 | ascynol D[c] | H. ascyron[a] | −31 (0.1, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 132.1 | ascynol B[c] | H. ascyron[a] | +17 (0.1, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 133.1 | ascynol C[c] | H. ascyron[a] | −82 (0.06, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 134.1 | ascynol A[c] | H. ascyron[a] | −42.6 (0.06, m)[b] | Y.-L. Hu 2025 | |||
|
|||||||
| 135.1 | X = H | norascyronone A[c] | H. ascyron[a] | +68 (0.2, m)[b] | Y.-L. Hu 2019 | ||
| 135.2 | X = OH | norascyronone B[c] | H. ascyron[a] | +22 (0.2, m)[b] | Y.-L. Hu 2019 | ||
|
|||||||
| 136.1 | norprzewalsone A[c] | H. przewalskii[a] | +76.7 (0.4, m)[b] | Y. Duan 2022b | |||
|
|||||||
| 137.1 | hyperforatum A[c] | H. perforatum[a] | +2 (0.1, m)[b] | X. Wang 2024 | |||
|
|||||||
| 138.1 | hyperforatum B[e] | H. perforatum[a] | +7.5 (1.00, m)[b] | X. Wang 2024 | |||
|
|||||||
| 139.1 | hyperforatum C[e] | H. perforatum[a] | +5.9 (0.35, m)[b] | X. Wang 2024 | |||
|
|||||||
| 140.1 | R = i-Pr | hyperforone I[c] | H. perforatum[a] | +60.9 (0.6, m)[b] | Y. Guo 2021b | ||
| 140.2 | R = s-Bu | norprzewalsone B[c][e] | H. przewalskii[a] | +48.4 (0.3, m)[b] | Y. Duan 2022b | ||
|
|||||||
| 141.1 | hyperforone J[c] | H. perforatum[a] | −110.0 (0.3, m)[b] | Y. Guo 2021b | |||
|
|||||||
| 142.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
hookerione C[d] | H. hookerianum[a] | +2 (0.25, m)[b] | Y. Ye 2016 | ||
| 142.2 | R1 = i-Pr R2 = geranyl R3 = prenyl R4 = CH=CMe2 |
hypersubone C[d] | H. subsessile[a] | −13.3 (3.20, m)[b] | Y. Liao 2015 | ||
| 142.3 | R1 = i-Pr R2 = geranyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
hookerione A[d] | H. hookerianum[a] | +5 (0.25, m)[b] | Y. Ye 2016 | ||
| 142.4 | R1 = i-Pr R2 = geranyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
hookerione B[d] | H. hookerianum[a] | +32 (0.11, m)[b] | Y. Ye 2016 | ||
| 142.5 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
hirsuton B[d] | H. hirsutum[a] | +6.6 (0.30, m)[b] | J. Max 2021 | ||
| 142.6 | R1 = s-Bu R2 = prenyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
hirsuton A[d] | H. hirsutum[a] | +3.7 (0.83, m)[b] | J. Max 2021 | ||
| 142.7 | R1 = s-Bu R2 = geranyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
hookerione D[d][e] | H. hookerianum[a] | −27 (0.13, m)[b] | Y. Ye 2016 | ||
| 142.8 | R1 = Ph R2 = prenyl R3 = prenyl R4 = CH=CMe2 |
plukenetione A | C. plukenetii[a] | +1 (0.8)[b] | G. E. Henry 1996 | ||
| 142.9 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
(−)-28,29-epoxyplukenetione A[c] | C. havetiodes[a] var. stenocarpa, C. obdeltifolia[a] | −4.4 (1.0)[b] | O. E. Christian 2001, J. S. A. R. Teixeira 2005 | ||
| 142.10 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
(+)-28,29-epoxyplukenetione A[d] (enantiomer) | H. sampsonii[a] | +8.8 (0.54)[b] | H. Zhu 2014 | ||
| 142.11 | R1 = Ph R2 = (Z)-CH=CHCMe2OH R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
wilsonglucinol H[d] | H. wilsonii[a] | +2.4 (0.5, m)[b] | H. Cheng 2022a | ||
| 142.12 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
sampsonione Q[d] | H. sampsonii[a] | −9.65 (0.401)[b] | Z. Y. Xiao 2007 | ||
| 142.13 | R1 = Ph R2 = prenyl R3 = prenyl R4 = (S,S)-3-prenylmethyl-3-methyloxiran-2-yl |
hyperandrone A | H. androsaemum[a] | +20.9 (0.25, m)[b] | K. Wang 2012, X.-W. Yang 2018 | ||
| 142.14 | R1 = Ph R2 = prenyl R3 = (E)-4-oxo-3-methyl-2-buten-1-yl R4 = (S)-3,3-dimethyloxiran-2-yl |
hyperwilone A[d] | H. wilsonii[a] | +39.3 (0.65)[b] | J. Hao 2021 | ||
| 142.15 | R1 = Ph R2 = (E,R,R)-3,5-dimethyl-1-hepten-1-yl R3 = (E,E)-6-oxo-3,4-dimethyl-2,4-hexadien-1-yl R4 = CH=CMe2 |
sinaicinone | H. sinaicum[a] | +37.5 (0.17, mc)[b] | T. Řezanka 2007 | ||
| 142.16 | R1 = Ph R2 = geranyl R3 = prenyl R4 = CH=CMe2 |
otogirinin A | H. erectum[a] Thunb., H. attenuatum[a] | − 8.1 (0.08, m)[b] | Y. Ishida 2010, D. Li 2015a | ||
| 142.17 | R1 = Ph R2 = geranyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
sampsonione J[d] | H. sampsonii[a] | +1.48 (0.2)[b] | L.-H. Hu 1999a, H. Zhu 2014 | ||
| 142.18 | R1 = Ph R2 = geranyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
hyperisampsin G[d] | H. sampsonii[a] | −8.7 (0.80)[b] | H. Zhu 2014 | ||
| 142.19 | R1 = Ph R2 = (R)-lavandulyl[f] R3 = prenyl R4 = CH=CMe2 |
garcimultiflorone N[c][t][u][x] | G. multiflora[a] | −28.9 (0.090, m)[b] | Z.-Q. Wang 2018 | ||
| 142.20 | R1 = Ph R2 = lavandulyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
epi-isosampsonione J[d][e] | G. multiflora[a] | +55.0 (0.02, m)[b] | Y. Chen 2019a | ||
| 142.21 | R1 = Ph R2 = lavandulyl R3 = prenyl R4 = (S)-3,3-dimethyloxiran-2-yl |
garcimultiflorone D, a.k.a. isosampsonione J[e] (one of two by the first name) | G. multiflora[a] | +5.6 (0.12)[b] | C.-W. Ting 2012, Y. Chen 2019a | ||
| 142.22 | R1 = Ph R2 = (E,E)-7-hydroxy-3,7-dimethyl-2,5-octadienyl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
hypersubone D[d] | H. subsessile[a] | −32.8 (0.07, m)[b] | T.-W. Cao 2020 | ||
| 142.23 | R1 = Ph R2 = (E)-5-(3,3-dimethyloxiran-2-yl)-3-methyl-2-penten-1-yl R3 = prenyl R4 = (R)-3,3-dimethyloxiran-2-yl |
hypersubone E[d][e] | H. subsessile[a] | −12.7 (0.27, m)[b] | T.-W. Cao 2020 | ||
|
|||||||
| 143.1 | R = prenyl | cumilcinol G[d] | H. wilsonii[a] | +104.7 (0.2, m)[b] | B. Tao 2024a | ||
| 143.2 | R = geranyl | hyperattenin J[d] | H. attenuatum[a] Choisy | +23.8 (0.3, m)[b] | D. Li 2015b | ||
|
|||||||
| 144.1 | hyperadaman D[d] | H. wilsonii[a] | +47.7 (0.2, m)[b] | B. Tao 2024b | |||
|
|||||||
| 145.1 | wilsonglucinol I[d] | H. wilsonii[a] | +20.9 (0.25, m)[b] | H. Cheng 2022a | |||
|
|||||||
| 146.1 | garciyunnanone G[d] | G. yunnan[a] Hu | +4.4 (0.1, m)[b] | M. Nan 2024 | |||
|
|||||||
| 147.1 | R = i-Pr | hyperadaman G[d] | H. wilsonii[a] | +43.2 (0.2, m)[b] | B. Tao 2024b | ||
| 147.2 | R = Ph | hyperadaman F[d] | H. wilsonii[a] | +87.7 (0.6, m)[b] | B. Tao 2024b | ||
|
|||||||
| 148.1 | R = CH2COCHMe2 | hyperadaman B[d] | H. wilsonii[a] | +5.7 (0.2, m)[b] | B. Tao 2024b | ||
| 148.2 | R = CH2COC(Me)=CH2 | hyperadaman A[d] | H. wilsonii[a] | +17.0 (0.1, m)[b] | B. Tao 2024b | ||
|
|||||||
| 149.1 | hyperadaman E[d][z] | H. wilsonii[a] | +86.0 (0.2, m)[b] | B. Tao 2024b | |||
|
|||||||
| 150.1 | R1 = geranyl R2 = i-Pr X = OH |
hyperisampsin B[d] | H. sampsonii[a] | +2.6 (0.08)[b] | H. Zhu 2014 | ||
| 150.2 | R1 = geranyl R2 = i-Pr X = OOH |
hyperattenin L[d] | H. attenuatum[a] | −1.7 (0.42)[b] | D. Li 2018 | ||
| 150.3 | R1 = lavandulyl[f] R2 = H X = OOH |
garciyunnanone D[d][e] | G. yunnan[a] Hu | −5.4 (0.2, m)[b] | M. Nan 2024 | ||
|
|||||||
| 151.1 | R1 = i-Pr R2 = prenyl X = OH |
hyperihirsolin A | H. hirsutum[a] | −25.3 (0.62, m)[b] | J. Max 2021 | ||
| 151.2 | R1 = s-Bu R2 = prenyl X = OH |
hyperihirsolin B[e] | H. hirsutum[a] | −13.0 (0.90, m)[b] | J. Max 2021 | ||
| 151.3 | R1 = Ph R2 = prenyl X = OH |
hyperesternoid L[d] | H. monogynum[a] | −32.2 (0.2, m)[b] | Z. Dong 2026 | ||
| 151.4 | R1 = Ph R2 = geranyl X = OH |
hyperisampsin A[d] | H. sampsonii[a] | −25.9 (0.16)[b] | H. Zhu 2014 | ||
| 151.5 | R1 = Ph R2 = (R)-lavandulyl[f] X = OH |
garcimultiflorone O[c][t][v][x] | G. multiflora[a] | +1.4 (0.73, m)[b] | Z.-Q. Wang 2018 | ||
| 151.6 | R1 = Ph R2 = lavandulyl[f] X = OOH |
garciyunnanone C[d][e] | G. yunnan[a] Hu | −5.4 (0.2, m)[b] | M. Nan 2024 | ||
|
|||||||
| 152.1 | R = prenyl | hypersampsonone M[d] | H. sampsonii[a] | +10 (1.0, m)[b] | Y. Li 2023 | ||
| 152.2 | R = geranyl | hyperisampsin C[d] | H. sampsonii[a] | −19.7 (0.30)[b] | H. Zhu 2014 | ||
| 152.3 | R = lavandulyl | isohyperisampsin C[c][e] | G. multiflora[a] | +93.3 (0.02, m)[b] | Y. Chen 2019a | ||
| 152.4 | R = (R)-lavandulyl[f] | garciyunnanone E[d] | G. yunnan[a] Hu | +8.0 (0.2, m)[b] | M. Nan 2024 | ||
|
|||||||
| 153.1 | hyperadaman C[d] | H. wilsonii[a] | +36.2 (0.2, m)[b] | B. Tao 2024b | |||
|
|||||||
| 154.1 | R = prenyl X = OH |
hyperesternoid M[d] | H. monogynum[a] | −42.8 (0.1, m)[b] | Z. Dong 2026 | ||
| 154.2 | R = geranyl X = OOH |
hyperisampsin D[d] | H. sampsonii[a] | −25.1 (0.12)[b] | H. Zhu 2014 | ||
|
|||||||
| 155.1 | R = prenyl X = OOH |
hyperesternoid N[d] | H. monogynum[a] | −38.8 (0.2, m)[b] | Z. Dong 2026 | ||
| 155.2 | R = geranyl X = OH |
hypersubone B[d] | H. subsessile[a] | −52.2 (0.09, m)[b] | Y. Liao 2015 | ||
| 155.3 | R = lavandulyl X = OOH |
garciyunnanone F[d] | G. yunnan[a] Hu | −63.2 (0.2, m)[b] | M. Nan 2024 | ||
|
|||||||
| 156.1 | R1 = i-Pr R2 = prenyl R3 = CMe=CH2 X = OH |
cumilcinol H[d] | H. wilsonii[a] | −6.6 (0.5, m)[b] | B. Tao 2024a | ||
| 156.2 | R1 = Ph R2 = prenyl R3 = CMe=CH2 X = OH |
hyperisampsin E[d] | H. sampsonii[a] | +9.5 (0.23, m)[b] | H. Zhu 2014 | ||
| 156.3 | R1 = Ph R2 = prenyl R3 = CMe2OH X = H |
no common name | C. obdeltifolia[a] | +10.0 (0.4)[b] | J. S. A. R. Teixeira 2005 | ||
| 156.4 | R1 = Ph R2 = prenyl R3 = CMe2OH X = OH |
hyperisampsin F[d] | H. sampsonii[a] | +2.0 (0.10, m)[b] | H. Zhu 2014 | ||
| 156.5 | R1 = Ph R2 = geranyl R3 = CMe=CH2 X = OH |
sampsonione I[d] | H. sampsonii[a] | +16.88 (0.1)[b] | L.-H. Hu 1999a, H. Zhu 2014 | ||
| 156.6 | R1 = Ph R2 = (R)-lavandulyl[f] R3 = CMe=CH2 X = OH |
garciyunnanone A[d] | G. yunnan[a] Hu | +6.6 (0.1, m)[b] | M. Nan 2024 | ||
|
|||||||
| 157.1 | garciyunnanone B[d][e] | G. yunnan[a] Hu | +27.5 (0.2, m)[b] | M. Nan 2024 | |||
|
|||||||
| 158.1 | R = i-Pr | hyperesternoid I[d] | H. monogynum[a] | −27.9 (0.2, m)[b] | Z. Dong 2026 | ||
| 158.2 | R = i-Bu | hyperesternoid J[d] | H. monogynum[a] | −31.7 (0.2, m)[b] | Z. Dong 2026 | ||
| 158.3 | R = (R)-s-Bu | hyperesternoid K[d] | H. monogynum[a] | −25.8 (0.2, m)[b] | Z. Dong 2026 | ||
|
|||||||
| 159.1 | hyperesternoid G[d] | H. kouytchemse[a] | −53.9 (0.3, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 160.1 | hyperesternoid H[d] | H. kouytchemse[a] | −78.4 (0.2, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 161.1 | R1 = prenyl R2 = CO2Me R3 = (S)-3,3-dimethyloxiran-2-yl |
hookerione G[d] | H. hookerianum[a] | −213 (0.25, m)[b] | Y. Ye 2016 | ||
| 161.2 | R1 = geranyl R2 = H R3 = (S)-3,3-dimethyloxiran-2-yl |
hookerione H[d] | H. hookerianum[a] | −152 (0.14, m)[b] | Y. Ye 2016 | ||
| 161.3 | R1 = geranyl R2 = CO2Me R3 = CH=CMe2 |
hypersubone A[d] | H. subsessile[a] | −142.5 (0.09, m)[b] | Y. Liao 2015 | ||
| 161.4 | R1 = geranyl R2 = CO2Me R3 = (R)-3,3-dimethyloxiran-2-yl |
hookerione E[d] | H. hookerianum[a] | −146 (0.16, m)[b] | Y. Ye 2016 | ||
| 161.5 | R1 = geranyl R2 = CO2Me R3 = (S)-3,3-dimethyloxiran-2-yl |
hookerione F[d] | H. hookerianum[a] | −198 (0.12, m)[b] | Y. Ye 2016 | ||
|
|||||||
| 162.1 | cumilcinol I[d] | H. wilsonii[a] | +108.5 (0.2, m)[b] | B. Tao 2024a | |||
|
|||||||
| 163.1 | R = H | patumantane C[d] | H. patulum[a] | −190.7 (0.1, m)[b] | Y. Duan 2024c | ||
| 163.2 | R = CO2Me | patumantane B[d] | H. patulum[a] | −68.0 (0.1, acn)[b] | Y. Duan 2024c | ||
|
|||||||
| 164.1 | patumantane D[d] | H. patulum[a] | −75.3 (0.1, m)[b] | Y. Duan 2024c | |||
|
|||||||
| 165.1 | R1 = i-Pr R2 = prenyl R3 = CMe2OH R4 = prenyl |
hirsutofolin A | H. hirsutum[a] | +5.8 (0.65, m)[b] | J. Max 2021 | ||
| 165.2 | R1 = i-Pr R2 = prenyl R3 = CMe2OOH R4 = prenyl |
peroxyhirsutofolin A | H. hirsutum[a] | +12.0 (0.79, m)[b] | J. Max 2021 | ||
| 165.3 | R1 = i-Pr R2 = prenyl R3 = CMe2OOH R4 = prenyl |
hyperesternoid V[d] (prob. enantiomer) | H. monogynum[a] | −35.2 (0.1, m)[b] | Z. Dong 2026 | ||
| 165.4 | R1 = i-Pr R2 = geranyl R3 = CMe2OH R4 = prenyl |
hyperacmosin F | H. acmosepalum[a] | −16.3 (0.10, m)[b] | X. Wang 2020a | ||
| 165.5 | R1 = i-Bu R2 = prenyl R3 = CMe2OH R4 = prenyl |
hyperesternoid T[d] | H. monogynum[a] | −43.3 (0.2, m)[b] | Z. Dong 2026 | ||
| 165.6 | R1 = i-Bu R2 = prenyl R3 = CMe2OOH R4 = prenyl |
hyperesternoid U[d] | H. monogynum[a] | −45.2 (0.1, m)[b] | Z. Dong 2026 | ||
| 165.7 | R1 = s-Bu R2 = prenyl R3 = CMe2OH R4 = prenyl |
hirsutofolin B[d][e] | H. hirsutum[a] | −12.8 (1.15, m)[b] | J. Max 2021 | ||
| 165.8 | R1 = s-Bu R2 = prenyl R3 = CMe2OH R4 = prenyl |
hyperwilone B[c][e] (prob. enantiomer) | H. wilsonii[a] | +51.1 (0.50)[b] | J. Hao 2021 | ||
| 165.9 | R1 = (R)-s-Bu R2 = prenyl R3 = CMe2OOH R4 = prenyl |
hyperesternoid W[d] | H. monogynum[a] | −39.9 (0.1, m)[b] | Z. Dong 2026 | ||
| 165.10 | R1 = s-Bu R2 = prenyl R3 = CMe2OH R4 = E-CH=CHCMe2OOH |
3′-hydroperoxyisohirsutofolin B[e] | H. hirsutum[a] | +20.1 (0.52, m)[b] | J. Max 2021 | ||
| 165.11 | R1 = Ph R2 = prenyl R3 = CMe2OH R4 = prenyl |
sampsonione R | C. obdeltifolia, H. sampsonii, H. attenuatum[a] | +10.8 (0.011)[b] | F. G. Cruz 2004, Z. Y. Xiao 2007, D. Li 2015a | ||
| 165.12 | R1 = Ph R2 = prenyl R3 = CMe2OOH R4 = prenyl |
hyperesternoid X[d] | H. monogynum[a] | −42.3 (0.1, m)[b] | Z. Dong 2026 | ||
| 165.13 | R1 = Ph R2 = geranyl R3 = CMe2OH R4 = prenyl |
otogirinin C | H. erectum[a] Thunb. | NR | Y. Ishida 2010 | ||
| 165.14 | R1 = Ph R2 = lavandulyl R3 = CMe=CH2 R4 = OH |
epi-garcimultiflorone P[d][e] | G. multiflora[a] | +5.32 (0.02, m)[b] | H. Teng 2019 | ||
|
|||||||
| 166.1 | R1 = i-Pr R2 = geranyl R3 = CMe2OH R4 = prenyl |
pseudohenone F | H. pseudohenryi[a] N. Robson | −7 (0.10, m)[b] | X.-W. Yang 2017b | ||
| 166.2 | R1 = s-Bu R2 = geranyl R3 = CMe2OH R4 = prenyl |
pseudohenone G[e] | H. pseudohenryi[a] N. Robson | −8 (0.15, m)[b] | X.-W. Yang 2017b | ||
| 166.3 | R1 = Ph R2 = (R)-lavandulyl[f] R3 = CMe=CH2 R4 = OH |
garcimultiflorone P[c][t][u][x] | G. multiflora[a] | −5.1 (0.19, m)[b] | Z.-Q. Wang 2018 | ||
|
|||||||
| 167.1 | hypersampsone L | H. sampsonii[a] | −67.4 (0.098)[b] | Y. H. Zeng 2012 | |||
|
|||||||
| 168.1 | hypersampsone S (one of two by that name) | H. sampsonii[a] | +33 (0.3)[b] | J.-J. Chen 2014 | |||
|
|||||||
| 169.1 | R = prenyl | hypseudohenone B[d] | H. pseudohenryi[a] | +13.5 (0.147, m)[b] | N.-N. Jiang 2023 | ||
| 169.2 | R = geranyl | hypseudohenone C[d] | H. pseudohenryi[a] | +13.1 (0.106, m)[b] | N.-N. Jiang 2023 | ||
|
|||||||
| 170.1 | hypseudohenone A[d] | H. pseudohenryi[a] | +19.6 (0.222, m)[b] | N.-N. Jiang 2023 | |||
|
|||||||
| 171.1 | patumantane A[d] | H. patulum[a] | −56.9 (0.1, m)[b] | Y. Duan 2024c | |||
|
|||||||
| 172.1 | R1 = C(=O)i-Pr R2 = geranyl |
norsampsone E[d] | H. sampsonii[a] | −63.0 (0.30)[b] | W.-J. Tian 2017 | ||
| 172.2 | R1 = C(=O)Ph R2 = geranyl |
hyperacmosin E | H. acmosepalum[a] | −57.6 (0.175)[b] | X. Wang 2020a | ||
| 172.3 | R1 = (R)-CHPhCH2CO2H R2 = prenyl |
lathrophytoic acid A | Kielmeyera lathrophyton | +15 (0.23, m)[b] | M. F. de Almeida 2011 | ||
|
|||||||
| 173.1 | R = prenyl | hypersampsone N[d] | H. sampsonii[a] | +34.4 (0.50)[b] | W.-J. Tian 2014b | ||
| 173.2 | R = geranyl | hypersampsonone E[d] | H. sampsonii[a] | +3.21 (1.06)[b] | J.-S. Zhang 2016 | ||
|
|||||||
| 174.1 | R1 = i-Pr R2 = prenyl R3 = E-CH=CHCMe2OH |
3′-hydroxyisohirsutuman A | H. hirsutum[a] | –35.2 (0.13, m)[b] | J. Max 2021 | ||
| 174.2 | R1 = i-Pr R2 = geranyl R3 = prenyl |
hyperwilsol B[d] | H. wilsonii[a] | −72.34 (0.05, m)[b] | Z.-X. Wang 2025 | ||
| 174.3 | R1 = s-Bu R2 = prenyl R3 = prenyl |
hirsutuman B[e] | H. hirsutum[a] | −61.9 (0.68, m)[b] | J. Max 2021 | ||
| 174.4 | R1 = s-Bu R2 = prenyl R3 = E-CH=CHCMe2OH |
3′-hydroxyisohirsutuman B[e] | H. hirsutum[a] | −69.5 (0.19, m)[b] | J. Max 2021 | ||
| 174.5 | R1 = Ph R2 = prenyl R3 = prenyl |
sampsonione B | C. obdeltifolia, G. propinqua, H. sampsonii[a] | +10.0 (0.018)[b] | L.-H. Hu 1998, F. G. Cruz 2004, T. Sriyatep 2017 | ||
| 174.6 | R1 = Ph R2 = prenyl R3 = CH2CH2CMe2OH |
no common name | C. obdeltifolia[a] | −5.1 (0.012)[b] | F. G. Cruz 2004 | ||
| 174.7 | R1 = Ph R2 = prenyl R3 = (E)-CH=CHCMe2OH |
hyphenrone M | H. sampsonii[a] | −82 (0.2, m)[b] | X.-W. Yang 2015 | ||
| 174.8 | R1 = Ph R2 = (R)-CH2CHOHCMe2OH R3 = prenyl |
wilsonglucinol J[c] | H. wilsonii[a] | +10.7 (0.5, m)[b] | H. Cheng 2022a | ||
| 174.9 | R1 = Ph R2 = geranyl R3 = prenyl |
sampsonione A | H. sampsonii[a] | −49 (0.4)[b] | L.-H. Hu 1998 | ||
| 174.10 | R1 = Ph R2 = geranyl R3 = (E)-CH=CHCMe2OH |
hyphenrone N | H. sampsonii[a] | −89 (0.2, m)[b] | X.-W. Yang 2015 | ||
| 174.11 | R1 = Ph R2 = geranyl R3 = (E)-CH=CHCMe2OMe |
hypersampsonone D[d] | H. sampsonii[a] | −66.2 (0.52)[b] | J.-S. Zhang 2016 | ||
|
|||||||
| 175.1 | R1 = i-Pr R2 = prenyl |
hyperhomanoon A[d] | H. patulum[a] | +6.2 (0.3, m)[b] | B. Tao 2025 | ||
| 175.2 | R1 = (S)-s-Bu R2 = prenyl |
hyperhomanoon B[d] | H. patulum[a] | +45.0 (0.1, m)[b] | B. Tao 2025 | ||
| 175.3 | R1 = Ph R2 = prenyl |
hypersampsone O[d] | H. sampsonii[a] | +15.2 (0.50)[b] | W.-J. Tian 2014b | ||
| 175.4 | R1 = Ph R2 = geranyl |
hyphenrone O | H. sampsonii[a] | −9 (0.1, m)[b] | X.-W. Yang 2015 | ||
| 175.5 | R1 = Ph R2 = (R)-lavandulyl[f] |
garciyunnanone R[d] | G. yunnan[a] Hu | +9.2 (0.05, m)[b] | M. Nan 2024 | ||
|
|||||||
| 176.1 | hyperhomanoon E[d] | H. patulum[a] | −2.90 (0.5, m)[b] | B. Tao 2025 | |||
|
|||||||
| 177.1 | R = prenyl | hyperhomanoon D[d] | H. patulum[a] | +95.3 (0.4, m)[b] | B. Tao 2025 | ||
| 177.2 | R = geranyl | hyperhomanoon C[d] | H. patulum[a] | +26.2 (0.4, acn)[b] | B. Tao 2025 | ||
|
|||||||
| 178.1 | R1 = i-Pr R2 = prenyl R3 = CMe2OH |
hyperihirsan B | H. hirsutum[a] | +47.9 (0.18, m)[b] | J. Max 2021 | ||
| 178.2 | R1 = i-Pr R2 = geranyl R3 = CMe2OH |
hypersubone G[d] | H. subsessile[a] | +37.5 (0.13, m)[b] | T.-W. Cao 2020 | ||
| 178.3 | R1 = i-Pr R2 = geranyl R3 = CMe2OOH |
hypersubone H[d] | H. subsessile[a] | +89.3 (0.08, m)[b] | T.-W. Cao 2020 | ||
| 178.4 | R1 = Ph R2 = prenyl R3 = CMe2OH |
plukenetione C | C. plukenetii, H. sampsonii[a] | +65.9 (0.1)[b] | G. E. Henry 1999, O. E. Christian 2001, Z. Y. Xiao 2010 | ||
| 178.5 | R1 = Ph R2 = prenyl R3 = CMe2OOH |
peroxysampsone A | H. sampsonii[a] | +17.0 (0.128)[b] | Z. Y. Xiao 2010 | ||
| 178.6 | R1 = Ph R2 = (E)-CH=CHCMe2OOH R3 = CMe2OH |
33-hydroperoxyisoplukenetione C | C. havetiodes[a] var. stenocarpa | −3.9 (0.2)[b] | O. E. Christian 2001 | ||
| 178.7 | R1 = Ph R2 = geranyl R3 = CMe2OH |
otogirinin B | H. erectum[a] Thunb., H. attenuatum[a] | +12.0 (0.14, m)[b] | Y. Ishida 2010, D. Li 2015a | ||
| 178.8 | R1 = Ph R2 = geranyl R3 = CMe2OOH |
hyperisampsin O[d] | H. sampsonii[a] | +12 (0.2, m)[b] | H.-C. Zhu 2017 | ||
| 178.9 | R1 = Ph R2 = lavandulyl R3 = OH |
garcimultinone B[d][e] | G. multiflora[a] | +28.3 (0.04, m)[b] | Y. Chen 2019a | ||
| 178.10 | R1 = Ph R2 = lavandulyl R3 = CMe2OH |
garcimultiflorone G[e] | G. multiflora[a] | +5.6 (0.12)[b] | C.-W. Ting 2014 | ||
| 178.11 | R1 = Ph R2 = lavandulyl R3 = CMe2OOH |
isohyperisampsin O[d][e] | G. multiflora[a] | +22.4 (0.06, m)[b] | Y. Chen 2019a | ||
| 178.12 | R1 = Ph R2 = (2S,3E)-CH2CH(CMe=CH2)CH=CHCMe2OOH R3 = CMe2OH |
garcimultiflorone Q[c][t][u][x] | G. multiflora[a] | −11.1 (0.21, m)[b] | Z.-Q. Wang 2018 | ||
|
|||||||
| 179.1 | R = geranyl X = H |
hypersubone F[d] | H. subsessile[a] | −73.4 (0.12, m)[b] | T.-W. Cao 2020 | ||
| 179.2 | R = geranyl X = OH |
hyperisampsin N[d] | H. sampsonii[a] | −31 (0.1)[b] | H.-C. Zhu 2017 | ||
| 179.3 | R = geranyl X = OOH |
hyperbeanin G[c] | H. beanii[a] | −40.0 (0.08, m)[b] | Y. Ma 2022a | ||
| 179.4 | R = lavandulyl X = OH |
garcimultinone N[d] | G. multiflora[a] | +12.59 (0.04, m)[b] | H. Teng 2021 | ||
|
|||||||
| 180.1 | peroxysampsone B | H. sampsonii, H. attenuatum[a] | −41.2 (0.042)[b] | Z. Y. Xiao 2010, D. Li 2015a | |||
|
|||||||
| 181.1 | R = i-Pr | pyranohyperihirsan A | H. hirsutum[a] | −24.7, (0.29, m)[b] | J. Max 2021 | ||
| 181.2 | R = s-Bu | pyranohyperihirsan B[e] | H. hirsutum[a] | −30.7 (0.25, m)[b] | J. Max 2021 | ||
|
|||||||
| 182.1 | hyperattenin M[d][s] | H. attenuatum[a] | −24.1 (0.19, m)[b] | D. Li 2018 | |||
|
|||||||
| 183.1 | R = geranyl | hypersampsonone B[d] | H. sampsonii[a] | +14.9 (0.35)[b] | J.-S. Zhang 2016 | ||
| 183.2 | R = lavandulyl | isohypersampsonone B[d][e] (inseparably mixed with epi-isohypersampsonone B, epimer at hemiacetal, in 5:1 ratio) | G. multiflora[a] | +60.0 (0.01, m)[b] | Y. Chen 2019a | ||
|
|||||||
| 184.1 | hyperesternoid Y[d] | H. monogynum[a] | −42.3 (0.1, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 185.1 | hyperesternoid Z[d] | H. monogynum[a] | −48.7 (0.1, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 186.1 | wilsonglucinol A[d] | H. wilsonii[a] | −14.4 (0.63, m)[b] | Y. Zhang 2020 | |||
|
|||||||
| 187.1 | R1 = i-Pr R2 = prenyl |
wilsonglucinol C[d] | H. wilsonii[a] | −94.8 (0.84, m)[b] | Y. Zhang 2020 | ||
| 187.2 | R1 = s-Bu R2 = prenyl |
cumilcinol C[d][e] | H. wilsonii[a] | −137.0 (0.1, m)[b] | B. Tao 2024a | ||
| 187.3 | R1 = Ph R2 = prenyl |
wilsonglucinol B[d] | H. wilsonii[a] | −51.2 (0.73, m)[b] | Y. Zhang 2020 | ||
| 187.4 | R1 = Ph R2 = (E)-CH=CHCMe2OH |
wilsonglucinol K, a.k.a. hypersampsone Y[d] | H. wilsonii[a] | −4.0 (0.5, m)[b], −74.0 (0.1, m)[b] | H. Cheng 2022a, J. Cao 2024 | ||
|
|||||||
| 188.1 | garcimultinone C[d][e] | G. multiflora[a] | −59.4 (0.02, m)[b] | H. Teng 2019 | |||
|
|||||||
| 189.1 | R = i-Bu | hyperesternoid D[d] | H. monogynum[a] | −69.8 (0.3, m)[b] | Z. Dong 2026 | ||
| 189.2 | R = (R)-s-Bu | hyperesternoid E[d] | H. monogynum[a] | −58.7 (0.3, m)[b] | Z. Dong 2026 | ||
|
|||||||
| 190.1 | hyperesternoid F[d] | H. monogynum[a] | −87.2 (0.3, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 191.1 | R1 = i-Pr R2 = prenyl |
cumilcinol A[d] | H. wilsonii[a] | +170.8 (0.3, m)[b] | B. Tao 2024a | ||
| 191.2 | R1 = Ph R2 = prenyl |
dioxasampsone B[d] | H. sampsonii[a] | +77.0 (0.50)[b] | W.-J. Tian 2014c | ||
| 191.3 | R1 = Ph R2 = geranyl |
hypersampsonone C[d] | H. sampsonii[a] | +6.7 (0.15)[b] | J.-S. Zhang 2016 | ||
| 191.4 | R1 = Ph R2 = lavandulyl |
isohypersampsonone C[d][e] | G. multiflora[a] | +81.7 (0.02, m)[b] | Y. Chen 2019a | ||
|
|||||||
| 192.1 | R1 = i-Pr R2 = geranyl X = H2 |
hookerione Q | H. hookerianum[a] | +11.2 (0.12, m)[b] | Y. Ye 2019 | ||
| 192.2 | R1 = Ph R2 = prenyl X = H2 |
hypersampsone M[d] | G. propinqua, H. sampsonii[a] | +56.6 (0.50)[b] | W.-J. Tian 2014a, T. Sriyatep 2017 | ||
| 192.3 | R1 = Ph R2 = prenyl X = O |
pseudohenone C | H. pseudohenryi[a] N. Robson | −5 (0.24, m)[b] | X.-W. Yang 2017b | ||
| 192.4 | R1 = Ph R2 = (E)-4-oxoprenyl X = H2 |
pseudohenone B | H. pseudohenryi[a] N. Robson | +7 (0.10, m)[b] | X.-W. Yang 2017b | ||
| 192.5 | R1 = Ph R2 = geranyl X = H2 |
hypersampsone I | H. sampsonii[a] | +18.6 (0.262)[b] | Y. H. Zeng 2012 | ||
| 192.6 | R1 = Ph R2 = geranyl X = O |
sampsonione E | H. sampsonii, H. attenuatum[a] | +57.7 (0.03)[b] | L.-H. Hu 1999b, D. Li 2015a | ||
| 192.7 | R1 = Ph R2 = lavandulyl X = O |
garciyunnanone I[d][e] | G. yunnan[a] Hu | +2 (0.1, m)[b] | M. Nan 2024 | ||
|
|||||||
| 193.1 | R1 = i-Pr R2 = geranyl X = H2 |
hypersampsone C | H. sampsonii[a] | +14.3 (0.2)[b] | Y.-L. Lin 2003 | ||
| 193.2 | R1 = Ph R2 = prenyl X = H2 |
hypersampsone P[d] | H. sampsonii, H. subsessile[a] | +11.0 (0.3)[b] | W.-J. Tian 2014b, H.-M. Zhou 2020 | ||
| 193.3 | R1 = Ph R2 = prenyl X = O |
hyperattenin F[d] | H. attenuatum[a] Choisy | −2.9 (0.10, m)[b] | D. Li 2015a | ||
| 193.4 | R1 = Ph R2 = CH2C(=O)CMe=CH2 X = H2 |
pseudohenone D[d] | H. pseudohenryi[a] N. Robson | +6 (0.28, m)[b] | X.-W. Yang 2017b | ||
| 193.5 | R1 = Ph R2 = geranyl X = H2 |
sampsonione H | H. sampsonii[a] | +5.15 (0.07)[b] | L.-H. Hu 1999b | ||
| 193.6 | R1 = Ph R2 = geranyl X = O |
hyperattenin G[d] | H. attenuatum[a] Choisy | −6.9 (0.16, m)[b] | D. Li 2015a | ||
| 193.7 | R1 = Ph R2 = lavandulyl X = H2 |
iso-sampsonione H[d][e] | G. multiflora[a] | +11.84 (0.08, m)[b] | H. Teng 2019 | ||
| 193.8 | R1 = Ph R2 = lavandulyl X = O |
garciyunnanone J[d][e] | G. yunnan[a] Hu | +5 (0.1, m)[b] | M. Nan 2024 | ||
| 193.9 | R1 = Ph R2 = (E)-6,6-dimethoxy-3-methyl-2-hexenyl X = H2 |
hypercurpalone B[d] | H. curvisepalum[a] | +1.94 (0.10, m)[b] | Y. Ye 2022 | ||
|
|||||||
| 194.1 | R1 = i-Pr R2 = prenyl R3 = i-Pr X = H |
hookerione M | H. hookerianum[a] | +68.1 (0.08, m)[b] | Y. Ye 2019 | ||
| 194.2 | R1 = i-Pr R2 = prenyl R3 = CMe2OH X = H |
wilsonglucinol G[d] | H. wilsonii[a] | +26.3 (0.27, m)[b] | Y. Zhang 2020 | ||
| 194.3 | R1 = i-Pr R2 = prenyl R3 = CMe2OOH X = H |
hyperesternoid Q[d] | H. monogynum[a] | −22.4 (0.1, m)[b] | Z. Dong 2026 | ||
| 194.4 | R1 = i-Pr R2 = geranyl R3 = CMe=CH2 X = H |
hypersampsone A | H. sampsonii[a] | +21 (0.3)[b] | Y.-L. Lin 2003 | ||
| 194.5 | R1 = s-Bu R2 = prenyl R3 = CMe2OH X = H |
hirsutusal C[e] | H. hirsutum[a] | N/A | J. Max 2021 | ||
| 194.6 | R1 = Ph R2 = prenyl R3 = i-Pr X = H |
hookerione L | H. hookerianum[a] | +31.4 (0.10, m)[b] | Y. Ye 2019 | ||
| 194.7 | R1 = Ph R2 = prenyl R3 = CMe=CH2 X = H |
hypersampsone X[d] | H. sampsonii[a] | +27.1 (0.50)[b] | W.-J. Tian 2017 | ||
| 194.8 | R1 = Ph R2 = prenyl R3 = CMe2OH X = H |
plukenetione B | C. plukenetii[a] | +17.2 (0.03)[b] | G. E. Henry 1999, R. B. Grossman 2000 | ||
| 194.9 | R1 = Ph R2 = prenyl R3 = CMe2OOH X = H |
hyperbeanin F[c] | H. beanii[a] | +10.0 (0.11, m)[b] | Y. Ma 2022a | ||
| 194.10 | R1 = Ph R2 = prenyl R3 = CMe2OH X = OH |
hyperesternoid O[d] | H. monogynum[a] | −45.9 (0.3, m)[b] | Z. Dong 2026 | ||
| 194.11 | R1 = Ph R2 = prenyl R3 = OH X = H |
hypersampsonone L[d] | H. sampsonii[a] | +10 (1.0, m)[b] | Y. Li 2023 | ||
| 194.12 | R1 = Ph R2 = geranyl R3 = i-Pr X = H |
hypersampsone D | H. sampsonii[a] | −35 (0.2)[b] | Y.-L. Lin 2003 | ||
| 194.13 | R1 = Ph R2 = geranyl R3 = CMe=CH2 X = H |
sampsonione D | H. sampsonii[a] | +12.27 (0.156)[b] | L.-H. Hu 1999b | ||
| 194.14 | R1 = Ph R2 = geranyl R3 = CMe2OH X = H |
sampsonione C | H. sampsonii, H. attenuatum[a] | +13.39 (0.174)[b] | L.-H. Hu 1999b, D. Li 2015a | ||
| 194.15 | R1 = Ph R2 = geranyl R3 = CMe2OOH X = H |
hypersampsonone F[d] | H. sampsonii[a] | +6.73 (1.04)[b] | J.-S. Zhang 2016 | ||
| 194.16 | R1 = Ph R2 = geranyl R3 = OH X = H |
cumilcinol D[d] | H. wilsonii[a] | −4.9 (0.3, m)[b] | B. Tao 2024a | ||
| 194.17 | R1 = Ph R2 = neryl R3 = i-Pr X = H |
hookerione I | H. hookerianum[a] | +24.2 (0.25, m)[b] | Y. Ye 2019 | ||
| 194.18 | R1 = Ph R2 = lavandulyl R3 = CMe=CH2 X = H |
garciyunnanone K[d][e] | G. yunnan[a] Hu | +12.9 (0.1, m)[b] | M. Nan 2024 | ||
| 194.19 | R1 = Ph R2 = lavandulyl R3 = i-Pr X = H |
garciyunnanone N[d][e] | G. yunnan[a] Hu | +1.0 (0.2, m)[b] | M. Nan 2024 | ||
| 194.20 | R1 = Ph R2 = lavandulyl R3 = CMe2OH X = H |
garciyunnanone Q[d][e] | G. yunnan[a] Hu | +25.6 (0.2, m)[b] | M. Nan 2024 | ||
| 194.21 | R1 = Ph R2 = lavandulyl R3 = CMe2OOH X = H |
iso-hypersampsonone F[d][e] | G. multiflora[a] | +5.60 (0.01, m)[b] | H. Teng 2019 | ||
| 194.22 | R1 = Ph R2 = lavandulyl R3 = OH X = H |
garcimultinone A[d][e] | G. multiflora[a] | −25.6 (0.02, m)[b] | Y. Chen 2019a | ||
|
|||||||
| 195.1 | R1 = i-Pr R2 = prenyl R3 = CMe2OH |
wilsonglucinol F[d] | H. wilsonii[a] | +29.2 (0.55, m)[b] | Y. Zhang 2020 | ||
| 195.2 | R1 = i-Pr R2 = geranyl R3 = CMe=CH2 |
hookerione O | H. hookerianum[a] | +39.1 (0.25, m)[b] | Y. Ye 2019 | ||
| 195.3 | R1 = s-Bu R2 = prenyl R3 = CMe2OH |
cumilcinol F[d][e] | H. wilsonii[a] | +104.7 (0.2, m)[b] | B. Tao 2024a | ||
| 195.4 | R1 = Ph R2 = prenyl R3 = i-Pr |
hyperacmone F[d] | H. maclarenii[a] | +10.32 (0.126, m)[b] | W.-L. Meng 2026 | ||
| 195.5 | R1 = Ph R2 = prenyl R3 = CMe2OH |
hypersampsone Q[d] | H. sampsonii[a] | +18.3 (0.4)[b] | W.-J. Tian 2014b | ||
| 195.6 | R1 = Ph R2 = geranyl R3 = i-Pr |
hypersampsone G | H. sampsonii[a] | +10.25 (0.401)[b] | Y. H. Zeng 2009 | ||
| 195.7 | R1 = Ph R2 = geranyl R3 = CMe=CH2 |
hypersampsone J | H. sampsonii[a] | +11.4 (0.573)[b] | Y. H. Zeng 2012 | ||
| 195.8 | R1 = Ph R2 = geranyl R3 = CMe2OH |
hypersampsonone G[d] | H. sampsonii[a] | +4.22 (0.9)[b] | J.-S. Zhang 2016 | ||
| 195.9 | R1 = Ph R2 = geranyl R3 = CMe2OOH |
hyperattenin K[d] | H. attenuatum[a] Choisy | −11.5 (0.886, m)[b] | D. Li 2015b | ||
| 195.10 | R1 = Ph R2 = lavandulyl R3 = CMe2OH |
isohypersampsonone G[d][e] | G. multiflora[a] | +34.2 (0.01, m)[b] | Y. Chen 2019a | ||
|
|||||||
| 196.1 | R1 = i-Pr R2 = prenyl R3 = CMe2OH X = H |
wilsonglucinol D[d] | H. wilsonii[a] | −17.7 (0.92, m)[b] | Y. Zhang 2020 | ||
| 196.2 | R1 = i-Pr R2 = prenyl R3 = CMe2OH X = H |
hyperwilone C[c] (enantiomer) | H. wilsonii[a] | +47.3 (0.50, m)[b] | J. Hao 2021 | ||
| 196.3 | R1 = s-Bu R2 = prenyl R3 = CMe2OH X = H |
wilsonglucinol E, a.k.a. hirsutusal D[d][e] | H. wilsonii[a] | −9.9 (0.34, m)[b] | Y. Zhang 2020, J. Max 2021 | ||
| 196.4 | R1 = Ph R2 = prenyl R3 = OH X = H |
no common name | C. obdeltifolia, G. propinqua[a] | NR | F. G. Cruz 2004, T. Sriyatep 2017 | ||
| 196.5 | R1 = Ph R2 = prenyl R3 = i-Pr X = H |
hyphenrone Q | H. sampsonii[a] | −4 (0.2, m)[b] | X.-W. Yang 2015 | ||
| 196.6 | R1 = Ph R2 = prenyl R3 = CMe2OH X = H |
attenuatumione A[c] | H. attenuatum[a] | −19.3 (0.18)[b] | Z.-B. Zhou 2014, X.-W. Yang 2018 | ||
| 196.7 | R1 = Ph R2 = prenyl R3 = CMe2OH X = OH |
hyperesternoid P[d] | H. monogynum[a] | −52.2 (0.2, m)[b] | Z. Dong 2026 | ||
| 196.8 | R1 = Ph R2 = prenyl R3 = CMe2OH X = H |
hypercohone A[d] (prob. enantiomer) | H. cohaerens[a] | +3.87 (0.21, m)[b] | X. Liu 2013b | ||
| 196.9 | R1 = Ph R2 = geranyl R3 = i-Pr X = H |
hookerione K | H. hookerianum[a] | −33.1 (0.27, m)[b] | Y. Ye 2019 | ||
| 196.10 | R1 = Ph R2 = geranyl R3 = CMe2OH X = H |
attenuatumione D | H. attenuatum[a] | −10.8 (0.15)[b] | Z.-B. Zhou 2014 | ||
| 196.11 | R1 = Ph R2 = geranyl R3 = CMe2OOH X = H |
hyperattenin I[d] | H. attenuatum[a] Choisy | −24.5 (0.23, m)[b] | D. Li 2015a | ||
| 196.12 | R1 = Ph R2 = (Z)-geranyl R3 = CMe2OH X = H |
hyperacmone G[d] | H. maclarenii[a] | –30.52 (0.057, m)[b] | W.-L. Meng 2026 | ||
| 196.13 | R1 = Ph R2 = lavandulyl R3 = CMe=CH2 X = H |
garciyunnanone L[d][e] | G. yunnan[a] Hu | −5.7 (0.2, m)[b] | M. Nan 2024 | ||
| 196.14 | R1 = Ph R2 = lavandulyl R3 = i-Pr X = H |
garciyunnanone O[d][e] | G. yunnan[a] Hu | +2.0 (0.1, m)[b] | M. Nan 2024 | ||
|
|||||||
| 197.1 | R1 = i-Pr R2 = prenyl R3 = i-Pr |
hookerione N | H. hookerianum[a] | −10.3 (0.13, m)[b] | Y. Ye 2019 | ||
| 197.2 | R1 = i-Pr R2 = prenyl R3 = CMe2OH |
hirsutusal A[e] | H. hirsutum[a] | +36.7 (0.18, m)[b] | J. Max 2021 | ||
| 197.3 | R1 = i-Pr R2 = prenyl R3 = OH |
cumilcinol E[d] | H. wilsonii[a] | −2.0 (0.1, m)[b] | B. Tao 2024a | ||
| 197.4 | R1 = i-Pr R2 = geranyl R3 = i-Pr |
hypersampsone B | H. sampsonii[a] | +12 (0.3)[b] | Y.-L. Lin 2003 | ||
| 197.5 | R1 = i-Pr R2 = geranyl R3 = CMe2OH |
hookerione P | H. hookerianum[a] | −10.3 (0.13, m)[b] | Y. Ye 2019 | ||
| 197.6 | R1 = s-Bu R2 = prenyl R3 = CMe2OH |
hirsutusal B[e] | H. hirsutum[a] | −6.9 (0.24, m)[b] | J. Max 2021 | ||
| 197.7 | R1 = Ph R2 = prenyl R3 = OH |
pseudohenone E | C. obdeltifolia, H. pseudohenryi[a] N. Robson | −27 (0.13, m)[b] | F. G. Cruz 2004, X.-W. Yang 2017b | ||
| 197.8 | R1 = Ph R2 = prenyl R3 = i-Pr |
hyphenrone P | H. sampsonii[a] | −83 (0.1, m)[b] | X.-W. Yang 2015 | ||
| 197.9 | R1 = Ph R2 = prenyl R3 = CMe=CH2 |
hypercohone B | H. cohaerens[a] | −37.2 (0.11, m)[b] | X. Liu 2013b | ||
| 197.10 | R1 = Ph R2 = prenyl R3 = CMe2OH |
hyperacmosin G[c] | H. acmosepalum[a] | −8.3 (0.012)[b] | X. Wang 2020a | ||
| 197.11 | R1 = Ph R2 = prenyl R3 = CMe2OH |
sampsonione G[d] (prob. enantiomer) | C. obdeltifolia, H. sampsonii, H. attenuatum, H. wilsonii[a] | +10.0 (0.01)[b] | L.-H. Hu 1999b, F. G. Cruz 2004, D. Li 2015a, Y. Zhang 2020 | ||
| 197.12 | R1 = Ph R2 = geranyl R3 = OH |
hyperattenin H[d] | H. attenuatum[a] Choisy | −12.4 (0.26, m)[b] | D. Li 2015a, X.-W. Yang 2017b | ||
| 197.13 | R1 = Ph R2 = geranyl R3 = OH |
cowabenzophenone B[c] (prob. enantiomer) | G. cowa[a] | +96 (0.048)[b] | T. Sriyatep 2014, X.-W. Yang 2017b | ||
| 197.14 | R1 = Ph R2 = geranyl R3 = i-Pr |
hypersampsone E[c] | H. sampsonii[a] | +39 (0.2)[b] | Y.-L. Lin 2003, H.-B. Zhang 2019 | ||
| 197.15 | R1 = Ph R2 = geranyl R3 = i-Pr |
hyperichoisin B[d] (enantiomer) | H. choisianum[a] | −17.4 (0.285)[b] | H.-B. Zhang 2021 | ||
| 197.16 | R1 = Ph R2 = geranyl R3 = CMe=CH2 |
hypercohone C | H. cohaerens[a] | −38.0 (0.09, m)[b] | X. Liu 2013b | ||
| 197.17 | R1 = Ph R2 = geranyl R3 = CMe=CH2 |
cowabenzophenone A (enantiomer) | G. cowa[a] | +137 (0.02)[b] | T. Sriyatep 2014 | ||
| 197.18 | R1 = Ph R2 = geranyl R3 = CMe2OH |
sampsonione F[c] | H. sampsonii, H. attenuatum, H. wilsonii[a] | +14.5 (1.1)[b] | L.-H. Hu 1999b, D. Li 2015a, H.-B. Zhang 2019, Y. Zhang 2020 | ||
| 197.19 | R1 = Ph R2 = geranyl R3 = CMe2OH |
hyperichoisin C[d] (enantiomer) | H. choisianum[a] | −21.9 (0.31)[b] | H.-B. Zhang 2021 | ||
| 197.20 | R1 = Ph R2 = geranyl R3 = CMe2OOH |
hyperberlone C[c] | H. beanii[a] | −0.34 (2, m)[b] | Y.-W. Li 2022 | ||
| 197.21 | R1 = Ph R2 = neryl R3 = i-Pr |
hookerione J | H. hookerianum[a] | −38.2 (0.12, m)[b] | Y. Ye 2019 | ||
| 197.22 | R1 = Ph R2 = lavandulyl R3 = CMeCH2 |
garciyunnanone M[d][e] | G. yunnan[a] Hu | +4.3 (0.4, m)[b] | M. Nan 2024 | ||
| 197.23 | R1 = Ph R2 = lavandulyl R3 = i-Pr |
iso-hookerione J[d][e] | G. multiflora[a] | −4.70 (0.05, m)[b] | H. Teng 2019 | ||
| 197.24 | R1 = Ph R2 = lavandulyl R3 = CMe2OH |
garciyunnanone P[d][e] | G. yunnan[a] Hu | −3.6 (0.1, m)[b] | M. Nan 2024 | ||
| 197.25 | R1 = Ph R2 = lavandulyl R3 = OH |
garciyunnanone H[d] | G. yunnan[a] Hu | +21.6 (0.1, m)[b] | M. Nan 2024 | ||
|
|||||||
| 198.1 | hypertonii A[c] | H. addingtonii[a] N. Robson | +42.3 (0.1, acn)[b] | Q. Feng 2025 | |||
|
|||||||
| 199.1 | dioxasampsone A[d] | H. sampsonii[a] | +16.8 (0.50)[b] | W.-J. Tian 2014c | |||
|
|||||||
| 200.1 | hyperesternoid R[d] | H. monogynum[a] | −32.7 (0.2, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 201.1 | hyperesternoid S[d] | H. monogynum[a] | −24.8 (0.2, m)[b] | Z. Dong 2026 | |||
|
|||||||
| 202.1 | pseudohenone A | H. pseudohenryi[a] N. Robson | +43 (0.20, m)[b] | X.-W. Yang 2017b | |||
|
|||||||
| 203.1 | cumilcinol B[d] | H. wilsonii[a] | +98.0 (0.1, m)[b] | B. Tao 2024a | |||
|
|||||||
| 204.1 | hypercurpalone A[d] | H. curvisepalum[a] | −17.9 (0.13, m)[b] | Y. Ye 2022 | |||
|
|||||||
| 205.1 | hypseudone A[c] | H. pseudohenryi[a] | +38.2 (0.096, m)[b] | N.-N. Jiang 2025 | |||
|
|||||||
| 206.1 | garsubelone A[d] | G. subelliptica[a] | +103 (0.14, m)[b] | Y.-L. Wang 2019 | |||
|
|||||||
| 207.1 | R1 = i-Pr R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
hyperforatum D | H. perforatum[a] | +4.0 (1.00, m)[b] | X. Wang 2024 | ||
| 207.2 | R1 = n-Pr R2 = CHBuCO2Me R3 = prenyl R4 = prenyl R5 = H |
kielmeyeracin[c][e] | Kielmeyera variabilis | −70 (0.1, m)[b] | A. Coqueiro 2016 | ||
| 207.3 | R1 = i-Bu R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
spiranthenone B | Spiranthera odoratissima | −24 (0.10)[b] | L. C. Albernaz 2012, X.-W. Yang 2018 | ||
| 207.4 | R1 = Ph R2 = H R3 = prenyl R4 = (E)-CH=CHCMe=O R5 = H |
oblongifolin V[c] | G. oblongifolia[a] | +4.3 (0.02, m)[b] | H. Zhang 2016 | ||
| 207.5 | R1 = Ph R2 = H R3 = prenyl R4 = geranyl R5 = H |
oblongifolin L[c] | G. oblongifolia[a] | −15.1 (0.05, m)[b] | H. Zhang 2014a, X.-W. Yang 2018 | ||
| 207.6 | R1 = Ph R2 = H R3 = prenyl R4 = CH2C(=O)C(=CH2)CH2CH2CH=CMe2 R5 = H |
oblongifolin O[c][l][m] | G. oblongifolia[a] | −20.8 (0.05, m)[b] | H. Zhang 2014a | ||
| 207.7 | R1 = Ph R2 = H R3 = prenyl R4 = 6-oxo-ω-isogeranyl[h] R5 = H |
oblongifolin N[c][l][m] | G. oblongifolia[a] | −17.5 (0.04, m)[b] | H. Zhang 2014a | ||
| 207.8 | R1 = Ph R2 = H R3 = prenyl R4 = (S)-6-hydroxy-ω-isogeranyl[h] R5 = H |
oblongifolin Q[c][l][m] | G. oblongifolia[a] | −222.2 (0.03, m)[b] | H. Zhang 2014a | ||
| 207.9 | R1 = Ph R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
hyperascyrin L[d] | H. ascyron[a] | −58.5 (0.1, m)[b] | B. Zhen 2019 | ||
| 207.10 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
clusianone[c] | C. congestiflora, C. spiritu-sanctensis, C. torresii, H. hypericoides[a] | +58.3 (0.7)[b]; OMe: +61 (1.4)[b] | C. M. A. de Oliveira 1996, A. L. Piccinelli 2005, V. Rodeschini 2007, M. R. Garnsey 2010, F. Horeischi 2015 | ||
| 207.11 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone I, a.k.a. 13-deoxyguttiferone J[i] (one of two by the first name) | G. cambogia, G. virgata[a] | −14.3 (5.6, m)[b] | J. Merza 2006, M. Masullo 2008 | ||
| 207.12 | R1 = Ph R2 = prenyl R3 = lavandulyl R4 = prenyl R5 = H |
spiritone[e] | C. spiritu-sanctensis[a] | NR | A. L. M. Porto 2000 | ||
| 207.13 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
18-hydroxyclusianone | H. hypericoides[a] | NR | O. E. Christian 2008 | ||
| 207.14 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone J, a.k.a. garciyunnanin A, and tautomer iso-guttiferone J | G. cambogia, G. gummi-gutta, G. virgata, G. yunnanensis[a] | −34.3 (1.75, m)[b], −3.0 (0.11)[b] | J. Merza 2006, M. Masullo 2008, G. Xu 2008, P. Pandey 2024 | ||
| 207.15 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
ent-guttiferone J[l][m] (prob. enantiomer) | R. edulis[a] | +10.8 (0.01, m)[b] | U. M. Acuña 2010 | ||
| 207.16 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = H |
oblongifolin U[c] | G. oblongifolia[a] | +48.2 (0.08, m)[b] | H. Zhang 2014a | ||
| 207.17 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = prenyl |
garcicowin B | G. cowa[a] | −16.0 (0.21)[b] | G. Xu 2010 | ||
| 207.18 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
aristophenone A, and tautomer aristophenone B[c] | G. xanthochymus[a] | +58 (0.1)[b]; OAc: +53 (0.1)[b], +54 (0.1)[b] | O. Cuesta-Rubio 2001b, S. Baggett 2005 | ||
| 207.19 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone K | G. calcicola, G. cambogia, G. cowa, G. yunnanensis[a] Hu | −2 (0.35)[b] | S. Cao 2007, M. Masullo 2008, G. Xu 2010, D. Zheng 2017 | ||
| 207.20 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = CH2COCMe=CH2 |
garciyunnanin J[c] | G. yunnanensis[a] | +103.1 (0.13, m)[b] | D. Zheng 2021b | ||
| 207.21 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = CH2CHOHCMe=CH2 R5 = prenyl |
schomburgkianone F[d][e] | G. schomburgkiana[a] | −13 (0.4)[b] | D. H. Le 2016 | ||
| 207.22 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = CH2CHOHCMe=CH2 R5 = prenyl |
schomburgkianone G[d][e] (diastereomer) | G. schomburgkiana[a] | +6 (0.3)[b] | D. H. Le 2016 | ||
| 207.23 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl |
garciyunnanol I[d] | G. yunnanensis[a] | −58 (0.36, m)[b] | X.-Y. Hu 2024 | ||
| 207.24 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = CH2CO2H R5 = prenyl |
garciyunnanol H[d] | G. yunnanensis[a] | −12 (0.18, m)[b] | X.-Y. Hu 2024 | ||
| 207.25 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = H |
oblongifolin B | G. cowa, G. oblongifolia, G. yunnanensis[a] Hu | +17.6 (0.21)[b] | W. Hamed 2006, G. Xu 2010, D. Zheng 2017 | ||
| 207.26 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = prenyl |
guttiferone G | G. humilis, G. macrophylla[a] | −25 (0.04)[b], +8.7 (1.5)[b] | R. B. Williams 2003, K. Herath 2005, R. Ciochina 2006 | ||
| 207.27 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = prenyl |
oblongifolin C (prob. enantiomer) | G. cowa, G. oblongifolia, G. yunnanensis[a] Hu | +14.5 (0.21)[b] | W. Hamed 2006, G. Xu 2010, D. Zheng 2017 | ||
| 207.28 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH2CH=CMeCH2CH2CH2CMe2OH R5 = prenyl |
garschomcinol A[d] | G. schomburgkiana[a] | +12.5 (0.20, m)[b] | S. Kaennakam 2022a | ||
| 207.29 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH2CH=CMeCH2CH2CH2CMe2OMe R5 = prenyl |
garschomcinol B[d] | G. schomburgkiana[a] | +13.5 (0.28, m)[b] | S. Kaennakam 2022a | ||
| 207.30 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH2CH=CMeCH2CH2CH2CMe2OEt R5 = prenyl |
garschomcinol C[d] | G. schomburgkiana[a] | +14.7 (0.34, m)[b] | S. Kaennakam 2022a | ||
| 207.31 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (R)-6-hydroxy-ω-isogeranyl[h] R5 = prenyl |
schomburgkianone A[d] | G. schomburgkiana[a] | +15 (0.7)[b] | D. H. Le 2016 | ||
| 207.32 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (S)-6-hydroxy-ω-isogeranyl[h] R5 = prenyl |
schomburgkianone B[d] | G. schomburgkiana[a] | +40 (1.0)[b] | D. H. Le 2016 | ||
| 207.33 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E,E)-CH2CH=CMeCH2CH=CHCMe2OH R5 = prenyl |
schomburgkianone C[d] | G. schomburgkiana[a] | +25 (0.8)[b] | D. H. Le 2016 | ||
| 207.34 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E,E)-CH2CH=CMeCH2CH=CHCMe2OMe R5 = prenyl |
garciyunnanol E[d] | G. yunnanensis[a] | +5 (0.36, m)[b] | X.-Y. Hu 2024 | ||
| 207.35 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = geranyl R4 = prenyl R5 = H |
guttiferone M[c] | G. cambogia[a] | −29.8 (0.15, m)[b] | M. Masullo 2008, M. Masullo 2010 | ||
| 207.36 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = geranyl R4 = prenyl R5 = prenyl |
guttiferone P | G. solomonensis[a] | +18.2 (0.33)[b] | A. R. Carroll 2009 | ||
| 207.37 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = geranyl R4 = geranyl R5 = H |
guttiferone B | G. cowa, S. globulifera[a] | −44 (0.5)[b] | K. R. Gustafson 1992, G. Xu 2010 | ||
| 207.38 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = lavandulyl R4 = prenyl R5 = H |
7-epi-garcinol[e] | M. coccinea[a] | −86 (0.8)[b] | G. Marti 2009 | ||
| 207.39 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-isolavandulyl[g] R4 = prenyl R5 = H |
xanthochymusone B[d] | G. xanthochymus[a] | +137 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 207.40 | R1 = 3,4-dihydroxyphenyl R2 = (E)-CH2CH=CMeCH2OH R3 = prenyl R4 = prenyl R5 = prenyl |
garciyunnanol F[d] | G. yunnanensis[a] | +7 (0.17, m)[b] | X.-Y. Hu 2024 | ||
| 207.41 | R1 = 3,4-dihydroxyphenyl R2 = (Z)-CH2CH=CMeCH2OH R3 = prenyl R4 = geranyl R5 = prenyl |
garciyunnanol G[d] | G. yunnanensis[a] | +11 (0.18, m)[b] | X.-Y. Hu 2024 | ||
| 207.42 | R1 = 3,4-dihydroxyphenyl R2 = geranyl R3 = geranyl R4 = prenyl R5 = H |
guttiferone O (one of two by that name) | G. solomonensis[a] | +30.7 (0.66)[b] | A. R. Carroll 2009 | ||
| 207.43 | R1 = 3,4-dihydroxyphenyl R2 = ω-isogeranyl[h] R3 = prenyl R4 = geranyl R5 = H |
semsinone A[n] | G. semseii[a] | +52 (0.1)[b] | J. J. Magadula 2008 | ||
| 207.44 | R1 = 2,4,5-trihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone L | G. calcicola[a] | −8 (0.06)[b] | S. Cao 2007 | ||
|
|||||||
| 208.1 | R1 = i-Pr R2 = Me R3 = prenyl R4 = prenyl R5 = H |
hyperpapuanone | H. papuanum[a] | +15 (0.1, m)[b] | K. Winkelmann 2001a | ||
| 208.2 | R1 = i-Bu R2 = CHPhCH2CO2H R3 = prenyl R4 = prenyl R5 = H |
laxifloranone[e] | Marila laxiflora | +23.6 (0.8, m)[b] | H. R. Bokesch 1999 | ||
| 208.3 | R1 = i-Bu R2 = CHPhCH2CO2Me R3 = prenyl R4 = prenyl R5 = H |
mesuaferroic acid H[e] | Mesua ferrea | +15.9 (0.2, m)[b] | X.-C. Zhang, 2020 | ||
| 208.4 | R1 = i-Bu R2 = CHPhCH2CO2H R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = H |
mesuaferroic acid I[e] | Mesua ferrea | +2.15 (0.2, m)[b] | X.-C. Zhang, 2020 | ||
| 208.5 | R1 = i-Bu R2 = CHPhCH2CO2H R3 = prenyl R4 = CH2CH(OH)CMe=CH2 R5 = H |
mesuaferroic acid L[e] | Mesua ferrea | +8.5 (0.2, m)[b] | X.-C. Zhang, 2020 | ||
| 208.6 | R1 = CH(OH)CMe2OH R2 = CHPhCH2CO2H R3 = prenyl R4 = prenyl R5 = H |
mesuaferroic acid K[e] | Mesua ferrea | +3.25 (0.2, m)[b] | X.-C. Zhang, 2020 | ||
| 208.7 | R1 = Ph R2 = H R3 = prenyl R4 = Me R5 = H |
oblongifolin P[c] | G. oblongifolia[a] | −56.3 (0.05, m)[b] | H. Zhang 2014a | ||
| 208.8 | R1 = Ph R2 = H R3 = prenyl R4 = prenyl R5 = H |
garciniaphenone[m] | G. brasiliensis[a] | −52.8 (0.1)[b] | P. B. M. C. Derogis 2008 | ||
| 208.9 | R1 = Ph R2 = H R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone Q | G. cochinchinensis[a] | −50 (0.21)[b] | H. D. Nguyen 2011 | ||
| 208.10 | R1 = Ph R2 = H R3 = prenyl R4 = prenyl R5 = prenyl |
cowanone, a.k.a. chamuangone (prob. enantiomer) | G. cowa[a] | +5 (1.0)[b] | K. Trisuwan 2012, A. Sakunpak 2012 | ||
| 208.11 | R1 = Ph R2 = H R3 = prenyl R4 = (E)-CH=CHCMe2OH R5 = prenyl |
garcowacinol A[d] | G. cowa[a] | −35.0 (0.50, m)[b] | S. Kaennakam 2022b | ||
| 208.12 | R1 = Ph R2 = H R3 = prenyl R4 = (E)-CH=CHCMe2OMe R5 = prenyl |
garcowacinol B[d] | G. cowa[a] | −46.5 (0.50, m)[b] | S. Kaennakam 2022b | ||
| 208.13 | R1 = Ph R2 = H R3 = prenyl R4 = geranyl R5 = H |
oblongifolin AA[c] | G. oblongifolia[a] | −36.2 (0.05, m)[b] | H. Zhang 2016, X.-W. Yang 2018 | ||
| 208.14 | R1 = Ph R2 = H R3 = prenyl R4 = (E)-CH2CH=CMeCH2CH2CH2CMe2OH R5 = H |
oblongifolin Z[c][m] | G. oblongifolia[a] | −23.5 (0.03, m)[b] | H. Zhang 2016 | ||
| 208.15 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl R5 = H |
hyperibone L | H. scabrum[a] | +69.5 (0.2)[b] | N. Tanaka 2004 | ||
| 208.16 | R1 = Ph R2 = prenyl R3 = Me R4 = prenyl R5 = prenyl |
hyperelatone A[d] | H. elatoides[a] | +189.3 (0.1)[b] | X.-T. Yan 2019 | ||
| 208.17 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
7-epi-clusianone[d] | C. sandinensis, C. torresii, H. elegans, H. hypericoides[a] | +62.3 (1.1)[b] | F. delle Monache 1991, M. H. Santos 1998, T. M. de Almeida Alves 1999, K. Winkelmann 2001a, A. L. Piccinelli 2005, P. T. Nedialkov 2016, L. Wang 2021 | ||
| 208.18 | R1 = Ph R2 = prenyl R3 = (S)-lavandulyl[f] R4 = prenyl R5 = H |
garcimultiflorone K[c] (one of two by that name) | G. multiflora[a] | −92.4 (0.41, m)[b] | L.-Y. Cheng 2018 | ||
| 208.19 | R1 = Ph R2 = prenyl R3 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone C[d] | G. picrorhiza[a] | +15 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 208.20 | R1 = Ph R2 = geranyl R3 = prenyl R4 = prenyl R5 = H |
hyperbeone A[c] | H. beanii[a] | −4.7 (0.08, m)[b] | W.-X. Li 2021 | ||
| 208.21 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
18-hydroxy-7-epi-clusianone | H. hypericoides[a] | +64 (0.29)[b] | O. E. Christian 2008 | ||
| 208.22 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = H |
oblongifolin E | G. oblongifolia[a] | +65.1 (0.40)[b] | S.-X. Huang 2009 | ||
| 208.23 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = geranyl R4 = prenyl R5 = H |
guttiferone N | G. cambogia[a] | −34.5 (0.07, m)[b] | M. Masullo 2008 | ||
| 208.24 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = lavandulyl R4 = prenyl R5 = H |
14-deoxygarcinol[e] | M. coccinea[a] | −42 (0.3)[b] | G. Marti 2009 | ||
| 208.25 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = (S)-isolavandulyl[g] R4 = prenyl R5 = H |
xanthochymusone A[d] | G. xanthochymus[a] | +137 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 208.26 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone B[d] | G. picrorhiza[a] | +12 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 208.27 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
garcimultiflorone H[d] | G. multiflora[a] | +29.8 (0.62, m)[b] | W. Fu 2015 | ||
| 208.28 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = prenyl |
guttiferone A | S. globulifera, G. livingstonei, G. humilis[a] | +34 (1.7)[b] | K. R. Gustafson 1992, R. B. Williams 2003 | ||
| 208.29 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl R5 = H |
oblongifolin A | G. cowa, G. oblongifolia, G. yunnanesis[a] Hu | +23 (0.35)[b] | W. Hamed 2006, G. Xu 2010, D. Zheng 2017 | ||
| 208.30 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (R)-6-hydroxy-ω-isogeranyl[h] R5 = H |
oblongifolin T[c] | G. oblongifolia[a] | +10.8 (0.05, m)[b] | H. Zhang 2014a, X.-W. Yang 2018 | ||
| 208.31 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = (1R,3S)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
garcinopicrobenzophenone, a.k.a. eugeniaphenone[d] | G. eugeniaefolia, G. picrorhiza[a] | −271.4 (0.17, m)[b], +28 (0.10, m)[b] | A. Soemiati 2006, S. Hartati 2008, E. R. Sukandar 2020 | ||
| 208.32 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = geranyl R4 = prenyl R5 = H |
guttiferone I[i] (one of two by that name) | G. griffithii[a] | −68 (1.2)[b] | R. W. Fuller 1999 | ||
| 208.33 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (E)-CH2CH(CMe=CH2)CH=CHCMe2OOH R4 = prenyl R5 = H |
nujiangefolin E[d][e] | G. nujiangensis[a] | −22.48 (0.11, m)[b] | X.-J. Liu 2023 | ||
| 208.34 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = 2,2-dimethyl-5-isopropenyl-3-tetrahydrofurylmethyl R4 = prenyl R5 = H |
paucinochymol A[d][e] | G. paucinervis[a] | −38.8 (0.01, m)[b] | X. Tan 2020 | ||
| 208.35 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = geranyl R4 = geranyl R5 = H |
oblongifolin D | G. cowa, G. oblongifolia[a] | +44.6 (0.21)[b] | W. Hamed 2006, G. Xu 2010 | ||
| 208.36 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-lavandulyl[f] R4 = prenyl R5 = H |
garcinol, a.k.a. (−)-camboginol, a.k.a. guttiferone F[c] | G. cambogia, G. cowa, G. indica, G. pedunculata, G. yunnanensis [a] Hu, M. coccinea, Allanblackia stuhlmannii[a] | −138 (0.1)[b], −293 (0.4)[b] | A. V. Rama Rao 1980, N. Krishnamurthy 1981, A. Sahu 1989, R. W. Fuller 1999, G. Marti 2009, G. Xu 2010, C. Socolsky 2015, D. Zheng 2017, D. Zheng 2021a, X. Wang 2021a | ||
| 208.37 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-lavandulyl[f] R4 = prenyl R5 = H |
guttiferone E, a.k.a. (+)-camboginol[d] (enantiomer) | Cuban propolis, C. rosea, G. ovafolia, G. virgata, G. yunnanensis[a] Hu | +101 (0.5)[b] | K. R. Gustafson 1992, R. W. Fuller 1999, O. Cuesta Rubio 1999, O. Cuesta-Rubio 2002, J. Merza 2006, C. Socolsky 2015, D. Zheng 2021a | ||
| 208.38 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = lavandulyl R4 = prenyl R5 = prenyl |
guttiferone D[e] | S. globulifera[a] | +92 (0.9)[b] as mix with guttiferone C | K. R. Gustafson 1992 | ||
| 208.39 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-lavandulyl[f] R4 = CH2CHOHCMe2OH R5 = H |
garcimultiflorone F[e] | G. multiflora[a] | −68.7 (0.49, m)[b] | X. Liu 2010, X. Wang 2021a | ||
| 208.40 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-lavandulyl[f] R4 = CH2CHOHCMe2OH R5 = H |
isogarcimultiflorone F[e] (diastereomer) | G. multiflora[a] | −46.0 (0.50, m)[b] | X. Liu 2010, X. Wang 2021a | ||
| 208.41 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = lavandulyl R4 = (S)-CH2CHOHCMe2OMe R5 = H |
garciesculentone C[e] | G. esculenta[a] | −24.9 (0.08, m)[b] | H. Zhang 2014b | ||
| 208.42 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-isolavandulyl[g] R4 = prenyl R5 = H |
xanthochymol, a.k.a. garcinielliptone FC[d] | Cuban propolis, G. mannii, G. staudtii, G. subelliptica, G. virgata, G. xanthochymus, G. madrunno, Platonia insignis[a] | +138 (0.1)[b], +12.6 (1.0)[b] | C. G. Karanjgoakar 1973, D. L. Dreyer 1974, G. Venkatswamy 1975, J. F. Blount 1976, O. Cuesta Rubio 1999, D. Roux 2000, O. Cuesta-Rubio 2002, S. Baggett 2005, J. Merza 2006, C.-C. Wu 2008a, J. S. Costa 2013, Y. Luo 2023 | ||
| 208.43 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = isolavandulyl[g] R4 = prenyl R5 = prenyl |
guttiferone C[e] | S. globulifera[a] | +92 (0.9)[b] as mix with guttiferone D | K. R. Gustafson 1992 | ||
| 208.44 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (4R)-4-hydroxygeranyl R4 = prenyl R5 = H |
32-hydroxy-7-epi-guttiferone M[d][l][m] | R. edulis[a] | +10 (0.1, m)[b] | U. M. Acuña 2010 | ||
| 208.45 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (2R)-4-hydroxyisolavandulyl[g] R4 = prenyl R5 = H |
garcimultiflorone E[e] | G. multiflora[a] | −43.6 (0.41, m)[b] | X. Liu 2010, X. Wang 2021a | ||
| 208.46 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (4R)-4-hydroxyisolavandulyl[g] R4 = prenyl R5 = H |
garciesculentone E[e] | G. esculenta[a] | −14.3 (0.03, m)[b] | H. Zhang 2014b | ||
| 208.47 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (4S)-4-hydroxyisolavandulyl[g] R4 = prenyl R5 = H |
garciesculentone D[e] | G. esculenta[a] | −15.9 (0.05, m)[b] | H. Zhang 2014b | ||
| 208.48 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = (1S)-2-methylene-4,4-dimethylcyclohexylmethyl R4 = prenyl R5 = H |
acuminophenone A | R. acuminata[a] | +208 (0.01)[b] | G. R. Almanza 2011 | ||
| 208.49 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = 3-isopropenyl-2,2-dimethylcyclopentyl R4 = prenyl R5 = H |
thorelione A[e] | Calophyllum thorelii | +91.9 (1.0, m)[b] | L.-T. T. Nguyen 2012 | ||
| 208.50 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (2,4,4-trimethyl-2-cyclohexenyl)methyl R4 = prenyl R5 = H |
coccinone F | M. coccinea[a] | −32 (0.7)[b] | G. Marti 2009 | ||
| 208.51 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = (1S,3R)-3-(2-hydroxyisopropyl)-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone D[d] | G. picrorhiza[a] | +34 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 208.52 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = (1S,3S)-3-acetyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone E[d] | G. picrorhiza[a] | +5 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 208.53 | R1 = 3,4-dihydroxyphenyl R2 = (E)-CH=CHCMe2OH R3 = (E)-CH2CH(CMe=CH2)CH(OH)CH=CMe2 R4 = prenyl R5 = H |
garciyunnanensisin C[c][e] | G. yunnanensis[a] | +170.0 (0.1, m)[b] | P.-X. Ji 2025 | ||
| 208.54 | R1 = 3,4-hydroxyphenyl R2 = (E)-CH2CH=C(Me)CH2OH R3 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone A[d] | G. picrorhiza[a] | +27 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 208.55 | R1 = 3,4-dihydroxyphenyl R2 = CH2CH2CMe2OH R3 = (S)-lavandulyl[f] R4 = prenyl R5 = H |
garcimultiflorone D (one of two by that name) | G. multiflora[a] | −53.6 (0.48, m)[b] | X. Liu 2010, X. Wang 2021a | ||
| 208.56 | R1 = 3,4-dihydroxyphenyl R2 = CH2CHOHCMe2OH R3 = (S)-lavandulyl[f] R4 = prenyl R5 = H |
18-hydroxygarcimultiflorone D[e] | G. multiflora[a] | −33.3 (0.12, m)[b] | X. Liu 2010, X. Wang 2021a | ||
| 208.57 | R1 = 3,4-dihydroxyphenyl R2 = lavandulyl R3 = prenyl R4 = prenyl R5 = H |
coccinone G[e] | M. coccinea[a] | −16 (1.0)[b] | G. Marti 2009 | ||
| 208.58 | R1 = 3,4-dihydroxyphenyl R2 = (2,4,4-trimethyl-1-cyclohexenyl)methyl R3 = prenyl R4 = prenyl R5 = H |
coccinone H | M. coccinea[a] | −16 (1.0)[b] | G. Marti 2009 | ||
|
|||||||
| 209.1 | R = prenyl | garciyunnanimine A[c] | G. yunnanensis[a] Hu | +11.7 (0.03, m)[b] | D. Zheng 2017, J.-Y. Xie 2024 | ||
| 209.2 | R = geranyl | garciyunnanimine C[c] | G. yunnanensis[a] Hu | +11.4 (0.041, m)[b] | D. Zheng 2017, J.-Y. Xie 2024 | ||
|
|||||||
| 210.1 | R1 = Ph R2 = Me R3 = prenyl R4 = H |
hyperelamine A[d] | H. elatoides[a] | +44.3 (0.11, m)[b] | J.-Y. Xie 2024 | ||
| 210.2 | R1 = Ph R2 = Me R3 = prenyl R4 = (R)-CH(CH3)C≡N |
hyperelanitrile C[d] | H. elatoides[a] | +28.3 (0.10, m)[b] | J.-Y. Xie 2024 | ||
| 210.3 | R1 = Ph R2 = Me R3 = prenyl R4 = (S)-CH(CH3)C≡N |
hyperelanitrile A[d] | H. elatoides[a] | +91.1 (0.05, m)[b] | J.-Y. Xie 2024 | ||
| 210.4 | R1 = 3,4-dihydroxyphenyl R2 = (S)-lavandulyl[f] R3 = H R4 = H |
garciyunnanimine B[c] | G. yunnanensis[a] Hu | −69.0 (0.035, m)[b] | D. Zheng 2017, J.-Y. Xie 2024 | ||
|
|||||||
| 211.1 | R = (R)-CH(CH3)C≡N | hyperelanitrile D[d] (inseparable E/Z mixture with hyperelanitrile C at exocyclic double bond) | H. elatoides[a] | N/D | J.-Y. Xie 2024 | ||
| 211.2 | R = (S)-CH(CH3)C≡N | hyperelanitrile B[d] (inseparable E/Z mixture with hyperelanitrile A at exocyclic double bond) | H. elatoides[a] | N/D | J.-Y. Xie 2024 | ||
|
|||||||
| 212.1 | oblongifolin M[c][l][m] | G. oblongifolia[a] | −4.2 (0.05, m)[b] | H. Zhang 2014a | |||
|
|||||||
| 213.1 | enervosanone | Calophyllum enervosum | +10 (0.2000, m)[b] | M. Taher 2005 | |||
|
|||||||
| 214.1 | R1 = prenyl R2 = prenyl R3 = prenyl X1 = OH X2 = OH X3 = H |
oxy-guttiferone K[d] | G. cambogia[a] | +20.9 (0.1)[b] | M. Masullo 2008, M. Masullo 2010 | ||
| 214.2 | R1 = prenyl R2 = geranyl R3 = H X1 = OH X2 = OH X3 = H |
oblongifolin G | G. oblongifolia[a] | +5.9 (0.41)[b] | S.-X. Huang 2009 | ||
| 214.3 | R1 = prenyl R2 = geranyl R3 = H X1 = H X2 = H X3 = OH |
oblongifolin I | G. oblongifolia[a] | NR | Y. Zhou 2010 | ||
| 214.4 | R1 = prenyl R2 = geranyl R3 = prenyl X1 = OH X2 = OH X3 = H |
garciyunnanin B | G. yunnanensis[a] | +18.1 (0.12)[b] | G. Xu 2008 | ||
| 214.5 | R1 = prenyl R2 = geranyl R3 = prenyl X1 = H X2 = OH X3 = OH |
garciyunnanin K[d] | G. yunnanensis[a] | +2.2 (0.10, m)[b] | D. Zheng 2021b | ||
| 214.6 | R1 = geranyl R2 = prenyl R3 = H X1 = OH X2 = OH X3 = H |
oxy-guttiferone M | G. cambogia[a] | −96.2 (0.1, m)[b] | M. Masullo 2010 | ||
| 214.7 | R1 = lavandulyl R2 = prenyl R3 = H X1 = OH X2 = OH X3 = H |
symphonone H[e] | S. globulifera[a] | −37 (0.2)[b] | G. Marti 2010 | ||
|
|||||||
| 215.1 | R1 = prenyl R2 = prenyl R3 = H X1 = OH X2 = H |
garcimultiflorone I[d] | G. multiflora[a] | −42.1 (0.36, m)[b] | W. Fu 2015 | ||
| 215.2 | R1 = prenyl R2 = prenyl R3 = prenyl X1 = OH X2 = H |
2,16-oxyguttiferone A[d] | S. globulifera[a] | +48 (1.0, m)[b] | K. Cottet 2015 | ||
| 215.3 | R1 = prenyl R2 = geranyl R3 = H X1 = OH X2 = H |
oblongifolin F | G. oblongifolia[a] | −85.6 (0.41)[b] | S.-X. Huang 2009 | ||
| 215.4 | R1 = prenyl R2 = geranyl R3 = H X1 = H X2 = OH |
oblongifolin H | G. oblongifolia[a] | NR | Y. Zhou 2010 | ||
| 215.5 | R1 = geranyl R2 = prenyl R3 = H X1 = OH X2 = H |
oxy-guttiferone I | G. cambogia[a] | +23.8 (0.1, m)[b] | M. Masullo 2010 | ||
| 215.6 | R1 = (S)-lavandulyl[f] R2 = prenyl R3 = H X1 = OH X2 = H |
garcimultiflorone J[c] | G. multiflora[a] | +11.11 (0.44, m)[b] | W. Fu 2015, X. Wang 2021a | ||
| 215.7 | R1 = isolavandulyl[g] R2 = prenyl R3 = H X1 = OH X2 = H |
nujiangefolin A[e] | G. nujiangensis[a] | −2 (0.10, m)[b] | Z.-X. Xia 2012 | ||
| 215.8 | R1 = (R)-isolavandulyl[g] R2 = (E)-CH=CHCMe2OH R3 = H X1 = OH X2 = H |
nujiangefolin D[d] | G. nujiangensis[a] | −12 (0.10, m)[b] | Z. Tang 2019 | ||
| 215.9 | R1 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R2 = prenyl R3 = H X1 = OH X2 = H |
picrorhizone H[d] | G. picrorhiza[a] | −7 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 215.10 | R1 = 3-isopropenyl-2,2-dimethylcyclopentyl R2 = prenyl R3 = H X1 = OH X2 = H |
oxy-thorelione A[e] | Calophyllum thorelii | +91.9 (1.0, m)[b] | L.-T. T. Nguyen 2012 | ||
| 215.11 | R1 = (2S)-4-hydroxyisolavandulyl[g] R2 = prenyl R3 = H X1 = OH X2 = H |
garciesculentone B[e] | G. esculenta[a] | +18.4 (0.04, m)[b] | H. Zhang 2014b | ||
|
|||||||
| 216.1 | garcinialone[l][m] | G. multiflora[a] | −2.0 (0.02, m)[b] | S.-C. Chien 2008 | |||
|
|||||||
| 217.1 | xanthochymusone N[d] | G. xanthochymus[a] | −16 (0.1, m)[b] | Y.-G. Fu 2025 | |||
|
|||||||
| 218.1 | no common name | G. indica[a] | +18.9 (0.1, m)[b] | R. Kaur 2012 | |||
|
|||||||
| 219.1 | symphonone I | S. globulifera[a] | −22 (0.4)[b] | G. Marti 2010 | |||
|
|||||||
| 220.1 | R = prenyl | (+)-garciyunnanin L[c] | G. yunnanensis[a] | +28.5 (0.10, m)[b] | D. Zheng 2021b | ||
| 220.2 | R = prenyl | (−)-garciyunnanin L[d] | G. xanthochymus[a] | −21 (0.1, m)[b] | Y.-G. Fu 2025 | ||
| 220.3 | R = CH2CH2CMe=CH2 | xanthochymusone O[d] | G. xanthochymus[a] | −21 (0.1, m)[b] | Y.-G. Fu 2025 | ||
|
|||||||
| 221.1 | R1 = prenyl R2 = prenyl |
oxy-guttiferone K2 | G. cambogia[a] | +12.2 (0.1, m)[b] | M. Masullo 2010 | ||
| 221.2 | R1 = isolavandulyl[g] R2 = H |
garcixanthochymone J[d][e] | G. xanthochymus[a] | +53.2 (0.73, m)[b] | S. Jin 2021 | ||
|
|||||||
| 222.1 | R1 = prenyl R2 = prenyl R3 = prenyl |
4,16-oxyguttiferone A | S. globulifera[a] | +53 (1.0, m)[b] | K. Cottet 2015 | ||
| 222.2 | R1 = prenyl R2 = geranyl R3 = H |
guttiferone O, a.k.a. oxy-oblongifolin A (one of two by that first name) | G. afzelii[a] | +45 (0.2, a)[b] | A. M. Lannang 2010 | ||
| 222.3 | R1 = (S)-lavandulyl[f] R2 = prenyl R3 = H |
garcim-2[c] | G. xanthochymus[a] | N/A | Z. Wu 2022 | ||
| 222.4 | R1 = isolavandulyl[g] R2 = prenyl R3 = H |
nujiangefolin B[e] | G. nujiangensis[a] | +5 (0.10, m)[b] | Z.-X. Xia 2012 | ||
|
|||||||
| 223.1 | garciyunnanensisin E[c][e] | G. yunnanensis[a] | −120.0 (0.1, m)[b] | P.-X. Ji 2025 | |||
|
|||||||
| 224.1 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl |
longistylione B[c] | H. longistylum[a] | +0.8 (0.04, mc)[b] | X. Cao 2017 | ||
| 224.2 | R1 = 3,4-dihydroxyphenyl R2 = lavandulyl R3 = prenyl R4 = H |
symphonone F[e] | S. globulifera[a] | −9 (1.0)[b] | G. Marti 2010 | ||
| 224.3 | R1 = 3,4-dihydroxyphenyl R2 = isolavandulyl[g] R3 = prenyl R4 = H |
garcixanthochymone G[d][e] | G. xanthochymus[a] | +28.5 (0.87, m)[b] | S. Jin 2021 | ||
|
|||||||
| 225.1 | R1 = Ph R2 = Me R3 = prenyl |
longistylione A[c] | H. longistylum[a] | −12.4 (0.4, mc)[b] | X. Cao 2017 | ||
| 225.2 | R1 = Ph R2 = prenyl R3 = H |
hyperscabrone F[c] | H. scabrum[a] | −18 (0.1, m)[b] | W. Gao 2016a | ||
| 225.3 | R1 = Ph R2 = (S)-CH2CHOHCMe2OH R3 = prenyl |
hyperkouytone F[c] | H. kouytchense[a] | −46.5 (0.45, m)[b] | H.-Y. Lou 2024 | ||
| 225.4 | R1 = 3,4-dihydroxyphenyl R2 = lavandulyl R3 = H |
symphonone G[e] | S. globulifera[a] | −4 (0.4)[b] | G. Marti 2010 | ||
|
|||||||
| 226.1 | hyperascyrin N[d] | H. ascyron[a] | +40.0 (0.1, m)[b] | B. Zhen 2019 | |||
|
|||||||
| 227.1 | no common name | H. scabrum[a] | +17.2 (1.0, m)[b] | S. Soroury 2020 | |||
|
|||||||
| 228.1 | R1 = i-Pr R2 = CMe2OH R3 = geranyl R4 = prenyl R5 = H |
hyperbeanin Q[c] | H. beanii[a] | −19.5 (0.4, m)[b] | X.-Y. Suo 2021b | ||
| 228.2 | R1 = Ph R2 = CMe2OH R3 = (2R,3E)-CH2CH(CMe=CH2)CH=CHCMe2OOH R4 = prenyl R5 = H |
garcimultinone K[d] | G. multiflora[a] | −12.00 (0.05, m)[b] | H. Teng 2021 | ||
| 228.3 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = geranyl R4 = prenyl R5 = H |
paucinochymol C[d] | G. paucinervis[a] | +17.2 (0.02, m)[b] | X. Tan 2020 | ||
| 228.4 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = lavandulyl R4 = prenyl R5 = H |
paucinochymol B[d][e] | G. paucinervis[a] | −46.6 (0.02, m)[b] | X. Tan 2020 | ||
| 228.5 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = isolavandulyl[g] R4 = prenyl R5 = H |
nujiangefolin C[e] | G. nujiangensis[a] | +20 (0.05, m)[b] | Z.-X. Xia 2012 | ||
| 228.6 | R1 = 3,4-dihydroxyphenyl R2 = CMe2OH R3 = (E)-CH2CH(CMe=CH2)CH=CHCMe2OH R4 = prenyl R5 = H |
garciyunnanensisin D[d][e] | G. yunnanensis[a] | +112.0 (0.1, m)[b] | P.-X. Ji 2025 | ||
| 228.7 | R1 = 3,4-hydroxyphenyl R2 = CMe2OH R3 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone F[d] | G. picrorhiza[a] | +11 (0.10, m)[b] | E. R. Sukandar 2020 | ||
| 228.8 | R1 = 3,4-hydroxyphenyl R2 = CH(Me)CO2H R3 = (1S,3R)-3-isopropenyl-2,2-dimethylcyclobutylmethyl R4 = prenyl R5 = H |
picrorhizone G[d][e] | G. picrorhiza[a] | +11 (0.10, m)[b] | E. R. Sukandar 2020 | ||
|
|||||||
| 229.1 | R1 = Ph R2 = prenyl R3 = prenyl R4 = H |
hyperibone I | H. scabrum[a] | +13.3 (0.3)[b] | M. Matsuhisa 2002, R. Ciochina 2006, K. Lindermayr 2013 | ||
| 229.2 | R1 = Ph R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = H |
hyperibone H | H. scabrum[a] | +12.4 (0.4)[b] | M. Matsuhisa 2002, R. Ciochina 2006 | ||
| 229.3 | R1 = Ph R2 = (S)-lavandulyl[f] R3 = prenyl R4 = H |
garcimultinone L[d] | G. multiflora[a] | +110.00 (0.04, m)[b] | H. Teng 2021 | ||
| 229.4 | R1 = 3,4-dihydroxyphenyl R2 = (S)-lavandulyl R3 = prenyl R4 = H |
garynthone D | G. yunnanensis[a] | racemic; +21.52 (0.1, m)[b] and −18.83 (0.1, m)[b] | Z. Guo 2025a | ||
| 229.5 | R1 = 3,4-dihydroxyphenyl R2 = (S)-isolavandulyl[g] R3 = prenyl R4 = H |
garynthone E[d] | G. yunnanensis[a] | −31.07 (0.1, m)[b] | Z. Guo 2025a | ||
|
|||||||
| 230.1 | thorelione B[e] | Calophyllum thorelii | +412.0 (0.14, e)[b] | L.-T. T. Nguyen 2012 | |||
|
|||||||
| 231.1 | R1 = CMe=CH2 R2 = H |
oblongifolin X[d] | G. oblongifolia[a] | −11.8 (0.03, m)[b] | H. Zhang 2016 | ||
| 231.2 | R1 = CMe=CH2 R2 = prenyl |
garcowacinol E[d] | G. cowa[a] | −36.0 (0.50, m)[b] | S. Kaennakam 2022b | ||
| 231.3 | R1 = CMe2OH R2 = prenyl |
garcowacinol G[d] | G. cowa[a] | −28.1 (0.30, m)[b] | S. Kaennakam 2022b | ||
|
|||||||
| 232.1 | garcowacinol H[d] | G. cowa[a] | −21.2 (0.50, m)[b] | S. Kaennakam 2022b | |||
|
|||||||
| 233.1 | R1 = H R2 = CMe=CH2 R3 = prenyl R4 = prenyl |
garcowacinol F[d] | G. cowa[a] | −25.0 (0.50, m)[b] | S. Kaennakam 2022b | ||
| 233.2 | R1 = H R2 = CMe2OH R3 = prenyl R4 = prenyl |
guttiferone R[d] | G. cochinchinensis[a] | −57.5 (0.33, m)[b] | H. D. Nguyen 2011, S. Kaennakam 2022b | ||
| 233.3 | R1 = H R2 = CMe2OH R3 = geranyl R4 = H |
oblongifolin R[d][l][m] | G. oblongifolia[a] | −54.5 (0.03, m)[b] | H. Zhang 2014a | ||
| 233.4 | R1 = prenyl R2 = CMe=CH2 R3 = prenyl R4 = H |
hyperscabrone E[d] | H. scabrum[a] | −10 (0.1, m)[b] | W. Gao 2016a | ||
|
|||||||
| 234.1 | R1 = s-Bu R2 = CHPhCH2CO2H R3 = prenyl |
mesuaferroic acid A[e][m] | Mesua ferrea | NR | N. E. Rasol 2017 | ||
| 234.2 | R1 = s-Bu R2 = CHPhCH2CO2H R3 = CH2CHOHCMe2OH |
mesuaferroic acid E[e][m] | Mesua ferrea | NR | N. E. Rasol 2017 | ||
| 234.3 | R1 = i-Bu R2 = CHPhCH2CO2H R3 = prenyl |
mesuaferroic acid C[e][m] | Mesua ferrea | NR | N. E. Rasol 2017 | ||
| 234.4 | R1 = i-Bu R2 = CHPhCH2CO2H R3 = CH2CHOHCMe2OH |
mesuaferroic acid F[e][m] | Mesua ferrea | NR | N. E. Rasol 2017 | ||
| 234.5 | R1 = Ph R2 = prenyl R3 = prenyl |
sampsonione P, a.k.a. hyperscabrone L | H. sampsonii, H. scabrum[a] | +18.6 (0.022)[b], +40.0 (0.1, m)[b] | W. Gao 2016b, Z. Y. Xiao 2007 | ||
| 234.6 | R1 = Ph R2 = prenyl R3 = (R)-CH2CHOHCMe2OH |
hypersampsone V[k] | H. sampsonii[a] | +13.0 (0.50)[b] | W.-J. Tian 2016 | ||
| 234.7 | R1 = Ph R2 = prenyl R3 = (S)-CH2CHOHCMe2OH |
hypersampsone W[k] | H. sampsonii[a] | +0.60 (0.50)[b] | W.-J. Tian 2016 | ||
|
|||||||
| 235.1 | R1 = s-Bu R2 = CHPhCH2CO2H R3 = prenyl |
mesuaferroic acid B[e][m] | Mesua ferrea | NR | N. E. Rasol 2017 | ||
| 235.2 | R1 = CH2CMe2OH R2 = CHPhCH2CO2H R3 = prenyl |
mesuaferroic acid J[e] | Mesua ferrea | +4.25 (0.2, m)[b] | X.-C. Zhang, 2020 | ||
| 235.3 | R1 = Ph R2 = prenyl R3 = prenyl |
hyperattenin E, a.k.a. hyperibrin D[d] | H. scabrum[a] | −13.0 (0.19, m)[b] | D. Li 2015a, W. Gao 2016c, X.-W. Yang 2018 | ||
| 235.4 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (S)-6,6-dimethyl-2-methylenecyclohexylmethyl |
paucinone D | G. paucinervis[a] | +41.6 (0.11, m)[b] | X.-M. Gao 2010 | ||
|
|||||||
| 236.1 | paucinone A | G. paucinervis[a] | −6.2 (0.05, m)[b] | X.-M. Gao 2010 | |||
|
|||||||
| 237.1 | paucinone B | G. paucinervis[a] | +58.7 (0.10, m)[b] | X.-M. Gao 2010 | |||
|
|||||||
| 238.1 | paucinone C | G. paucinervis[a] | +19.2 (0.17, m)[b] | X.-M. Gao 2010 | |||
|
|||||||
| 239.1 | garcicowin A | G. cowa[a] | −219.0 (0.09)[b] | G. Xu 2010 | |||
|
|||||||
| 240.1 | garcowacinol D[d] | G. cowa[a] | +37.0 (0.50, m)[b] | S. Kaennakam 2022b | |||
|
|||||||
| 241.1 | R1 = Ph R2 = H R3 = H R4 = prenyl R5 = prenyl |
garcowacinol C[d] | G. cowa[a] | +28.5 (0.50, m)[b] | S. Kaennakam 2022b | ||
| 241.2 | R1 = Ph R2 = H R3 = OH R4 = geranyl R5 = H |
oblongifolin S[d][l][m] | G. oblongifolia[a] | −37.8 (0.04, m)[b] | H. Zhang 2014a | ||
| 241.3 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl R5 = H |
xanthochymusone G[d] | G. xanthochymus[a] | −141 (0.1, m)[b] | Z.-H. Xu 2022 | ||
|
|||||||
| 242.1 | R1 = Ph R2 = H R3 = H R4 = (E)-CH=CHCMe=O |
oblongifolin W[d] | G. oblongifolia[a] | +20.0 (0.03, m)[b] | H. Zhang 2016 | ||
| 242.2 | R1 = Ph R2 = prenyl R3 = prenyl R4 = prenyl |
13,14-didehydroxy-7-epi-isogarcinol | G. multiflora[a] | −185 (0.13)[b] | J.-J. Chen 2009, X. Wang 2021a | ||
| 242.3 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl |
14-deoxy-7-epi-isogarcinol | S. globulifera[a] | −77 (0.9)[b] | G. Marti 2010 | ||
| 242.4 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = prenyl |
7-epi-isogarcinol | M. coccinea, S. globulifera[a] | −158 (1.0)[b] | G. Marti 2009, G. Marti 2010 | ||
| 242.5 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = 3-methylbutyl |
epunctanone | G. epunctata[a] Stapf | +24.9 (0.00985, a)[b] | G. Y. T. Fotso 2014 | ||
| 242.6 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe=CH2 |
symphonone A | S. globulifera[a] | −37 (0.7)[b] | G. Marti 2010 | ||
| 242.7 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = (E)-CH=CHCMe2OH |
symphonone C | S. globulifera[a] | −67 (1.0)[b] | G. Marti 2010 | ||
| 242.8 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = prenyl R4 = geranyl |
symphonone B | S. globulifera[a] | −81 (1.0)[b] | G. Marti 2010 | ||
| 242.9 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = (E)-CH=CHCMe2OH R4 = prenyl |
7-epi-coccinone B | S. globulifera[a] | −50 (0.9)[b] | G. Marti 2010 | ||
| 242.10 | R1 = 3,4-hydroxyphenyl R2 = prenyl R3 = CH2CH2CMe=CH2 R4 = prenyl |
xanthochymusone F[d] | G. xanthochymus[a] | +141 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 242.11 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = CH2CHOHCMe2OH R4 = prenyl |
symphonone D[e] | S. globulifera[a] | −41 (0.4)[b] | G. Marti 2010 | ||
| 242.12 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = CH2CHOHCMe2OH R4 = prenyl |
symphonone E[e] (diastereomer) | S. globulifera[a] | −50 (0.4)[b] | G. Marti 2010 | ||
|
|||||||
| 243.1 | R1 = Ph R2 = H R3 = H R4 = CH2CO2H |
oblongifolin Y[d] | G. oblongifolia[a] | +24.1 (0.06, m)[b] | H. Zhang 2016 | ||
| 243.2 | R1 = Ph R2 = prenyl R3 = OH R4 = prenyl |
hypersampsonone J[d] | H. sampsonii[a] | +17.5 (1.0, m)[b] | Y. Li 2023 | ||
| 243.3 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = CH2CH2CMe=CH2 R4 = CH2CHOHCMe=CH2 |
guttiferone T[e] | G. cochinchinensis[a] | −14 (0.3)[b] | B. T. D. Trinh 2013 | ||
|
|||||||
| 244.1 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl R5 = prenyl |
13,14-didehydroxyisoxanthochymol[d] | G. multiflora[a] | +205.7 (0.15)[b] | G. Xu 2010 | ||
| 244.2 | R1 = Ph R2 = Me R3 = prenyl R4 = prenyl R5 = prenyl |
garcimultinone M[c] (enantiomer) | G. multiflora[a] | −114.44 (0.02, m)[b] | H. Teng 2021 | ||
| 244.3 | R1 = 3-hydroxyphenyl R2 = Me R3 = prenyl R4 = prenyl R5 = prenyl |
14-deoxyisogarcinol | G. indica[a] | −178.0 (0.1, m)[b] | R. Kaur 2012 | ||
| 244.4 | R1 = 3-hydroxyphenyl R2 = Me R3 = CH2CH2CMe=CH2 R4 = prenyl R5 = prenyl |
xanthochymusone C[d] | G. xanthochymus[a] | +132 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 244.5 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = prenyl R4 = prenyl R5 = prenyl |
isoxanthochymol[d] | G. pyrifera, G. subelliptica, G. xanthochymus, G. ovafolia[a] | +181 (0.6, e)[b] | C. G. Karanjgoakar 1973, K. R. Gustafson 1992, M. Iinuma 1996, D. Roux 2000, S. Baggett 2005, C. Socolsky 2015 | ||
| 244.6 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = prenyl R4 = prenyl R5 = prenyl |
isogarcinol, a.k.a. cambogin, a.k.a. 30-epi-cambogin[c] (enantiomer) | G. indica, G. cambogia, G. cochinchinensis, G. cowa, G. pedunculata[a] | −224 (0.1, m)[b] | A. V. Rama Rao 1980, N. Krishnamurthy 1981, N. Krishnamurthy 1982, A. Sahu 1989, R. W. Fuller 1999, G. Xu 2010, B. T. D. Trinh 2013, C. Socolsky 2015, D. Zheng 2021a, X. Wang 2021a | ||
| 244.7 | R1 = 3,4-hydroxyphenyl R2 = Me R3 = prenyl R4 = CH2CH2CMe2OH R5 = prenyl |
xanthochymusone D[d] | G. xanthochymus[a] | +186 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 244.8 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2CH2CMe=CH2 R4 = prenyl R5 = prenyl |
(+)-cycloxanthochymol | G. pyrifera, G. subelliptica, M. coccinea[a] | +112 (1)[b] | M. Iinuma 1996, D. Roux 2000, G. Marti 2009 | ||
| 244.9 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2CH2CMe=CH2 R4 = prenyl R5 = prenyl |
(−)-cycloxanthochymol[j] (enantiomer) | G. subelliptica[a] | −80.9 (2.20, m)[b] | L.-J. Zhang 2010 | ||
| 244.10 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = prenyl R4 = CH2CHOHCMe2OH R5 = prenyl |
coccinone D[e] | M. coccinea[a] | −76 (0.4)[b] | G. Marti 2009 | ||
| 244.11 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = prenyl R4 = CH2CHOHCMe2OH R5 = prenyl |
coccinone E[e] (diastereomer) | M. coccinea[a] | −70 (0.3)[b] | G. Marti 2009 | ||
| 244.12 | R1 = 3,4-hydroxyphenyl R2 = Me R3 = CH2CH2CMe=CH2 R4 = CH2CH2CMe2OH R5 = prenyl |
xanthochymusone E[d] | G. xanthochymus[a] | +117 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 244.13 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2CH2CMe2OH R4 = prenyl R5 = prenyl |
coccinone C | M. coccinea[a] | −60 (0.2)[b] | G. Marti 2009 | ||
| 244.14 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = (S)-CH2CH(OH)CMe=CH2 R4 = prenyl R5 = prenyl |
garpedvinin F[c] | G. pedunculata[a] Roxb. | −118.3 (0.1, m)[b] | D.-L. Zou 2025 | ||
| 244.15 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2CH2CMe2OH R4 = (S)-CH2CHOHCMe2OH R5 = CH2CH2CMe2OH |
garcixanthochymone H[d] | G. xanthochymus[a] | +31.6 (0.25, m)[b] | S. Jin 2021 | ||
| 244.16 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2CH2CMe2OH R4 = (R)-CH2CHOHCMe2OH R5 = CH2CH2CMe2OH |
garcixanthochymone I[d] | G. xanthochymus[a] | +17.8 (0.33, m)[b] | S. Jin 2021 | ||
| 244.17 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = CH2COCMe=CH2 R4 = prenyl R5 = prenyl |
garcixanthochymone F[d] | G. xanthochymus[a] | +55.3 (0.21, m)[b] | S. Jin 2021 | ||
| 244.18 | R1 = 3,4-dihydroxyphenyl R2 = Me R3 = (E)-CH=CHCMe2OH R4 = prenyl R5 = prenyl |
coccinone B | M. coccinea[a] | −55 (0.3)[b] | G. Marti 2009 | ||
| 244.19 | R1 = 3,4-dihydroxyphenyl R2 = CH2OH R3 = prenyl R4 = prenyl R5 = prenyl |
garynthone H | G. yunnanensis[a] | racemic; +160.00 (0.1, m)[b] and −182.25 (0.1, m)[b] | Z. Guo 2025a | ||
| 244.20 | R1 = 3,4-dihydroxyphenyl R2 = CH2OH R3 = CH2CH2CMe=CH2 R4 = prenyl R5 = prenyl |
garynthone I[d] | G. yunnanensis[a] | +96.5 (0.1, m)[b] | Z. Guo 2025a | ||
|
|||||||
| 245.1 | garpedvinin E[c] | G. pedunculata[a] Roxb. | −86.6 (0.30, m)[b] | D.-L. Zou 2025 | |||
|
|||||||
| 246.1 | garpedvinin A[c] | G. pedunculata[a] Roxb. | −86.6 (0.30, m)[b] | D.-L. Zou 2025 | |||
|
|||||||
| 247.1 | garciesculentone A[m] | G. esculenta[a] | −116.5 (0.06, m)[b] | H. Zhang 2014b | |||
|
|||||||
| 248.1 | garcinialiptone B | G. subelliptica[a] | +84.8 (5.40, m)[b] | L.-J. Zhang 2010 | |||
|
|||||||
| 249.1 | garcicowin D | G. cowa[a] | +336.0 (0.12)[b] | G. Xu 2010, Z.-H. Xu 2022 | |||
|
|||||||
| 250.1 | R1 = Ph R2 = CH=CMe2 |
13,14-didehydroxygarcicowin C[c] | G. multiflora[a] | −68.6 (0.18)[b] | G. Xu 2010, Y.-G. Fu 2025 | ||
| 250.2 | R1 = 3-hydroxyphenyl R2 = CH=CMe2 |
xanthochymusone H[d] | G. xanthochymus[a] | +60 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 250.3 | R1 = 3,4-dihydroxyphenyl R2 = CH=CMe2 |
garcicowin C[c] | G. cowa[a] | −72.1 (0.10)[b] | G. Xu 2010, Z.-H. Xu 2022 | ||
| 250.4 | R1 = 3,4-dihydroxyphenyl R2 = CH=CMe2 |
xanthochymusone I[d] (enantiomer) | G. xanthochymus[a] | +69 (0.1, m)[b] | Z.-H. Xu 2022 | ||
| 250.5 | R1 = 3,4-dihydroxyphenyl R2 = (R)-CH(OH)CMe2OH |
garynthone G | G. yunnanensis[a] | racemic; +160 (0.1, m)[b] and −76.85 (0.1, m)[b] | Z. Guo 2025a | ||
| 250.6 | R1 = 3,4-dihydroxyphenyl R2 = (R)-CH(OH)CMe2OMe |
garynthone F | G. yunnanensis[a] | racemic; +114.47 (0.1, m)[b] and −135.64 (0.1, m)[b] | Z. Guo 2025a | ||
|
|||||||
| 251.1 | garpedvinin D[c] | G. pedunculata[a] Roxb. | −54.6 (0.1, m)[b] | D.-L. Zou 2025 | |||
|
|||||||
| 252.1 | garcoblone E[c] | G. oblongifolia, G. yunnanensis[a] | −44.5 (1.0, m)[b] | Z. Wu 2022, Z. Guo 2025a | |||
|
|||||||
| 253.1 | coccinone A | M. coccinea[a] | +28 (1.0)[b] | G. Marti 2009 | |||
|
|||||||
| 254.1 | garpedvinin B[c] | G. pedunculata[a] Roxb. | −65.5 (0.1, m)[b] | D.-L. Zou 2025 | |||
|
|||||||
| 255.1 | garpedvinin C[c] | G. pedunculata[a] Roxb. | −68.8 (0.1, m)[b] | D.-L. Zou 2025 | |||
|
|||||||
| 256.1 | R = Ph | garcimultiflorone B | G. multiflora[a] | −132 (0.96)[b] | J.-J. Chen 2009 | ||
| 256.2 | R = 3-hydroxyphenyl | 13-hydroxygarcimultiflorone B | G. multiflora[a] | −115 (0.13)[b] | J.-J. Chen 2009 | ||
|
|||||||
| 257.1 | hyperascyrin M[d] | H. ascyron[a] | −57.2 (0.1, m)[b] | B. Zhen 2019 | |||
|
|||||||
| 258.1 | R = CH2CH2CHMeCO2H | garschomcinol E[d][e] | G. schomburgkiana[a] | +12.5 (0.20, m)[b] | S. Kaennakam 2022a | ||
| 258.2 | R = geranyl | garschomcinol D[d] | G. schomburgkiana[a] | +13.1 (0.30, m)[b] | S. Kaennakam 2022a | ||
|
|||||||
| 259.1 | R1 = H R2 = prenyl R3 = prenyl |
guttiferone S | G. cochinchinensis[a] | −10 (0.28, m)[b] | H. D. Nguyen 2011, D. H. Le 2016 | ||
| 259.2 | R1 = prenyl R2 = Me R3 = prenyl |
longistylione D[c] | H. longistylum[a] | +19.5 (0.13, mc)[b] | X. Cao 2017 | ||
| 259.3 | R1 = prenyl R2 = Me R3 = (E)-CH=CHCMe2OH |
ascyrone C[d] | H. ascyron[a] | +78 (0.06, m)[b] | X. Deng 2022 | ||
| 259.4 | R1 = prenyl R2 = Me R3 = (E)-CH=CHC(Me)=CH2 |
ascyrone E[d] | H. ascyron[a] | +3 (0.09, MeOH)[b] | X. Deng 2022 | ||
|
|||||||
| 260.1 | R1 = Ph R2 = H R3 = prenyl R4 = prenyl R5 = CMe=CH2 |
garcowacinol J[d] | G. cowa[a] | +18.0 (0.10, m)[b] | S. Kaennakam 2022b | ||
| 260.2 | R1 = Ph R2 = H R3 = prenyl R4 = prenyl R5 = CMe2OH |
garcowacinol I[d] | G. cowa[a] | +13.5 (0.10, m)[b] | S. Kaennakam 2022b | ||
| 260.3 | R1 = Ph R2 = prenyl R3 = Me R4 = prenyl R5 = CMe2OH |
longistylione C[c] | H. longistylum[a] | +154.3 (0.33, mc)[b] | X. Cao 2017 | ||
| 260.4 | R1 = Ph R2 = prenyl R3 = Me R4 = (E)-CH=CHCMe2OH R5 = CMe2OH |
ascyrone D[d] | H. ascyron[a] | +11 (0.11, m)[b] | X. Deng 2022 | ||
| 260.5 | R1 = Ph R2 = (E)-CH=CHCMe2OH R3 = Me R4 = prenyl R5 = CMe2OH |
ascyrone A[d] | H. ascyron[a] | +6 (0.05, m)[b] | X. Deng 2022 | ||
| 260.6 | R1 = Ph R2 = (E)-CH=CHCMe2OH R3 = Me R4 = (E)-CH=CHCMe2OH R5 = CMe2OH |
ascyrone B[d] | H. ascyron[a] | +34 (0.16, m)[b] | X. Deng 2022 | ||
| 260.7 | R1 = 3,4-dihydroxyphenyl R2 = H R3 = prenyl R4 = geranyl R5 = CMe2OH |
schomburgkianone E[d] | G. schomburgkiana[a] | +104 (0.4)[b] | D. H. Le 2016 | ||
|
|||||||
| 261.1 | guttiferone H[e] | G. xanthochymus[a] | +94 (0.006)[b] | S. Baggett 2005 | |||
|
|||||||
| 262.1 | garcixanthochymone K[d] | G. xanthochymus[a] | −37.9 (0.20, m)[b] | S. Jin 2021 | |||
|
|||||||
| 263.1 | burlemarxione E | C. burlemarxii[a] | +11.0 (0.5)[b] | C. G. Ferraz 2021 | |||
|
|||||||
| 264.1 | hyperprin A[d] | H. przewalskii[a] | −4.0 (0.10, m)[b] | J.-F. Zong 2020 | |||
|
|||||||
| 265.1 | R = prenyl X = OH |
garciyunnanol D[d] | G. yunnanensis[a] | +158 (0.64, m)[b] | X.-Y. Hu 2024 | ||
| 265.2 | R = geranyl X = H |
garciyunnanol C[d] | G. yunnanensis[a] | +17 (0.18, m)[b] | X.-Y. Hu 2024 | ||
| 265.3 | R = geranyl X = OH |
garciyunnanol B[d] | G. yunnanensis[a] | +115 (0.39, m)[b] | X.-Y. Hu 2024 | ||
|
|||||||
| 266.1 | garciyunnanol A[d] | G. yunnanensis[a] | +14 (0.16, m)[b] | X.-Y. Hu 2024 | |||
|
|||||||
| 267.1 | thoreliolide A[d][e] | Calophyllum thorelii | +82.0 (0.45, e)[b] | L.-T. T. Nguyen 2016 | |||
|
|||||||
| 268.1 | thoreliolide B[d] | Calophyllum thorelii | −51.2 (0.75, e)[b] | L.-T. T. Nguyen 2016 | |||
|
|||||||
| 269.1 | R1 = Ph R2 = prenyl R3 = CH=CMe2 R4 = prenyl |
hyperibone K[d] | H. scabrum[a] | +22.3 (0.3)[b] | N. Tanaka 2004, J. Qi 2010 | ||
| 269.2 | R1 = Ph R2 = prenyl R3 = CH=CMe2 R4 = (E)-4-oxo-3-methyl-2-buten-1-yl |
hypersampsonone K[d] | H. sampsonii[a] | −7.5 (1.0, m)[b] | Y. Li 2023 | ||
| 269.3 | R1 = Ph R2 = prenyl R3 = CH2C(=O)CH3 R4 = prenyl |
hyperibrin E[d] | H. scabrum[a] | +47.3 (0.06, m)[b] | J. Hu 2017 | ||
| 269.4 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = CH=CMe2 R4 = prenyl |
18-hydroxyhyperibone K | H. hypericoides[a] | NR | O. E. Christian 2008 | ||
| 269.5 | R1 = 3,4-dihydroxyphenyl R2 = prenyl R3 = CH2C(=O)CH3 R4 = prenyl |
oblongifolin K[c] | G. oblongifolia[a] | +55.4 (0.07, m)[b] | H. Zhang 2014a | ||
| 269.6 | R1 = 3,4-dihydroxyphenyl R2 = lavandulyl R3 = CH=CMe2 R4 = prenyl |
garciniagifolone A[e] | G. oblongifolia[a] | +7.0 (0.09, m)[b] | W.-G. Shan 2012 | ||
| 269.7 | R1 = 3,4-dihydroxyphenyl R2 = 2,4,4-trimethyl-1-cyclohexen-1-ylmethyl R3 = CH=CMe2 R4 = prenyl |
garpauvinin A[d] | G. paucinervis[a] | −49.86 (0.91, m)[b] | C.-C. Jia 2023 | ||
| 269.8 | R1 = 3,4-dihydroxyphenyl R2 = isolavandulyl[g] R3 = CH=CMe2 R4 = prenyl |
(+)-garcinialiptone A[e][j] | G. subelliptica[a] | +12.1 (3.40, m)[b] | L.-J. Zhang 2010 | ||
| 269.9 | R1 = 3,4-dihydroxyphenyl R2 = isolavandulyl[g] R3 = CH=CMe2 R4 = prenyl |
(−)-garcinialiptone A[e][j] (enantiomer) | G. subelliptica, G. yunnanensis[a] | −17.3 (3.36, m)[b] | L.-J. Zhang 2010 | ||
| 269.10 | R1 = 3,4-dihydroxyphenyl R2 = CH2CH(CMe=CH2)CH2CH2CMe2OH R3 = CH=CMe2 R4 = prenyl |
garcixanthochymone A[e] | G. xanthochymus[a] | −13.8 (0.660, m)[b] | Y. Chen 2017 | ||
| 269.11 | R1 = 3,4-dihydroxyphenyl R2 = (E)-CH2CH(CMe=CH2)CH=CHCMe2OH R3 = CH=CMe2 R4 = prenyl |
garciyunnanensisin B[d][e] | G. yunnanensis[a] | −130.8 (0.1, m)[b] | P.-X. Ji 2025 | ||
| 269.12 | R1 = 3,4-dihydroxyphenyl R2 = (S)-lavandulyl R3 = (R)-3,3-dimethyloxiran-2-yl R4 = prenyl |
garpedvinin I[d] | G. pedunculata[a] Roxb. | −54.7 (0.1, m)[b] | D.-L. Zou 2025 | ||
| 269.13 | R1 = 3,4-dihydroxyphenyl R2 = (2R,4S)-CH2CH(CMe=CH2)CH2CH(OOH)CMe=CH2 R3 = CH=CMe2 R4 = prenyl |
garpedvinin J[d] | G. pedunculata[a] Roxb. | −79.0 (0.1, m)[b] | D.-L. Zou 2025 | ||
| 269.14 | R1 = 3,4-dihydroxyphenyl R2 = (S,E)-CH2CH(CMe=CH2)CH=CHCMe2OH R3 = CH=CMe2 R4 = prenyl |
garpedvinin H[d] | G. pedunculata[a] Roxb. | −79.0 (0.1, m)[b] | D.-L. Zou 2025 | ||
| 269.15 | R1 = 3,4-dihydroxyphenyl R2 = (S,E)-CH2CH(CMe=CH2)CH=CHCMe2OOH R3 = CH=CMe2 R4 = prenyl |
garpedvinin G[d] | G. pedunculata[a] Roxb. | −118.3 (0.1, m)[b] | D.-L. Zou 2025 | ||
| 269.16 | R1 = 3,4-dihydroxyphenyl R2 = 4-hydroxyisolavandulyl[g] R3 = CH=CMe2 R4 = prenyl |
garcixanthochymone B[e] | G. xanthochymus[a] | −0.81 (0.410, m)[b] | Y. Chen 2017 | ||
| 269.17 | R1 = 3,4-dihydroxyphenyl R2 = isolavandulyl[g] R3 = OH R4 = prenyl |
garciyunnanensisin A[d][e] | G. yunnanensis[a] | −150.2 (0.1, m)[b] | P.-X. Ji 2025 | ||
|
|||||||
| 270.1 | garcixanthochymone C | G. xanthochymus[a] | +51.0 (0.400, m)[b] | Y. Chen 2017 | |||
|
|||||||
| 271.1 | oblongifolin J[c] | G. oblongifolia[a] | +8.6 (0.03, m)[b] | H. Zhang 2014a | |||
|
|||||||
| 272.1 | hypersampsone R (one of two by that name) | H. sampsonii[a] | +160 (0.1)[b] | J.-J. Chen 2014 | |||
|
|||||||
| 273.1 | garcimultiflorone C[e] | G. multiflora[a] | −25.3 (0.12)[b] | J.-J. Chen 2009 | |||
|
|||||||
| 274.1 | R = (S)-lavandulyl | garynthone B | G. yunnanensis[a] | racemic; +28.70 (0.1, m)[b] and −30.33 (0.1, m)[b] | Z. Guo 2025a | ||
| 274.2 | R = (S)-isolavandulyl[g] | garynthone C[d] | G. yunnanensis[a] | +7.85 (0.1, m)[b] | Z. Guo 2025a | ||
|
|||||||
| 275.1 | soniiglucinol A[c] | H. wilsonii[a] | −74.0 (0.2, m)[b] | S. Xie 2020a | |||
|
|||||||
| 276.1 | soniiglucinol B[c][e] | H. wilsonii[a] | −139.4 (0.4, m)[b] | S. Xie 2020a | |||
|
|||||||
| 277.1 | R1 = i-Pr R2 = prenyl |
hypersonin A[c] | H. wilsonii[a] | −13 (0.9, m)[b] | S. Xie 2020b | ||
| 277.2 | R1 = i-Pr R2 = geranyl |
hypersonin C[c] | H. wilsonii[a] | −2 (0.4, m)[b] | S. Xie 2020b | ||
| 277.3 | R1 = s-Bu R2 = prenyl |
hypersonin B[c][e] | H. wilsonii[a] | +3 (0.9, m)[b] | S. Xie 2020b | ||
|
|||||||
| 278.1 | hypersonin D[c][e] | H. wilsonii[a] | −1 (0.2, m)[b] | S. Xie 2020b | |||
|
|||||||
| 279.1 | soniiglucinol C[c] | H. wilsonii[a] | −151.3 (0.3, m)[b] | S. Xie 2020a | |||
|
|||||||
| 280.1 | soniiglucinol D[c] | H. wilsonii[a] | −24.9 (0.2, m)[b] | S. Xie 2020a | |||
|
|||||||
| 281.1 | enaimeone A | H. papuanum[a] | +27.8 (0.1, m)[b] | K. Winkelmann 2001b, A. B. zur Bonsen 2023 | |||
|
|||||||
| 282.1 | R = i-Pr | enaimeone B | H. papuanum[a] | +29.4 (0.1, m)[b] | K. Winkelmann 2001b, A. B. zur Bonsen 2023 | ||
| 282.2 | R = s-Bu | enaimeone C[e] | H. papuanum[a] | +32.9 (0.1, m)[b] | K. Winkelmann 2001b, A. B. zur Bonsen 2023 | ||
|
|||||||
| 283.1 | R1 = H R2 = geranyl |
hyperxylone B[c] | H. beanii[a] | +41 (0.09, m)[b] | X.-Y. Li 2022 | ||
| 283.2 | R1 = prenyl R2 = prenyl |
hyperxylone A[c] | H. beanii[a] | +38 (0.08, m)[b] | X.-Y. Li 2022 | ||
|
|||||||
| 284.1 | R1 = i-Pr R2 = CMe=CH2 |
ialibinone A | H. papuanum[a] | −22 (0.1)[b] | K. Winkelmann 2000 | ||
| 284.2 | R1 = i-Pr R2 = CMe2OH |
1′-hydroxyialibinone A | H. papuanum[a] | +3.7 (0.1, m)[b] | K. Winkelmann 2001b | ||
| 284.3 | R1 = i-Pr R2 = C(=CH2)CH2CH2CH=CMe2 |
yezo'otogirin E | H. yezoense[a] | +21.4 (1.7, m)[b] | N. Tanaka 2016a | ||
| 284.4 | R1 = s-Bu R2 = CMe=CH2 |
ialibinone C[e] | H. papuanum[a] | −26 (0.1)[b] | K. Winkelmann 2000 | ||
|
|||||||
| 285.1 | R1 = i-Pr R2 = H |
ialibinone E | H. papuanum[a] | −33 (0.1)[b] | K. Winkelmann 2000 | ||
| 285.2 | R1 = i-Pr R2 = CMe=CH2 |
ialibinone B | H. papuanum[a] | −91 (0.1)[b] | K. Winkelmann 2000 | ||
| 285.3 | R1 = i-Pr R2 = CMe2OH |
1′-hydroxyialibinone B | H. papuanum[a] | −35.7 (0.1, m)[b] | K. Winkelmann 2001b | ||
| 285.4 | R1 = i-Pr R2 = C(=CH2)CH2CH2CH=CMe2 |
yezo'otogirin F | H. yezoense[a] | +75.9 (1.7, m)[b] | N. Tanaka 2016a | ||
| 285.5 | R1 = s-Bu R2 = CMe=CH2 |
ialibinone D[e] | H. papuanum[a] | −72 (0.1)[b] | K. Winkelmann 2000 | ||
| 285.6 | R1 = s-Bu R2 = CMe2OH |
1′-hydroxyialibinone D[e] | H. papuanum[a] | −30.3 (0.1, m)[b] | K. Winkelmann 2001b | ||
|
|||||||
| 286.1 | lancasternoid A | H. lancasteri[a] | racemic | J.-Q. You 2025 | |||
|
|||||||
| 287.1 | lancasternoid B | H. lancasteri[a] | racemic | J.-Q. You 2025 | |||
|
|||||||
| 288.1 | lancasternoid C | H. lancasteri[a] | racemic | J.-Q. You 2025 | |||
|
|||||||
| 289.1 | lancasternoid D | H. lancasteri[a] | racemic | J.-Q. You 2025 | |||
|
|||||||
| 290.1 | takaneone A | H. sikokumontanum[a] | +30.0 (0.2, m)[b] | N. Tanaka 2008 | |||
|
|||||||
| 291.1 | takaneone B | H. sikokumontanum[a] | +24.0 (0.3, m)[b] | N. Tanaka 2008 | |||
|
|||||||
| 292.1 | R = COCH3 | takaneone C | H. sikokumontanum[a] | +61.9 (0.4, m)[b] | N. Tanaka 2008 | ||
| 292.2 | R = C(=CH2)CH2CH2CH=CMe2 | hyperelodione E[d] | H. elodeoides[a] | +44.0 (0.24, m)[b] | D.-R. Qiu 2021 | ||
|
|||||||
| 293.1 | hyperelodione F[d] | H. elodeoides[a] | +24.8 (0.33, m)[b] | D.-R. Qiu 2021 | |||
|
|||||||
| 294.1 | garcibracgluinol A[c] | G. bracteata[a] | +141.4 (0.02, m)[b] | J. Xu 2025 | |||
|
|||||||
| 295.1 | no common name | H. scabrum[a] | +30.5 (1.0)[b] | S. Soroury 2020 | |||
|
|||||||
| 296.1 | hyperireflexolide A[c] | H. beanni[a] | 0 (1.54)[b] | L. Cardona 1993 | |||
|
|||||||
| 297.1 | hyperireflexolide B[c] | H. beanni[a] | 0 (0.74)[b] | L. Cardona 1993, A. B. zur Bonsen 2023 | |||
|
|||||||
| 298.1 | hyperberlone A[c] | H. beanni[a] | 0 (0.74)[b] | Y.-W. Li 2022 | |||
|
|||||||
| 299.1 | garcinielliptone HG[c] | G. subelliptica[a] | −17 (0.02, m)[b] | C.-C. Liaw 2019 | |||
| 299.2 | garcinielliptone HH[d] (enantiomer) | G. subelliptica[a] | +16 (0.05, m)[b] | C.-C. Liaw 2019 | |||
|
|||||||
| 300.1 | R1 = prenyl R2 = H R3 = prenyl |
(−)-nemorosonol, a.k.a. burlemarxione C, and tautomer isonemorosonol[c] | C. burle-marxii, T. japonicum[a] | −207 (0.7)[b], −48 (1.35)[b] | A. Oya 2015, C. G. Ferraz 2019, M. do C. C. Silva 2024 | ||
| 300.2 | R1 = prenyl R2 = H R3 = prenyl |
(+)-nemorosonol[d] (enantiomer) | C. nemorosa[a] | +203 (0.7)[b] | F. delle Monache 1988, S. Cerrini 1993 | ||
| 300.3 | R1 = prenyl R2 = H R3 = cis-3-isopropenyl-2,2-dimethylcyclopentyl |
garmultinone D[d][e] | G. multiflora[a] | +172.5 (0.04, m)[b] | Y. Chen 2019b | ||
| 300.4 | R1 = CH2CH2CMe=CH2 R2 = H R3 = prenyl |
doitunggarcinone B, a.k.a. burlemarxione G, and tautomer burlemarxione F | C burle-marxii, G. propinqua[a] | −129 (0.054)[b], −14.0 (0.5)[b] | C. Tantapakul 2012, H. P. Pepper 2012, C. G. Ferraz 2021, M. do C. C. Silva 2024 | ||
| 300.5 | R1 = prenyl R2 = prenyl R3 = prenyl |
ascyronone E, a.k.a. hypatulin C[d][w] | H. ascyron, H. patulum[a] | −86.8 (0.1, m)[b], +102.5 (0.3, m)[b] | Z. P. Li 2019, N. Tanaka 2019 | ||
|
|||||||
| 301.1 | trijapin A[c] | T. japonicum[a] | −25 (0.2, m)[b] | A. Oya 2015 | |||
|
|||||||
| 302.1 | R = prenyl | trijapin B | T. japonicum[a] | −200 (0.1, m)[b] | A. Oya 2015 | ||
| 302.2 | R = CH2CH2CMe=CH2 | garcibracteamone J[c] | G. bracteata[a] | −169 (0.02, m)[b] | Q. Xue 2020 | ||
|
|||||||
| 303.1 | trijapin C | T. japonicum[a] | +38 (0.04, m)[b] | A. Oya 2015 | |||
|
|||||||
| 304.1 | R = prenyl | garmultinone A[d] | G. multiflora[a] | +176.4 (0.04, m)[b] | Y. Chen 2019b | ||
| 304.2 | R = (E)-CH=CHCMe2OOH | garmultinone C[d] | G. multiflora[a] | +207.2 (0.02, m)[b] | Y. Chen 2019b | ||
|
|||||||
| 305.1 | R = Ph | garmultinone B[d] | G. multiflora[a] | +173.9 (0.06, m)[b] | Y. Chen 2019b | ||
| 305.2 | R = 3-hydroxyphenyl | 30-hydroxy-garmultinone B[d] | G. multiflora[a] | +25.0 (0.1, m)[b] | J. Cao 2024 | ||
|
|||||||
| 306.1 | garmultinone E[d] (one of two by that name) | G. multiflora[a] | +85.0 (0.1, m)[b] | J. Cao 2024 | |||
|
|||||||
| 307.1 | garmultinone F[d] | G. multiflora[a] | +141.0 (0.1, m)[b] | J. Cao 2024 | |||
|
|||||||
| 308.1 | R1 = prenyl R2 = prenyl |
(−)-garcimulin A[c] | G. multiflora[a] | −142.9 (0.11, m)[b] | Y.-M. Fan 2015 | ||
| 308.2 | R1 = prenyl R2 = prenyl |
(+)-garcimulin A[d] (enantiomer) | G. multiflora[a] | +115.1 (0.11, m)[b] | Y.-M. Fan 2015 | ||
| 308.3 | R1 = CH2CH2CMe=CH2 R2 = prenyl |
garcimulin B[c] | G. multiflora[a] | −118.5 (0.21, m)[b] | Y.-M. Fan 2015 | ||
| 308.4 | R1 = CH2CH2CMe2OH R2 = prenyl |
garcimulin C[d] | G. multiflora[a] | +67.0 (0.1, m)[b] | J. Cao 2024 | ||
|
|||||||
| 309.1 | R1 = prenyl R2 = prenyl |
(−)-garmultin D[c] | G. multiflora[a] | −166.7 (0.28, m)[b] | D. S. Tian 2016 | ||
| 309.2 | R1 = prenyl R2 = prenyl |
(+)-garmultin D[d] (enantiomer) | G. multiflora[a] | +164.9 (0.30, m)[b] | D. S. Tian 2016 | ||
| 309.3 | R1 = prenyl R2 = CH2CH2CMe2OH |
garmultin H[d] | G. multiflora[a] | +77.0 (0.1, m)[b] | H. Luo 2025 | ||
| 309.4 | R1 = CH2CH2CMe=CH2 R2 = prenyl |
garmultin E[d] | G. multiflora[a] | −79.2 (0.29, m)[b] | D. S. Tian 2016 | ||
|
|||||||
| 310.1 | (−)-garmultin C[c] | G. multiflora[a] | −85.0 (0.20, m)[b] | D. S. Tian 2016 | |||
| 310.2 | (+)-garmultin C[d] (enantiomer) | G. multiflora[a] | +72.6 (0.23, m)[b] | D. S. Tian 2016 | |||
|
|||||||
| 311.1 | R = prenyl | (−)-garmultin A[c] | G. multiflora[a] | −112.8 (0.24, a)[b] | D. S. Tian 2016 | ||
| 311.2 | R = prenyl | (+)-garmultin A[d] (enantiomer) | G. multiflora[a] | +110.2 (0.22, a)[b] | D. S. Tian 2016 | ||
| 311.3 | R = CH2CH2CMe=CH2 | garmultin B[d] | G. multiflora[a] | −53.0 (0.37, m)[b] | D. S. Tian 2016 | ||
|
|||||||
| 312.1 | R = prenyl | (−)-garmultin F[c] | G. multiflora[a] | −39.0 (0.32, m)[b] | D. S. Tian 2016 | ||
| 312.2 | R = prenyl | (+)-garmultin F[d] (enantiomer) | G. multiflora[a] | +30.2 (0.37, m)[b] | D. S. Tian 2016 | ||
| 312.3 | R = CH2CH2CMe=CH2 | garmultin G[d] | G. multiflora[a] | −20.4 (0.25, m)[b] | D. S. Tian 2016 | ||
|
|||||||
| 313.1 | hyperuralone A[d] | H. uralum[a] | +34.3 (0.2, m)[b] | J.-J. Zhang 2014b | |||
|
|||||||
| 314.1 | hyperforcinol B[d] | H. forrestii[a] | +72 (0.2, m)[b] | W.-J. Lu 2021 | |||
|
|||||||
| 315.1 | uralin A, a.k.a. hyperacmosin N[d] | H. acmosepalum, H. uralum[a] | +71 (0.2, m)[b], +47.3 (0.1, m)[b] | Q.-Q. Fang 2021, M.-x. Sun 2021b | |||
|
|||||||
| 316.1 | burlemarxione A, and tautomer burlemarxione B | C. burlemarxii[a] | −113.0 (1.35)[b] | C. G. Ferraz 2019 | |||
|
|||||||
| 317.1 | R = prenyl | garcibractinone B[c] | G. bracteata[a] | +20 (0.05, m)[b] | Y. Chen 2020 | ||
| 317.2 | R = CH2CH2CMe=CH2 | garcibractinone A[c] | G. bracteata[a] | +72 (0.05, m)[b] | Y. Chen 2020 | ||
|
|||||||
| 318.1 | hypatulin A[c] | H. patulum[a] | +40 (0.05, m)[b] | N. Tanaka 2016b | |||
|
|||||||
| 319.1 | hyperforcinol C[c] | H. forrestii[a] | +30 (0.2, m)[b] | W.-J. Lu 2021 | |||
|
|||||||
| 320.1 | hypatulin B | H. patulum[a] | +27.0 (0.17, m)[b] | N. Tanaka 2016b | |||
|
|||||||
| 321.1 | X1 = H X2 = OH |
garcimultiflin D[d] | G. multiflora[a] | +10.0 (1.0, m)[b] | H. Luo 2025 | ||
| 321.2 | X1 = OH X2 = H |
garcimultiflin A[d] | G. multiflora[a] | −15.0 (1.0, m)[b] | J. Cao 2023 | ||
|
|||||||
| 322.1 | garcimultiflin B[d] | G. multiflora[a] | −10.0 (1.0, m)[b] | J. Cao 2023 | |||
|
|||||||
| 323.1 | garcimultiflin C[d] | G. multiflora[a] | +11.0 (1.0, m)[b] | J. Cao 2023 | |||
|
|||||||
| 324.1 | R1 = prenyl R2 = H R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
garcibracteatone | G. bracteata[a] | −1 (1.00)[b] | O. Thoison 2005 | ||
| 324.2 | R1 = prenyl R2 = H R3 = H R4 = prenyl X1 = H X2 = OH X3 = OH |
garcixanthochymone E | G. xanthochymus[a] | +9.49 (0.604, m)[b] | Y. Chen 2017 | ||
| 324.3 | R1 = prenyl R2 = H R3 = H R4 = (E)-CH=CHCMe2OH X1 = H X2 = H X3 = H |
garcibracteatone D[c] | G. bracteata[a] | −74.4 (0.01, m)[b] | X.-N. Li 2023 | ||
| 324.4 | R1 = prenyl R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyphenrone L, a.k.a. hypelodin B[d] | H. elodeoides, H. henryi, H. sampsonii[a] | −6.5 (2.9, m)[b], −12 (0.1, m)[b] | C. Hashida 2014, X.-W. Yang 2015, N. Tanaka 2019 | ||
| 324.5 | R1 = prenyl R2 = H R3 = prenyl R4 = (E)-CH=CHCMe2OOH X1 = H X2 = H X3 = H |
hyperkouytone K[d] | H. kouytchense[a] | −20.0 (0.27, m)[b] | H.-Y. Lou 2024 | ||
| 324.6 | R1 = prenyl R2 = (E)-CH=CHCMe2OH R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
hyperuralone B[d] | H. uralum[a] | −14.6 (0.14, m)[b] | J.-J. Zhang 2014b | ||
| 324.7 | R1 = prenyl R2 = (E)-CH=CHCMe2OOH R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
hyperberlone B[d] | H. beanii[a] | −8.9 (0.4, m)[b] | Y.-W. Li 2022 | ||
| 324.8 | R1 = CH2CH2CMe=CH2 R2 = H R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
doitunggarcinone A | G. propinqua[a] | −133.3 (0.015)[b] | C. Tantapakul 2012, H. P. Pepper 2012 | ||
| 324.9 | R1 = CH2CH2CMe=CH2 R2 = H R3 = H R4 = prenyl X1 = H X2 = OH X3 = OH |
garcixanthochymone D | G. xanthochymus[a] | +22.7 (0.577, m)[b] | Y. Chen 2017 | ||
| 324.10 | R1 = CH2CH2CMe=CH2 R2 = H R3 = H R4 = (E)-CH=CHCMe2OH X1 = H X2 = H X3 = H |
garcibracteatone E[c] | G. bracteata[a] | +3.63 (0.05, m)[b] | X.-N. Li 2023 | ||
| 324.11 | R1 = CH2CH2CMe2OH R2 = H R3 = H R4 = CH2CH2CMe2OH X1 = OH X2 = OH X3 = H |
hyphenrone Y[d] (one of two by that name) | G. multiflora[a] | −31.0 (0.1, m)[b] | J. Cao 2024 | ||
| 324.12 | R1 = (R)-CH2CH(OH)CMe=CH2 R2 = H R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
garcibracteatone A[c] | G. bracteata[a] | +34.8 (0.25, m)[b] | X.-N. Li 2023 | ||
| 324.13 | R1 = (R)-CH2CH(OH)CMe2OH R2 = H R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
garcibracteatone B[c] | G. bracteata[a] | +8.08 (0.06, m)[b] | X.-N. Li 2023 | ||
| 324.14 | R1 = (S)-CH2CH(OH)CMe2OH R2 = H R3 = H R4 = prenyl X1 = H X2 = H X3 = H |
garcibracteatone C[c] | G. bracteata[a] | +46.18 (0.05, m)[b] | X.-N. Li 2023 | ||
| 324.15 | R1 = (R)-CH2CH(OH)CMe2OH R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone B[d] | H. patulum[a] | −18.2 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.16 | R1 = (S)-CH2CH(OH)CMe2OH R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone A[d] | H. patulum[a] | −22.5 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.17 | R1 = (R)-CH2CH(OH)CMe2OMe R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone D[d] | H. patulum[a] | −26.1 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.18 | R1 = (S)-CH2CH(OH)CMe2OMe R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone C[d] | H. patulum[a] | −23.6 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.19 | R1 = (R)-CH2CH(OH)CMe=CH2 R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone F[d] | H. patulum[a] | −15.2 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.20 | R1 = (S)-CH2CH(OH)CMe=CH2 R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone E[d] | H. patulum[a] | −17.95 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.21 | R1 = (R)-2,3-epoxy-3-methylbutyl R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperkouytone L, a.k.a. hyperpatuone H[d] | H. kouytchense, H. patulum[a] | −42.6 (0.33, m)[b], −19.8 (0.3, m)[b] | H.-Y. Lou 2024, F. Zhang 2026 | ||
| 324.22 | R1 = (S)-2,3-epoxy-3-methylbutyl R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone G[d] | H. patulum[a] | −15.2 (0.3, m)[b] | F. Zhang 2026 | ||
| 324.23 | R1 = (E)-CH=CHCMe2OH R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyphenrone R | H. henryi[a] H. Lév & Vaniot | −15 (0.15, m)[b] | Y. Liao 2016 | ||
| 324.24 | R1 = (E)-CH=CHCMe2OOH R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyphenrone S | H. henryi[a] H. Lév & Vaniot | −14 (0.12, m)[b] | Y. Liao 2016 | ||
| 324.25 | R1 = (E)-CH=CHCMe2OMe R2 = H R3 = prenyl R4 = prenyl X1 = H X2 = H X3 = H |
hyperpatuone I[d] | H. patulum[a] | −52 (0.3, m)[b] | F. Zhang 2026 | ||
|
|||||||
| 325.1 | R1 = CH2CH2CMe=CH2 R2 = H |
garcibracteamone H[c] | G. bracteata[a] | +40 (0.05, m)[b] | Q. Xue 2020 | ||
| 325.2 | R1 = CH2CH2CMe=CH2 R2 = H |
burlemarxione H[d] (enantiomer) | C. burle-marxii[a] | −40.0 (0.5)[b] | M. do C. C. Silva 2024, Q. Xue 2020 | ||
| 325.3 | R1 = prenyl R2 = prenyl |
hyperforcinol A[d] | H. forrestii[a] | −39 (0.1, m)[b] | W.-J. Lu 2021 | ||
|
|||||||
| 326.1 | hyperkouytone M | H. kouytchense[a] | −24.8 (0.36, m)[b] | H.-Y. Lou 2024 | |||
|
|||||||
| 327.1 | garcibracteamone I[c] | G. bracteata[a] | −22 (0.05, m)[b] | Q. Xue 2020 | |||
|
|||||||
| 328.1 | burlemarxione D | C. burlemarxii[a] | −8.0 (1.0)[b] | C. G. Ferraz 2021 | |||
|
|||||||
| 329.1 | hyperlanin B[d] | H. lancasteri[a] | −32.1 (0.3, m)[b] | J.-Q. You 2024 | |||
|
|||||||
| 330.1 | hyparillum B[d] | H. patulum[a] | −51.5 (0.1)[b] | Y. Duan 2024a | |||
|
|||||||
| 331.1 | hyparillum A[d] | H. patulum[a] | −26.1 (0.2)[b] | Y. Duan 2024a | |||
|
|||||||
| 332.1 | garcioblon D[d] | G. oblongifolia[a] | −37.2 (0.3, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 333.1 | garcioblon A[d] | G. oblongifolia[a] | −29.0 (0.4, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 334.1 | garcioblon B[d] | G. oblongifolia[a] | −32.5 (0.4, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 335.1 | garcioblon C[d] | G. oblongifolia[a] | −40.6 (0.5, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 336.1 | garcioblon E[d] | G. oblongifolia[a] | +16.7 (0.5, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 337.1 | garcioblon F[d] | G. oblongifolia[a] | +26.2 (0.3, m)[b] | Q. Lin 2025 | |||
|
|||||||
| 338.1 | burlemarxione I[c] | C. burle-marxii[a] | NR | M. do C. C. Silva 2024 | |||
|
|||||||
| 339.1 | garbractin A[c] | G. bracteata[a] | −94.4 (0.05, m)[b] | X.-N. Li 2023 | |||
|
|||||||
| 340.1 | garcibracgluinol B[c] | G. bracteata[a] | +248.1 (0.03, m)[b] | J. Xu 2025 | |||
|
|||||||
| 341.1 | garcibracgluinol C[c] | G. bracteata[a] | +122.2 (0.07, m)[b] | J. Xu 2025 | |||
|
|||||||
| 342.1 | R = prenyl | xerophenone C | G. bracteata[a] | +106 (1.0)[b] | O. Thoison 2005 | ||
| 342.2 | R = CH2CH2CMe=CH2 | xerophenone A, and tautomer xerophenone B[d] | C. portlandiana, G. propinqua[a] | −36.4 (0.055, a)[b] | G. E. Henry 1995, T. Sriyatep 2017 | ||
|
|||||||
| 343.1 | R1 = Ph R2 = prenyl R3 = CH2CH(OMe)2 R4 = H |
garcoblone B[c] | G. oblongifolia[a] | +21.5 (1.0, m)[b] | Z. Wu 2022 | ||
| 343.2 | R1 = Ph R2 = prenyl R3 = CH2CO2H R4 = H |
garciyunnanin E[c] | G. yunnanensis[a] | +103.1 (0.13, m)[b] | D. Zheng 2021b | ||
| 343.3 | R1 = Ph R2 = prenyl R3 = CH2COCMe2OH R4 = H |
garciyunnanin F, a.k.a. garcoblone A[c] | G. oblongifolia, G. yunnanensis[a] | +137.6, +21.5 (0.10, m)[b] | D. Zheng 2021b, Z. Wu 2022 | ||
| 343.4 | R1 = Ph R2 = prenyl R3 = CH2COCMe2OH R4 = prenyl |
hyperberlone D[c] | H. beanii[a] | +1.6 (1.7, m)[b] | Y.-W. Li 2022 | ||
| 343.5 | R1 = Ph R2 = (S)-lavandulyl R3 = CH2COCMe2OH R4 = H |
garcoblone D[c][f] | G. oblongifolia[a] | +27.2 (1.0, m)[b] | Z. Wu 2022 | ||
| 343.6 | R1 = 3-hydroxyphenyl R2 = prenyl R3 = CH2COCMe2OH R4 = H |
garcoblone C[c] | G. oblongifolia[a] | +41.2 (1.0, m)[b] | Z. Wu 2022 | ||
|
|||||||
| 344.1 | R1 = prenyl R2 = prenyl |
garcoblone G[c] | G. oblongifolia[a] | −24.1 (1.0, m)[b] | S.-Y. Yang 2024 | ||
| 344.2 | R1 = prenyl R2 = CH2CH2CMe=CH2 |
garcibractinol A[d] | G. bracteata[a] | −91.9 (0.04, m)[b] | X. Li 2023 | ||
| 344.3 | R1 = (E)-CH=CHCMe2OMe R2 = CH2CH2CMe=CH2 |
garcibractinol E[d] | G. bracteata[a] | −85.1 (0.06, m)[b] | X. Li 2023 | ||
|
|||||||
| 345.1 | R = prenyl | garcibractinol B[d] | G. bracteata[a] | −13.3 (0.05, m)[b] | X. Li 2023 | ||
| 345.2 | R = (E)-CH=CHCMe2OH | garcibractinol D[d] | G. bracteata[a] | −63.9 (0.05, m)[b] | X. Li 2023 | ||
| 345.3 | R = (E)-CH=CHCMe2OOH | garcibractinol C[d] | G. bracteata[a] | −37.3 (0.05, m)[b] | X. Li 2023 | ||
| 345.4 | R = (R)-CH2CHOHCMe=CH2 | garcibractinol F[d] | G. bracteata[a] | −5.1 (0.056, m)[b] | X. Li 2023 | ||
|
|||||||
| 346.1 | garcoblone H[c] | G. oblongifolia[a] | −26.4 (1.0, m)[b] | S.-Y. Yang 2024 | |||
|
|||||||
| 347.1 | garynthone A | G. yunnanensis[a] | racemic; +7.85 (0.1, m)[b] and −3.28 (0.1, m)[b] | Z. Guo 2025a | |||
|
|||||||
| 348.1 | R = CMe2OH | garcibractinol G[d] | G. bracteata[a] | +150.5 (0.05, m)[b] | X. Li 2023 | ||
| 348.2 | R = CMe=CH2 | garcibractinol H[d] | G. bracteata[a] | +14.4 (0.04, m)[b] | X. Li 2023 | ||
|
|||||||
| 349.1 | garciyunnanin D[c] | G. yunnanensis[a] | +23.1 (0.10, m)[b] | D. Zheng 2021b | |||
|
|||||||
| 350.1 | spirohypertone A[c] | H. patulum[a] | −10.2 (0.2, m)[b] | Y. Duan 2024b | |||
|
|||||||
| 351.1 | trijapin D | T. japonicum[a] | −58 (0.6, m)[b] | A. Oya 2015 | |||
|
|||||||
| 352.1 | xerophenone G[c][e] | G. multiflora[a] | +103.0 (0.1, m)[b] | J. Cao 2024 | |||
|
|||||||
| 353.1 | xerophenone F[c][e] | G. multiflora[a] | +164.0 (0.1, m)[b] | J. Cao 2024 | |||
|
|||||||
| 354.1 | xerophenone H[e] | G. multiflora[a] | −15.0 (0.1, m)[b] | W.-Y. Lyu 2025 | |||
|
|||||||
| 355.1 | xerophenone D[c] | G. multiflora[a] | +116.0 (0.1, m)[b] | J. Cao 2024 | |||
|
|||||||
| 356.1 | R = isolavandulyl[g] | xerophenone E[c][e] | G. multiflora[a] | +23.0 (0.1, m)[b] | J. Cao 2024 | ||
| 356.2 | R = lavandulyl | xerophenone I[c][e] | G. multiflora[a] | −18.0 (0.1, m)[b] | H. Luo 2025 | ||
|
|||||||
| 357.1 | garcinielliptone HF | G. subelliptica[a] | −16.7 (0.22, a)[b] | C.-C. Wu 2008a | |||
|
|||||||
| 358.1 | gambogenone[e] | G. xanthochymus[a] | −5 (0.003, m)[b] | S. Baggett 2005 | |||
|
|||||||
| 359.1 | garcibractinone C[c] | G. multiflora[a] | +32.1 (0.02, m)[b] | Q. Li 2022 | |||
|
|||||||
| 360.1 | R = (2R)-3,3-dimethyloxiran-2-yl | hyperberin A[d] | H. beanii[a] | +69.1 (0.33, m)[b] | W.-J. Xu 2019 | ||
| 360.2 | R = (2S)-3,3-dimethyloxiran-2-yl | hyperberin B[d] | H. beanii[a] | +95.8 (0.28, m)[b] | W.-J. Xu 2019 | ||
| 360.3 | R = (1S)-1,2-dihydroxy-2-methyl-1-propyl | hyperberin C[d] | H. beanii[a] | +144.5 (0.19, m)[b] | W.-X. Li 2021 | ||
|
|||||||
| 361.1 | hyperberlone E[d] | H. beanii[a] | +5.7 (0.7, m)[b] | Y.-W. Li 2022 | |||
|
|||||||
| 362.1 | R1 = H R2 = benzoyl |
hyperforone C[c] (one of two by that name) | H. forrestii[a] | −115 (0.1, m)[b] | W.-J. Lu 2020 | ||
| 362.2 | R1 = benzoyl R2 = H |
hyperforone B[c] (one of two by that name) | H. forrestii[a] | −70 (0.1, m)[b] | W.-J. Lu 2020 | ||
|
|||||||
| 363.1 | R = prenyl | hypercohin A[c] | H. cohaerens, H. forrestii[a] | NR | X.-W. Yang 2012, W.-J. Lu 2020 | ||
| 363.2 | R = (E)-C=CCMe2OH | hypaluton B[c] | H. patulum[a] | −108.7 (0.4, m)[b] | Y. Duan 2021a | ||
|
|||||||
| 364.1 | hyperforone A[c] (one of two by that name) | H. forrestii[a] | −102 (0.1, m)[b] | W.-J. Lu 2020 | |||
|
|||||||
| 365.1 | hypaluton A[c] | H. patulum[a] | −64.2 (0.3, m)[b] | Y. Duan 2021a | |||
|
|||||||
| 366.1 | hyperbeanin P[c] | H. beanii[a] | −254 (0.2, m)[b] | X.-Y. Suo 2021b | |||
|
|||||||
| 367.1 | hyperprin B[c] | H. przewalskii[a] | −314.0 (0.10, m)[b] | J.-F. Zong 2020 | |||
|
|||||||
| 368.1 | hyperacmosin R[c] | H. acmosepalum[a] | −230.5 (0.14, m)[b] | Y. Ma 2022b | |||
|
|||||||
| 369.1 | hyperinoid A[c] | H. patulum[a] | +54.0 | X. Jia 2020 | |||
|
|||||||
| 370.1 | hyperinoid B[c] | H. patulum[a] | +61.0 | X. Jia 2020 | |||
|
|||||||
| 371.1 | (±)-hypandrone A | H. androsaemum[a] | 0 | J. Wei 2024a | |||
|
|||||||
| 372.1 | hypertaxoid B[d] | H. elatoides[a] | +13.1 (0.05, m)[b] | J.-Y. Xie 2026 | |||
|
|||||||
| 373.1 | hypertaxoid A[d] | H. elatoides[a] | +76.1 (0.05, m)[b] | J.-Y. Xie 2026 | |||
|
|||||||
| 374.1 | hypermonin A[c] | H. monogynum[a] | +46.5 (0.20, m)[b] | Y.-R. Zeng 2018 | |||
|
|||||||
| 375.1 | hypermonin B[c] | H. monogynum[a] | +155.42 (0.24, m)[b] | Y.-R. Zeng 2018 | |||
|
|||||||
| 376.1 | garciyunnanin G[c] | G. yunnanensis[a] | +28.7 (0.10, m)[b] | D. Zheng 2021b | |||
|
|||||||
| 377.1 | hyperjaponiol B[c] | H. japonicum [a]Thunb. ex Murray | +55.7 (0.1, m)[b] | Y. Liu 2026 | |||
|
|||||||
| 378.1 | R = Me X = OH |
harrisotone A | Harrisonia perforata | +2.0 (0.27, m)[b] | S. Yin 2009 | ||
| 378.2 | R = Me X = OOH |
harrisotone B | Harrisonia perforata | +25.4 (1.30, m)[b] | S. Yin 2009 | ||
| 378.3 | R = i-Pr X = OH |
tomoeone B | H. ascyron[a] | +9.5 (1.1, m)[b] | W. Hashida 2008 | ||
| 378.4 | R = i-Pr X = OOH |
tomoeone D | H. ascyron[a] | +10.4 (3.0, m)[b] | W. Hashida 2008, H. Zhu 2015a | ||
| 378.5 | R = i-Bu X = OH |
tomoeone F | H. ascyron[a] | +1.8 (1.8, m)[b] | W. Hashida 2008 | ||
| 378.6 | R = i-Bu X = OOH |
tomoeone H | H. ascyron[a] | +5.2 (2.7, m)[b] | W. Hashida 2008, H. Zhu 2015a | ||
| 378.7 | R = Ph X = OH |
hyperbeanol A | H. beanii[a] | +2.74 (0.21)[b] | X.-Q. Chen 2011 | ||
| 378.8 | R = Ph X = OOH |
hyperpatulol B[c] | H. patulum[a] | −35.2 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
|
|||||||
| 379.1 | R1 = i-Pr R2 = Me X = H |
hypulatone D | H. patulum[a] | –12 (0.1, m)[b] | Y.-F. Qiu 2026 | ||
| 379.2 | R1 = i-Pr R2 = prenyl X = OH |
hyperascyrone D[c] | H. ascyron[a] | −7.8 (0.48, m)[b] | H. Zhu 2015a | ||
| 379.3 | R1 = i-Pr R2 = prenyl X = OOH |
hookerianone E, a.k.a. hyperiforin C[c] | H. hookerianum, H. forrestii[a] | +30 (0.1, m)[b], +53.0 (0.1, m)[b] | Q.-Q. Wang 2020, J.-F. Zong 2021 | ||
| 379.4 | R1 = i-Bu R2 = prenyl X = OH |
hyperascyrone E[c] | H. ascyron[a] | −9.1 (0.68, m)[b] | H. Zhu 2015a | ||
| 379.5 | R1 = Ph R2 = prenyl X = OH |
hyperpatulol A | H. beanii[a] | +14.27 (0.34)[b] | X.-Q. Chen 2011, X. Liu 2026 | ||
|
|||||||
| 380.1 | R1 = Me R2 = prenyl R3 = prenyl X1 = H X2 = H |
harperoid B | Harrisonia perforata | +15 (0.4, m)[b] | P.-P. An 2026 | ||
| 380.2 | R1 = Me R2 = prenyl R3 = prenyl X1 = OH X2 = H |
harrisotone C | Harrisonia perforata | +11.1 (0.80, m)[b] | S. Yin 2009 | ||
| 380.3 | R1 = Me R2 = prenyl R3 = prenyl X1 = OOH X2 = H |
harrisotone E | Harrisonia perforata | +22.1 (0.09, m)[b] | S. Yin 2009 | ||
| 380.4 | R1 = Et R2 = prenyl R3 = Me X1 = OH X2 = H |
hyperpatulone F[c] one of two by that name | H. patulum[a] | +22.8 (1.0, m)[b] | Z.-N. Wu 2019 | ||
| 380.5 | R1 = i-Pr R2 = Me R3 = prenyl X1 = OH X2 = H |
chipericumin C | H. chinense, H. pyramidatum[a] | +35.1 (0.33, m)[b] | S. Abe 2012, R. Force 2014 | ||
| 380.6 | R1 = i-Pr R2 = Me R3 = prenyl X1 = OOH X2 = H |
pyramidatone D | H. pyramidatum[a] | +20.0 (0.009)[b] | R. Force 2014 | ||
| 380.7 | R1 = i-Pr R2 = prenyl R3 = Me X1 = OH X2 = H |
pyramidatone A, a.k.a. chipericumin E | H. pyramidatum, H. riparium[a] | +12.5 (0.005)[b], +12.0 (0.5, m)[b] | R. Force 2014, M. F. Tala 2015 | ||
| 380.8 | R1 = i-Pr R2 = prenyl R3 = Me X1 = OOH X2 = H |
pyramidatone B | H. pyramidatum[a] | +15.5 (0.03)[b] | R. Force 2014 | ||
| 380.9 | R1 = i-Pr R2 = prenyl R3 = Me X1 = OH X2 = OH |
hyperpatulol F[c] | H. patulum[a] | +14.0 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
| 380.10 | R1 = i-Pr R2 = prenyl R3 = prenyl X1 = OH X2 = H |
tomoeone A[c] | H. ascyron[a] | +33.2 (2.9, m)[b] | W. Hashida 2008, Y.-L. Hu 2023 | ||
| 380.11 | R1 = i-Pr R2 = prenyl R3 = prenyl X1 = OOH X2 = H |
tomoeone C | H. ascyron[a] | +17.4 (4.9, m)[b] | W. Hashida 2008, H. Zhu 2015a, Y.-L. Hu 2023 | ||
| 380.12 | R1 = s-Bu R2 = prenyl R3 = Me X1 = OH X2 = H |
chipericumin D[e] | H. chinense[a] | +67.4 (0.33, m)[b] | S. Abe 2012 | ||
| 380.13 | R1 = s-Bu R2 = prenyl R3 = prenyl X1 = OH X2 = H |
hyperascyrone F[c][e] | H. ascyron[a] | +41.1 (0.13, m)[b] | H. Zhu 2015a | ||
| 380.14 | R1 = s-Bu R2 = prenyl R3 = prenyl X1 = OOH X2 = H |
hookerianone D[c][e] | H. hookerianum[a] | +14 (0.1, m)[b] | Q.-Q. Wang 2020 | ||
| 380.15 | R1 = i-Bu R2 = prenyl R3 = Me X1 = OH X2 = H |
hyperpatulone C[c] (one of two by that name) | H. patulum[a] | +81.8 (0.10, m)[b] | Y.-x. Zhang 2021 | ||
| 380.16 | R1 = i-Bu R2 = prenyl R3 = prenyl X1 = OH X2 = H |
tomoeone E | H. ascyron, H. cohaerens[a] | +40.3 (1.0, m)[b] | W. Hashida 2008, J.-J. Zhang 2014a | ||
| 380.17 | R1 = i-Bu R2 = prenyl R3 = prenyl X1 = OOH X2 = H |
tomoeone G | H. ascyron[a] | +25.4 (1.7, m)[b] | W. Hashida 2008, H. Zhu 2015a | ||
| 380.18 | R1 = Ph R2 = prenyl R3 = prenyl X1 = OH X2 = H |
hyperbeanol C | H. beanii[a] | +31.21 (0.19)[b] | X.-Q. Chen 2011 | ||
| 380.19 | R1 = Ph R2 = prenyl R3 = prenyl X1 = OOH X2 = H |
hyperbeanol D | H. beanii[a] | +42.73 (0.42)[b] | X.-Q. Chen 2011 | ||
|
|||||||
| 381.1 | hyperpatulone D[c] (one of two by that name) | H. patulum[a] | +83.6 (0.10, m)[b] | Y.-x. Zhang 2021 | |||
|
|||||||
| 382.1 | R1 = Me R2 = prenyl R3 = prenyl X = OH |
harrisotone D | Harrisonia perforata | +4.1 (0.12, m)[b] | S. Yin 2009 | ||
| 382.2 | R1 = i-Pr R2 = Me R3 = prenyl X = OH |
monosescinol C[c] | H. longistylum[a] | −30.0 (0.4, m)[b] | Z. Shi 2024 | ||
| 382.3 | R1 = i-Pr R2 = prenyl R3 = Me X = OH |
hyperpatulol C, and tautomer hypericumono C[c] | H. monogynum, H. patulum[a] | +18.8 (0.1, m)[b]; −135.323 (0.15, m)[b] | Y.-Y. Liu 2019 | ||
| 382.4 | R1 = i-Pr R2 = prenyl R3 = Me X = OOH |
pyramidatone C | H. pyramidatum[a] | +17.3 (0.01)[b] | R. Force 2014 | ||
| 382.5 | R1 = (R)-s-Bu R2 = Me R3 = prenyl X = OH |
monosescinol B[c] | H. longistylum[a] | −37.3 (0.5, m)[b] | Z. Shi 2024 | ||
| 382.6 | R1 = (R)-s-Bu R2 = prenyl R3 = prenyl X = OH |
hyperlagarol I[c] | H. beanii[a] | NR | R.-D. Hu 2024 | ||
| 382.7 | R1 = (S)-s-Bu R2 = prenyl R3 = prenyl X = OH |
hyperlagarol H[c] | H. beanii[a] | NR | R.-D. Hu 2024 | ||
| 382.8 | R1 = Ph R2 = prenyl R3 = prenyl X = OH |
hyperbeanol B | H. patulum[a] | +34.2 (0.1, m)[b] | Y.-Y. Liu 2019, X. Liu 2026 | ||
|
|||||||
| 383.1 | R = i-Pr | hyperpatulol D[c] | H. patulum[a] | +2.2 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
| 383.2 | R = s-Bu | hyperpatulol E[c][e] | H. patulum[a] | +10.6 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
|
|||||||
| 384.1 | hunascynol I (or its epimer, hunascynol J) |
H. ascyron[a] | −0.7 (0.09, m)[b] | Y.-L. Hu 2023 | |||
|
|||||||
| 385.1 | hunascynol J (or its epimer, hunascynol I) |
H. ascyron[a] | −1.2 (0.11, m)[b] | Y.-L. Hu 2023 | |||
|
|||||||
| 386.1 | R1 = i-Pr R2 = Me X = H |
kouytchin B[d][m] | H. kouytchense[a] | +27.1 (0.5, m)[b] | C. Jing 2026 | ||
| 386.2 | R1 = i-Pr R2 = prenyl X = OH |
hyperascyrone B[d] | H. ascyron[a] | −4.8 (0.24, m)[b] | H. Zhu 2015a | ||
| 386.3 | R1 = i-Bu R2 = prenyl X = OH |
hyperascyrone C[d] | H. ascyron[a] | −3.8 (0.38, m)[b] | H. Zhu 2015a | ||
| 386.4 | R1 = Ph R2 = prenyl X = OH |
hyperascyrone A[d] | H. ascyron[a] | −16.4 (0.33, m)[b] | H. Zhu 2015a | ||
|
|||||||
| 387.1 | R1 = i-Pr R2 = prenyl X = H |
hunascynol H | H. ascyron[a] | +50 (0.10, m)[b] | Y.-L. Hu 2023 | ||
| 387.2 | R1 = i-Pr R2 = prenyl X = OH |
spirohypatone B[c] | H. patulum[a] | +23.03 (0.101, m)[b] | Y. Ye 2020 | ||
| 387.3 | R1 = i-Bu R2 = Me X = OH |
spihyperglucinol E[c] | H. longistylum[a] | −18.3 (0.3, m)[b] | Z. Shi 2022 | ||
| 387.4 | R1 = i-Bu R2 = prenyl X = H |
hunascynol G | H. ascyron[a] | +53 (0.10, m)[b] | Y.-L. Hu 2023 | ||
| 387.5 | R1 = i-Bu R2 = prenyl X = OH |
hunascynol F[c] | H. ascyron[a] | −6.0 (0.10, m)[b] | Y.-L. Hu 2023 | ||
| 387.6 | R1 = (R)-s-Bu R2 = Me X = H |
hyperpatulone E[c] | H. patulum[a] | +44.3 (0.20, m)[b] | Y.-x. Zhang 2021 | ||
| 387.7 | R1 = (S)-s-Bu R2 = Me X = H |
hyperpatulone F[c] (one of two by that name) | H. patulum[a] | +12.4 (0.10, m)[b] | Y.-x. Zhang 2021 | ||
| 387.8 | R1 = s-Bu R2 = Me X = OH |
hyperielliptone HB[c][e] | H. geminiflorum[a] | +1.0 (1)[b] | C.-C. Wu 2008b, Z. Shi 2022 | ||
| 387.9 | R1 = (R)-s-Bu R2 = prenyl X = OH |
hunascynol D[c] | H. ascyron[a] | +5.0 (0.12, m)[b] | Y.-L. Hu 2023 | ||
| 387.10 | R1 = (S)-s-Bu R2 = prenyl X = OH |
hunascynol E[c] | H. ascyron[a] | +18 (0.15, m)[b] | Y.-L. Hu 2023 | ||
| 387.11 | R1 = Ph R2 = prenyl X = OH |
hyperbeanin C[c] | H. beanii[a] | +34.5 (0.12, m)[b] | Y. Ma 2022a | ||
|
|||||||
| 388.1 | R1 = i-Pr R2 = Me |
chipericumin A | H. chinense[a] | +84.3 (0.29, m)[b] | S. Abe 2012 | ||
| 388.2 | R1 = s-Bu R2 = Me |
chipericumin B[e] | H. chinense[a] | +116.1 (0.46, m)[b] | S. Abe 2012 | ||
| 388.3 | R1 = Ph R2 = prenyl |
sampsonol A | H. sampsonii[a] | −7.7 (0.5, mc)[b] | W. Xin 2012 | ||
|
|||||||
| 389.1 | sampsonol B | H. sampsonii[a] | +45.3 (0.5, mc)[b] | W. Xin 2012 | |||
|
|||||||
| 390.1 | hyperhenone L | H. henryi[a] | −6 (0.08, m)[b] | Y.-T. Duan 2018 | |||
|
|||||||
| 391.1 | lagarocladone B[c] | H. lagarocladum[a] | +63.8 (0.1, m)[b] | L.-T. Lai 2026 | |||
|
|||||||
| 392.1 | hyperacmotone D[c] | H. acmosepalum[a] | +20 (0.10, m)[b] | A.-Z. Wang 2022 | |||
|
|||||||
| 393.1 | hyperacmotone E[c] | H. acmosepalum[a] | –1 (0.10, m)[b] | A.-Z. Wang 2022 | |||
|
|||||||
| 394.1 | hyperacmotone F[c] | H. acmosepalum[a] | +60 (0.10, m)[b] | A.-Z. Wang 2022 | |||
|
|||||||
| 395.1 | hypericumono A[c] | H. monogynum[a] | +24.443 (0.06, m)[b] | Y.-R. Zeng 2026 | |||
|
|||||||
| 396.1 | R = i-Bu | spiropatuol G[c] | H. patulum[a] | +3.0 (0.1, m)[b] | Z. Shi 2026 | ||
| 396.2 | R = s-Bu | spiropatuol H[c][e] | H. patulum[a] | +11.6 (0.1, m)[b] | Z. Shi 2026 | ||
|
|||||||
| 397.1 | R1 = Me R2 = prenyl R3 = prenyl X = H |
harperoid C | Harrisonia perforata | +26 (0.4, m)[b] | P.-P. An 2026 | ||
| 397.2 | R1 = i-Pr R2 = Me R3 = prenyl X = H |
sampsonol F | H. sampsonii[a] | +12.4 (0.5, mc)[b] | W. Xin 2012 | ||
| 397.3 | R1 = i-Pr R2 = prenyl R3 = Me X = H |
hyperhenone I | H. henryi[a] | −516 (0.12, m)[b] | Y.-T. Duan 2018 | ||
| 397.4 | R1 = i-Pr R2 = prenyl R3 = prenyl X = H |
hyperlagarin A | H. lagarocladum[a] | −87.9 (0.29, m)[b] | K. Wang 2019 | ||
| 397.5 | R1 = i-Bu R2 = Me R3 = prenyl X = H |
sampsonol E | H. sampsonii[a] | +25.8 (0.5, mc)[b] | W. Xin 2012 | ||
| 397.6 | R1 = s-Bu R2 = Me R3 = prenyl X = H |
hyperhenone H[e] | H. henryi[a] | −71 (0.15, m)[b] | Y.-T. Duan 2018 | ||
| 397.7 | R1 = (S)-s-Bu R2 = Me R3 = prenyl X = H |
hyperpatulol G[cc] | H. patulum[a] | −40.6 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
| 397.8 | R1 = s-Bu R2 = prenyl R3 = Me X = H |
hypericumono E[c][e] | H. monogynum[a] | +48.000 (0.10, m)[b] | Y.-T. Duan 2018 | ||
| 397.9 | R1 = s-Bu R2 = prenyl R3 = prenyl X = H |
hyperlagarin B[e] | H. lagarocladum[a] | −87.9 (0.18, m)[b] | K. Wang 2019 | ||
| 397.10 | R1 = Ph R2 = prenyl R3 = Me X = H |
sampsonol C | H. sampsonii[a] | +16.5 (0.5, mc)[b] | W. Xin 2012 | ||
| 397.11 | R1 = Ph R2 = prenyl R3 = prenyl X = H |
hypercohone G | H. cohaerens[a] | −56.1 (0.16, m)[b] | J.-J. Zhang 2014a | ||
| 397.12 | R1 = Ph R2 = prenyl R3 = prenyl X = OH |
kouytchin A[c][m] | H. kouytchense[a] | −20.0 (0.5, m)[b] | C. Jing 2026 | ||
| 397.13 | R1 = Ph R2 = (E)-CH=CHCMe2OH R3 = Me X = H |
sampsonol D | H. sampsonii[a] | +35.2 (0.5, mc)[b] | W. Xin 2012 | ||
| 397.14 | R1 = Ph R2 = (E)-CH=CHCMe2OH R3 = prenyl X = H |
hyperhenone J | H. henryi[a] | −15 (0.22, m)[b] | Y.-T. Duan 2018 | ||
|
|||||||
| 398.1 | R1 = Me R2 = prenyl R3 = prenyl |
harperoid D | Harrisonia perforata | −22 (0.4, m)[b] | P.-P. An 2026 | ||
| 398.2 | R1 = i-Pr R2 = Me R3 = prenyl |
hyperhenone G | H. henryi[a] | −99 (0.07, m)[b] | Y.-T. Duan 2018 | ||
| 398.3 | R1 = i-Pr R2 = prenyl R3 = Me |
hyperpatulol I[c] | H. patulum[a] | −9.4 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
| 398.4 | R1 = i-Pr R2 = prenyl R3 = prenyl |
hyperlagarin C | H. lagarocladum[a] | −89.7 (0.25, m)[b] | K. Wang 2019 | ||
| 398.5 | R1 = (S)-s-Bu R2 = prenyl R3 = Me |
hyperpatulol H[c] | H. patulum[a] | −31.2 (0.1, m)[b] | Y.-Y. Liu 2019 | ||
| 398.6 | R1 = Ph R2 = prenyl R3 = prenyl |
hyperbeanol F | H. beanii[a] | −46 (0.5, m)[b] | Y.-R. Li 2019 | ||
|
|||||||
| 399.1 | hyperbeanol G | H. beanii[a] | +15 (0.09, m)[b] | Y.-R. Li 2019 | |||
|
|||||||
| 400.1 | hypehenol A[c] | H. henryi[a] | +8.6 (0.23, m)[b] | T. Yue 2026 | |||
|
|||||||
| 401.1 | R = i-Pr | hypehenol B[c] | H. henryi[a] | +6.2 (0.19, m)[b] | T. Yue 2026 | ||
| 401.2 | R = s-Bu | hypehenol C[c][e] | H. henryi[a] | +10.8 (0.33, m)[b] | T. Yue 2026 | ||
|
|||||||
| 402.1 | hunascynol A, a.k.a. hyperlagarol A | H. ascyron, H. beanii[a] | +15 (0.5, m)[b] | Y.-L. Hu 2023, R.-D. Hu 2024 | |||
|
|||||||
| 403.1 | hunascynol B, a.k.a. hyperlagarol B | H. ascyron, H. beanii[a] | +57 (0.14, m)[b] | Y.-L. Hu 2023, R.-D. Hu 2024 | |||
|
|||||||
| 404.1 | hyperlagarol G[c] | H. beanii[a] | NR | R.-D. Hu 2024 | |||
|
|||||||
| 405.1 | hunascynol C | H. ascyron[a] | +29 (0.14, m)[b] | Y.-L. Hu 2023 | |||
|
|||||||
| 406.1 | hyperpatulone G[c] | H. patulum[a] | +62.0 (0.10, m)[b] | Y.-x. Zhang 2021 | |||
|
|||||||
| 407.1 | hyperbeanol H | H. beanii[a] | +52 (0.7, m)[b] | Y.-R. Li 2019 | |||
|
|||||||
| 408.1 | R = i-Pr | hypericumono D[c] | H. monogynum[a] | −16.452 (0.24, m)[b] | Y.-R. Zeng 2026 | ||
| 408.2 | R = i-Bu | spiropatuol E[c] | H. patulum[a] | –45.5 (0.1, m)[b] | Z. Shi 2026 | ||
| 408.3 | R = s-Bu | spiropatuol F[c][e] | H. patulum[a] | –56.6 (0.1, m)[b] | Z. Shi 2026 | ||
|
|||||||
| 409.1 | hyperhenone K | H. henryi[a] | −6 (0.07, m)[b] | Y.-T. Duan 2018 | |||
|
|||||||
| 410.1 | R = i-Pr | spiropatuol D[c] | H. patulum[a] | +5.225 (0.4, m)[b] | Z. Shi 2026 | ||
| 410.2 | R = i-Bu | spiropatuol B[c] | H. patulum[a] | +2.7 (0.5, m)[b] | Z. Shi 2026 | ||
| 410.3 | R = s-Bu | spiropatuol C[c][e] | H. patulum[a] | –10.5 (0.3, m)[b] | Z. Shi 2026 | ||
|
|||||||
| 411.1 | hyperispirone B[c] | H. beanii[a] | −53 (0.18, m)[b] | B. Yang 2022 | |||
|
|||||||
| 412.1 | hyperispirone A[c] | H. beanii[a] | +70 (0.15, m)[b] | B. Yang 2022 | |||
|
|||||||
| 413.1 | hyperlagarol J[c] | H. beanii[a] | NR | R.-D. Hu 2024 | |||
|
|||||||
| 414.1 | R1 = i-Pr R2 = Me |
hymoin C[c] | H. monogynum[a] | −76.00 (0.11, m)[b] | Y.-R. Zeng 2021b | ||
| 414.2 | R1 = s-Bu R2 = Me |
hymoin D[c][e] | H. monogynum[a] | −30.22 (0.13, m)[b] | Y.-R. Zeng 2021b | ||
| 414.3 | R1 = Ph R2 = prenyl |
hypatulone A[c] | H. patulum[a] | +11.2 (0.10, m)[b] | Y.-Y. Liu 2018, X.-W. Yang 2020 | ||
|
|||||||
| 415.1 | R = i-Pr | hymoin A[c] (one of two by that name) | H. monogynum[a] | −78.50 (0.08, m)[b] | Y.-R. Zeng 2021b | ||
| 415.2 | R = s-Bu | hymoin B[c][e] (one of two by that name) | H. monogynum[a] | −64.29 (0.13, m)[b] | Y.-R. Zeng 2021b | ||
|
|||||||
| 416.1 | R = i-Pr | hyperilongenol C[c] | H. longistylum[a] | +82.3 (0.5, m)[b] | N. Zhang 2019a, N. Zhang 2019b | ||
| 416.2 | R = i-Bu | hyperilongenol B[c] | H. longistylum[a] | +85.2 (0.3, m)[b] | N. Zhang 2019a, N. Zhang 2019b | ||
| 416.3 | R = s-Bu | hyperilongenol A[c] (mixture of s-Bu epimers) | H. longistylum[a] | +89.4 (0.6, m)[b] | N. Zhang 2019a, N. Zhang 2019b | ||
|
|||||||
| 417.1 | hyperlagarol C[c] | H. beanii[a] | NR | R.-D. Hu 2024 | |||
|
|||||||
| 418.1 | hyperlagarol D[c] | H. beanii[a] | NR | R.-D. Hu 2024 | |||
|
|||||||
| 419.1 | R = i-Bu | spihyperglucinol A[c] | H. longistylum[a] | −130.0 (0.8, m)[b] | Z. Shi 2022 | ||
| 419.2 | R = s-Bu | spihyperglucinol B[c][e] | H. longistylum[a] | −112.6 (0.1, m)[b] | Z. Shi 2022 | ||
|
|||||||
| 420.1 | R = i-Bu | spihyperglucinol C[c] | H. longistylum[a] | −53.4 (0.4, m)[b] | Z. Shi 2022 | ||
| 420.2 | R = s-Bu | spihyperglucinol D[c][e] | H. longistylum[a] | −61.6 (0.4, m)[b] | Z. Shi 2022 | ||
|
|||||||
| 421.1 | hypericumono F[c] | H. monogynum[a] | −40.000 (0.10, m)[b] | Y.-R. Zeng 2026 | |||
|
|||||||
| 422.1 | R = Me | biyouyanagiol[y] | H. chinense[a] | +10.5 (0.5)[b] | N. Tanaka 2009a | ||
| 422.2 | R = prenyl | uralin D[c] | H. uralum[a] | +32 (0.1, m)[b] | Q.-Q. Fang 2021 | ||
|
|||||||
| 423.1 | R = i-Pr | biyoulactone D | H. chinense[a] | −39.4 (0.1, m)[b] | N. Tanaka 2012 | ||
| 423.2 | R = s-Bu | biyoulactone E[e] | H. chinense[a] | −14.4 (0.07, m)[b] | N. Tanaka 2012 | ||
|
|||||||
| 424.1 | hyperbeanone A[c] | H. beanii[a] | −134 (0.15, m)[b] | B. Yang 2021a | |||
|
|||||||
| 425.1 | R = i-Pr | hypermonone B[c] | H. monogynum[a] | +56.31 (0.07, m)[b] | Y.-R. Zeng 2021c | ||
| 425.2 | R = s-Bu | hypermonone C[c][e] | H. monogynum[a] | −40.83 (0.07, m)[b] | Y.-R. Zeng 2021c | ||
|
|||||||
| 426.1 | hypermonone D[c] | H. monogynum[a] | +47.26 (0.12, m)[b] | Y.-R. Zeng 2021c | |||
|
|||||||
| 427.1 | hypermonone A[c] | H. monogynum[a] | +123.49 (0.09, m)[b] | Y.-R. Zeng 2021c | |||
|
|||||||
| 428.1 | R = i-Pr | hybeanone B[c] | H. beanii[a] | +72.3 (0.17, m)[b] | B. Yang 2021b | ||
| 428.2 | R = (S)-s-Bu | hybeanone A[c] | H. beanii[a] | +48.9 (0.09, m)[b] | B. Yang 2021b | ||
|
|||||||
| 429.1 | R = i-Pr | hypermonol A[c] | H. monogynum[a] | +25.8 (0.1, m)[b] | J. Wei 2024b | ||
| 429.2 | R = (S)-s-Bu | hypermonol E[c] | H. monogynum[a] | +18.8 (0.1, m)[b] | J. Wei 2024b | ||
|
|||||||
| 430.1 | R = i-Pr | hypermonol B[c] | H. monogynum[a] | −64.6 (0.1, m)[b] | J. Wei 2024b | ||
| 430.2 | R = (R)-s-Bu | hypermonol C[c] | H. monogynum[a] | +10.4 (0.1, m)[b] | J. Wei 2024b | ||
| 430.3 | R = (S)-s-Bu | hypermonol D[c] | H. monogynum[a] | +5.4 (0.1, m)[b] | J. Wei 2024b | ||
|
|||||||
| 431.1 | biyoulactone A[c] | H. chinense[a] | +8.1 (0.1, m)[b] | N. Tanaka 2011 | |||
|
|||||||
| 432.1 | R = i-Pr | hypemoin A[c] | H. monogynum[a] | +24 (0.2, m)[b] | Y.-N. Li 2011 | ||
| 432.2 | R = (S)-s-Bu | biyoulactone B | H. chinense[a] | +9.7 (0.2, m)[b] | N. Tanaka 2011 | ||
|
|||||||
| 433.1 | R = i-Pr | hypemoin B[c] | H. monogynum[a] | +48 (0.2, m)[b] | Y.-N. Li 2011 | ||
| 433.2 | R = (S)-s-Bu | biyoulactone C | H. chinense[a] | +15.7 (0.09, m)[b] | N. Tanaka 2011 | ||
|
|||||||
| 434.1 | R1 = i-Pr R2 = Me |
furanmonogone B[c][e] | H. monogynum[a] | −8 (0.1, m)[b] | W.-J. Xu 2017 | ||
| 434.2 | R1 = i-Pr R2 = (E)-CH=CHCMe2OH |
hyperascone A[c][aa] | H. ascyron[a] Linn. | +6.3 (0.03, m)[b] | S. Wang 2024 | ||
| 434.3 | R1 = i-Bu R2 = (E)-CH=CHCMe2OH |
hyperascone B[c][aa] | H. ascyron[a] Linn. | +5.7 (0.03, m)[b] | S. Wang 2024 | ||
| 434.4 | R1 = s-Bu R2 = Me |
furanmonogone A[c][e] | H. monogynum[a] | −12 (0.1, m)[b] | W.-J. Xu 2017 | ||
| 434.5 | R1 = Ph R2 = (E)-CH=CHCMe2OH |
hyperhenone M[e] | H. henryi[a] | −31 (0.10, m)[b] | Y.-T. Duan 2018 | ||
|
|||||||
| 435.1 | R = H | hypemoin E[c] | H. monogynum[a] | −76 (0.1, m)[b] | Y.-N. Li 2011 | ||
| 435.2 | R = CO2Me | hypemoin D[c] | H. monogynum[a] | +52 (0.1, m)[b] | Y.-N. Li 2011 | ||
| 435.3 | R = COCHMeCH2CH=CMe2 | hypemoin C[c][e] | H. monogynum[a] | +48 (0.2, m)[b] | Y.-N. Li 2011 | ||
|
|||||||
| 436.1 | longisglucinol A[c] | H. longistylum[a] | −31.2 (0.5, m)[b] | N. Zhang 2020 | |||
|
|||||||
| 437.1 | hymoin B[c] (one of two by that name) | H. monogynum[a] | +160.00 (0.10, m)[b] | C. Yuan 2025 | |||
|
|||||||
| 438.1 | R1 = i-Pr R2 = Me |
spirohypatone A[c] | H. patulum[a] | +105.54 (0.10, m)[b] | Y. Ye 2020 | ||
| 438.2 | R1 = i-Bu R2 = Me |
longisglucinol C[c][ff] | H. longistylum[a] | +99.8 (0.5, m)[b] | N. Zhang 2020 | ||
| 438.3 | R1 = (S)-s-Bu R2 = Me |
longisglucinol B[c][ff] | H. longistylum[a] | +106.9 (0.5, m)[b] | N. Zhang 2020 | ||
| 438.4 | R1 = Ph R2 = prenyl |
hyperacmotone C[c] | H. acmosepalum[a] | +101 (0.20, m)[b] | A.-Z. Wang 2022 | ||
|
|||||||
| 439.1 | R = Me | harperoid A[c] | Harrisonia perforata | +12 (0.2, m)[b] | P.-P. An 2026 | ||
| 439.2 | R = i-Pr | spiropatuol A[c] | H. patulum[a] | +60.625 (0.1, m)[b] | Z. Shi 2026 | ||
|
|||||||
| 440.1 | hymoin A[c] (one of two by that name) | H. monogynum[a] | +77.92 (0.15, m)[b] | C. Yuan 2025 | |||
|
|||||||
| 441.1 | hyperzrone A[c] | H. beanii[a] | +19.8 (0.1, m)[b] | X.-Y. Li 2025 | |||
|
|||||||
| 442.1 | hyperzrone B[c] | H. beanii[a] | −1.7 (0.1, m)[b] | X.-Y. Li 2025 | |||
Statistics
There are 1492 compounds listed.
| Feature | Number |
|---|---|
| bicyclo[3.3.1]nonanes | 1153 |
| bicyclo[3.2.1]octanes | 28 |
| bicyclo[2.2.2]octanes | 88 |
| other bridged bicyclics | 53 |
| spiroindanes | 159 |
| spiropentalanes | 9 |
| other spiro compounds | 2 |
| exo at C(7) | 584 |
| endo at C(7) | 538 |
| two substituents at C(3) (not caged) | 98 |
| no substituent at C(7) | 2 |
| no substituent at C(3) | 5 |
| acyloxy substituent at C(3) | 9 |
| type A | 897 |
| type B | 353 |
| uncaged | 837 |
| caged | 431 |
| seco and nor | 268 |
| enamine replacing carbonyl | 8 |
| dimer | 2 |
| trans-hydrindane | 114 |
| cis-hydrindane | 32 |
| enantiomeric pairs (including probable ones) | 0 |
The Grossman–Jacobs and Rastrelli rules are:
| C(7) orientation | ΔδH(6) | δC(7) | JH(6ax)–H(7) |
|---|---|---|---|
| exo | 0.3–1.2 ppm | 41–44 ppm | 10–13 Hz |
| endo | either 0.0–0.2 ppm | or 45–49 ppm | 6–8 Hz |
Footnote
Structure source (MDL Molfile)
Text is pre-selected — press ⌘C (Ctrl-C) to copy, or use the Copy button above.

